Jump to content

Mannosulfan: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drugbox
+sd
 
(16 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{drugbox
{{Drugbox
| verifiedrevid = 444359259
| IUPAC_name = 1,2,5,6-Tetrakis-O-(methylsulfonyl)-<small>D</small>-mannitol
| image = Mannosulfan.png

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 7518-35-6
| ATC_prefix = L01
| ATC_suffix = AB03
| ATC_supplemental =
| PubChem = 24140
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 135FQ40L36
| UNII = 135FQ40L36
| ChemSpiderID = 16736959
| verifiedrevid = 443410102

| IUPAC_name = 1,2,5,6-tetrakis-''O''-(methylsulfonyl)-<small>D</small>-mannitol

|synonyms=<small>[(2''R'',3''S'',4''S'',5''R'')-3,4-dihydroxy-2,5,6-tris(methylsulfonyloxy)hexyl] methanesulfonate</small>
<!--Chemical data-->
| image = Mannosulfan.png
| chemical_formula =
| CAS_number =
| CAS_supplemental =
| ATC_prefix = L01
| ATC_suffix = AB03
| ATC_supplemental =
| PubChem = 24140
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| chemical_formula =
| C=10 | H=22 | O=14 | S=4
| C=10 | H=22 | O=14 | S=4
| smiles = CS(=O)(=O)OC[C@H]([C@H]([C@@H]([C@@H](COS(=O)(=O)C)OS(=O)(=O)C)O)O)OS(=O)(=O)C
| molecular_weight = 494.53 g/mol
| synonyms = <small>[(2''R'',3''S'',4''S'',5''R'')-3,4-dihydroxy-2,5,6-tris(methylsulfonyloxy)hexyl] methanesulfonate</small>
| smiles = CS(=O)(=O)OC[C@H]([C@H]([C@@H]([C@@H](COS(=O)(=O)C)OS(=O)(=O)C)O)O)OS(=O)(=O)C
| StdInChI = 1S/C10H22O14S4/c1-25(13,14)21-5-7(23-27(3,17)18)9(11)10(12)8(24-28(4,19)20)6-22-26(2,15)16/h7-12H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1
| bioavailability =
| StdInChIKey = UUVIQYKKKBJYJT-ZYUZMQFOSA-N}}
| protein_bound =

| metabolism =
'''Mannosulfan''' ([[International Nonproprietary Name|INN]]) is an [[alkylating antineoplastic agent|alkylating agent]] with the potential for the treatment of [[cancer]]. It is not approved by the United States FDA for cancer treatment. Research suggests it is less toxic than the alkyl sulfonate [[Busulfan]].<ref>{{Cite book | vauthors = Jeswani G, Paul SD |doi=10.1016/B978-0-323-52727-9.00015-7 |chapter=Recent Advances in the Delivery of Chemotherapeutic Agents |title=Nano- and Microscale Drug Delivery Systems |pages=281–98 |year=2017 |isbn=978-0-323-52727-9 }}</ref>
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}


==References==
'''Mannosulfan''' ([[International Nonproprietary Name|INN]]) is an [[alkylating antineoplastic agent|alkylating agent]] used in the treatment of [[cancer]].
{{reflist}}


==External links==
*{{Commonscatinline}}


{{Chemotherapeutic agents}}
{{Chemotherapeutic agents}}
{{Alcohols}}


[[Category:Sulfonate esters]]
[[Category:Alkylsulfonates]]
[[Category:Mesylate esters]]
[[Category:Monosaccharides]]
[[Category:Monosaccharides]]
[[Category:Alkylating antineoplastic agents]]
[[Category:Alkylating antineoplastic agents]]