Meglumine: Difference between revisions

| Watchedfields = changed

| verifiedrevid = 407762837

| ImageFile = Meglumine.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 200

| ImageName = Stereo, skeletal formula of meglumine

| SystematicName = (2''R'',3''R'',4''R'',5''S'')-6-(Methylamino)hexane-1,2,3,4,5-pentol

| OtherNames = ''N''-Methyl-<small>D</small>-glucamine; Methylglucamine; ''N''-Methylglucamine; 1-Deoxy-1-(methylamino)-<small>D</small>-glucitol; 1-Deoxy-1-methylaminosorbitol; ''N''-Methylsorbitylamine; Meglumin <!-- synonyms from Chemical Abstracts Service-->

| CASNo = 6284-40-8

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 8567

| ChemSpiderID = 8249

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| UNII = 6HG8UB2MUY

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 59732

| UNII_Ref = {{fdacite|changed|FDA}}

| ChEMBL = 1200570

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| SMILES = O[C@H]([C@@H](O)CNC)[C@H](O)[C@H](O)CO

| StdInChI =1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MBBZMMPHUWSWHV-BDVNFPICSA-N

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

}}

| C=7 | H=17 | N=1 | O=5

| Appearance = White crystals

| LogP = −2.509

| pKa = 9.52

| pKb = 0.526

}}

|Section3={{Chembox Related

| OtherFunction_label =

| OtherFunction =

| OtherCompounds =

}}

'''Meglumine''' is a [[sugar alcohol]] derived from [[glucose]] that contains an [[amine | amino group]] modification. It is often used as an [[excipient]] in pharmaceuticals<ref>{{cite web | url = https://drugs.ncats.io/drug/6HG8UB2MUY | title = Meglumine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> and in conjunction with iodinated compounds in [[contrast medium|contrast media]] such as [[diatrizoate meglumine]], [[iothalamate | iothalamate meglumine]], and [[iodipamide meglumine]].<ref>[http://www.chemicalland21.com/lifescience/phar/N-METHYL-D-GLUCAMINE.htm Meglumine], chemicalland21.com</ref>