Jump to content

Megaphone (molecule): Difference between revisions

Page 1
Page 2
Content deleted Content added
m Journal cites:, added 1 DOI, using AWB (7794)
add semisystematic name
 
(23 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{chembox
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 431371149
| Watchedfields = changed
| verifiedrevid = 445399695
| Name = Megaphone
| Name = Megaphone
| ImageFile = megaphone chemical structure.png
| ImageFile = megaphone chemical structure.png
| ImageSize = 200px
| ImageName = Chemical structure of megaphone
| ImageName = Chemical structure of megaphone
| IUPACName = 6-[1-hydroxy-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-4-methoxy-6-prop-2-enylcyclohex-2-en-1-one
| IUPACName = (1′''R'',5′''R'',7''R'',8''S'')-7-Hydroxy-3,4,5,5′-methoxy-5′,6′-dihydro-2′''H''-8,1′-neolign-8′-en-2′-one
| SystematicName = (4''R'',6''R'')-6-[(1''R'',2''S'')-1-Hydroxy-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-4-methoxy-6-(prop-2-en-1-yl)cyclohex-2-en-1-one
| OtherNames = <!-- <br> -->
| OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 64332-37-2
| CASNo = 64332-37-2
| CASNo_Ref =
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| CASOther =
| UNII = 8J0BV7D5N9
| PubChem = 324150
| PubChem = 324150
| SMILES = O=C1C=C[C@H](OC)C[C@]1(CC=C)[C@H](C)[C@@H](O)C2=CC(OC)=C(OC)C(OC)=C2
| SMILES = O=C1C=C[C@H](OC)C[C@]1(CC=C)[C@H](C)[C@@H](O)C2=CC(OC)=C(OC)C(OC)=C2
| CASNo =
| PubChem2 = 442908
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 442908
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 391211
| ChemSpiderID = 391211
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C22H30O6/c1-7-10-22(13-16(25-3)8-9-19(22)23)14(2)20(24)15-11-17(26-4)21(28-6)18(12-15)27-5/h7-9,11-12,14,16,20,24H,1,10,13H2,2-6H3/t14-,16+,20-,22-/m1/s1
| StdInChI = 1S/C22H30O6/c1-7-10-22(13-16(25-3)8-9-19(22)23)14(2)20(24)15-11-17(26-4)21(28-6)18(12-15)27-5/h7-9,11-12,14,16,20,24H,1,10,13H2,2-6H3/t14-,16+,20-,22-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JCRROBQLLRCCAV-SQKDIAQBSA-N
| StdInChIKey = JCRROBQLLRCCAV-SQKDIAQBSA-N
| InChI =
| InChI =
| MeSHName =
| MeSHName =
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| C=22|H=30|O=6
| C=22 | H=30 | O=6
| ExactMass = 390.204239 u
| Appearance =
| Appearance =
| Density = 1.242 g/cm<sup>3</sup>
| Density = 1.242 g/cm<sup>3</sup>
| MeltingPt = 152 °C
| MeltingPtC = 152
| MeltingPt_notes =
| BoilingPt = <!-- °C -->
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
}}
}}


'''Megaphone''' is a [[Cytotoxicity|cytotoxic]] [[neolignan]] obtained from ''[[Aniba megaphylla]]'', a [[flowering plant]] of [[Lauraceae|Laurel family]] which gave the compound its name. Megaphone has also been prepared synthetically.<ref>{{cite journal|last1=Zoretic|first1=P|title=Total synthesis of d,1-megaphone|journal=Tetrahedron Letters|volume=24|pages=1125|year=1983|doi=10.1016/S0040-4039(00)86382-0}}</ref><ref>{{Cite journal|doi = 10.1016/S0040-4039(00)61960-3|title = Enantiospecific total synthesis of (-)-megaphone by a highly controlled consecutive 1,4- and 1,3-asymmetric induction|author = Tomioka, Kiyoshi; Kawasaki, Hisashi; Iitaka, Yoichi; Koga, Kenji|journal = Tetrahedron Letters |year = 1985|volume = 26|issue = 7|pages = 903–906}}</ref><ref>{{cite journal|doi=10.1021/ja00400a039|last1=Buechi|first1=George|year=1981|pages=2718|volume=103|journal=Journal of the American Chemical Society|last2=Chu|first2=Ping-Sun|title=The Synthesis of Megaphone}}</ref>
'''Megaphone''' is a [[Cytotoxicity|cytotoxic]] [[neolignan]] obtained from ''[[Aniba megaphylla]]'', a [[flowering plant]] of [[Lauraceae|Laurel family]] which gave the compound its name. Megaphone has also been prepared synthetically.<ref>{{cite journal|last1=Zoretic|first1=P|title=Total synthesis of d,l-megaphone|journal=Tetrahedron Letters|volume=24|issue=11|pages=1125–1128|year=1983|doi=10.1016/S0040-4039(00)86382-0}}</ref><ref>{{Cite journal|doi = 10.1016/S0040-4039(00)61960-3|title = Enantiospecific total synthesis of (-)-megaphone by a highly controlled consecutive 1,4- and 1,3-asymmetric induction|author1=Tomioka, Kiyoshi |author2=Kawasaki, Hisashi |author3=Iitaka, Yoichi |author4=Koga, Kenji |journal = Tetrahedron Letters |year = 1985|volume = 26|issue = 7|pages = 903–906}}</ref><ref>{{cite journal|doi=10.1021/ja00400a039|last1=Buechi|first1=George|year=1981|pages=2718|volume=103|issue=10|journal=Journal of the American Chemical Society|last2=Chu|first2=Ping-Sun|title=The Synthesis of Megaphone}}</ref>


Studies carried out in the 1960s demonstrated that an alcoholic extract of the ground root of ''Aniba megaphylla'' inhibited, ''in vitro'', growth of cells derived from human [[carcinoma]] of the [[nasopharynx]]. In 1978, the active components of the extract were isolated using [[silica gel]] [[chromatography]], characterized and named as megaphone (C<sub>22</sub>H<sub>30</sub>O<sub>6</sub>, solid), megaphone [[acetate]] (C<sub>24</sub>H<sub>32</sub>O<sub>7</sub>, oily liquid) and megaphyllone acetate (C<sub>23</sub>H<sub>28</sub>O<sub>7</sub>, oily liquid). For comparison, megaphone acetate was also produced synthetically by reacting megaphone with [[acetic anhydride]] at 50 °C for 6 hours. Stirring an alcoholic solution of megaphone (megaphone acetate), with added palladium catalyst, in hydrogen atmosphere, followed by evaporation of the solvent yields tetrahydromegaphone (tetrahydromegaphone acetate) as an oil. Millimeter-sized crystals of megaphone can be grown from an [[ether]]-[[chloroform]] solution.<ref name=j1/> They have monoclinic symmetry with [[space group]] ''P''2<sub>1</sub>, lattice constants ''a'' = 0.8757 nm, ''b'' = 1.1942 nm and ''c'' = 1.0177 nm and two [[formula unit]]s per [[unit cell]]. Megaphone and megaphone acetate molecules are [[Chirality (chemistry)|chiral]] and the reported extraction and synthesis procedures yielded their [[racemic mixture]]s.<ref name=j1>{{cite journal|doi = 10.1021/jo00398a013|author = SM Kupchan, KL Stevens, EA Rohlfing, BR Sickles, AT Sneden, RW Miller, RF Bryan|title = Tumor inhibitors. 126. New cytotoxic neolignans from Aniba megaphylla Mez|journal = J. Org. Chem.|volume = 43|issue = 4|year = 1978|pages = 586–590}}</ref> Megaphone acetate was also isolated from the root of ''Endlicheria dysodantha'', another plant of [[Lauraceae|Laurel family]], using chromatography of ethanolic solution. It showed inhibitory activity against cells of crown gall tumor and human lung, breast and colon carcinomas.<ref>{{cite journal|pmid=1665173|last1=Ma|first1=WW|year=1991|pages=1153–8|issue=4|last2=Kozlowski|volume=54|journal=Journal of natural products|first2=JF|last3=McLaughlin|first3=JL|title=Bioactive neolignans from Endlicheria dysodantha|doi=10.1021/np50076a045}}</ref>
Studies carried out in the 1960s demonstrated that an alcoholic extract of the ground root of ''Aniba megaphylla'' inhibited, ''in vitro'', growth of cells derived from human [[carcinoma]] of the [[nasopharynx]]. In 1978, the active components of the extract were isolated using [[silica gel]] [[chromatography]], characterized and named as megaphone (C<sub>22</sub>H<sub>30</sub>O<sub>6</sub>, solid), megaphone [[acetate]] (C<sub>24</sub>H<sub>32</sub>O<sub>7</sub>, oily liquid) and megaphyllone acetate (C<sub>23</sub>H<sub>28</sub>O<sub>7</sub>, oily liquid). For comparison, megaphone acetate was also produced synthetically by reacting megaphone with [[acetic anhydride]] at 50&nbsp;°C for 6 hours. Stirring an alcoholic solution of megaphone (megaphone acetate), with added palladium catalyst, in hydrogen atmosphere, followed by evaporation of the solvent yields tetrahydromegaphone (tetrahydromegaphone acetate) as an oil. Millimeter-sized crystals of megaphone can be grown from an [[diethyl ether|ether]]-[[chloroform]] solution.<ref name=j1/> They have monoclinic symmetry with [[space group]] ''P''2<sub>1</sub>, lattice constants ''a'' = 0.8757&nbsp;nm, ''b'' = 1.1942&nbsp;nm and ''c'' = 1.0177&nbsp;nm and two [[formula unit]]s per [[unit cell]]. Megaphone and megaphone acetate molecules are [[Chirality (chemistry)|chiral]] and the reported extraction and synthesis procedures yielded their [[racemic mixture]]s.<ref name=j1>{{cite journal|doi = 10.1021/jo00398a013|author1=SM Kupchan |author2=KL Stevens |author3=EA Rohlfing |author4=BR Sickles |author5=AT Sneden |author6=RW Miller |author7=RF Bryan |title = Tumor inhibitors. 126. New cytotoxic neolignans from Aniba megaphylla Mez|journal = J. Org. Chem.|volume = 43|issue = 4|year = 1978|pages = 586–590}}</ref> Megaphone acetate was also isolated from the root of ''Endlicheria dysodantha'', another plant of [[Lauraceae|Laurel family]], using chromatography of ethanolic solution. It showed inhibitory activity against cells of crown gall tumor and human lung, breast and colon carcinomas.<ref>{{cite journal|pmid=1665173|last1=Ma|first1=WW|year=1991|pages=1153–8|issue=4|last2=Kozlowski|volume=54|journal=Journal of Natural Products|first2=JF|last3=McLaughlin|first3=JL|title=Bioactive neolignans from Endlicheria dysodantha|doi=10.1021/np50076a045}}</ref>


==References==
== References ==
{{reflist}}
{{reflist}}


Line 45: Line 48:


[[Category:Lignans]]
[[Category:Lignans]]
[[Category:Phenol ethers]]
[[Category:O-methylated natural phenols]]
[[Category:Alcohols]]
[[Category:Total synthesis]]
[[Category:Alkenes]]
[[Category:Cyclohexenes]]
[[Category:Ketones]]
[[Category:Plant toxins]]
[[Category:Ethers]]