Methyl-DOB: Difference between revisions

(11 intermediate revisions by 10 users not shown)

Line 1:

{{chembox

| verifiedrevid = ~~400307668~~

| verifiedrevid = 415838126

| ImageFile = Methyl-DOB.png

| ImageSize = 200px

| ~~IUPACName~~ = 1-(4-~~bromo~~-2,5-dimethoxyphenyl)-''N''-methylpropan-2-amine

| PIN = 1-(4-Bromo-2,5-dimethoxyphenyl)-''N''-methylpropan-2-amine

| OtherNames =

| Section1 = {{Chembox Identifiers

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8261023

| InChI = 1/C12H18BrNO2/c1-8(14-2)5-9-6-12(16-4)10(13)7-11(9)15-3/h6-8,14H,5H2,1-4H3

| InChIKey = GURVSGCCXMIFMQ-UHFFFAOYAZ

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 351858

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

Line 16:

Line 17:

| StdInChIKey = GURVSGCCXMIFMQ-UHFFFAOYSA-N

| CASNo = 155638-80-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WW3LF52S82

| PubChem = 10085486

| SMILES = Brc1cc(OC)c(cc1OC)CC(NC)C

}}

| Section2 = {{Chembox Properties

|Section2={{Chembox Properties

| Formula = C12H18BrNO2

| MolarMass = 288.181 g/mol

Line 27:

Line 31:

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| ~~Autoignition~~ = }}

| AutoignitionPt = }}

}}

'''Methyl-DOB''', or '''4-[[bromo]]-2,5-di[[methoxy]]-N-[[methamphetamine|methylamphetamine]]''', is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is similar in structure to [[2,5-dimethoxy-4-bromoamphetamine|DOB]]. Methyl-DOB was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]'', the minimum dosage is listed as 8 mg, and the effects onset begin after 3 hours and last up to 36 hours. Methyl-DOB produces many physical effects, such as [[mydriasis]] and [[muscle]] tenseness, but few [[psychoactive]] effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Methyl-DOB.

'''Methyl-DOB''', or '''4-[[bromine|bromo]]-2,5-di[[methoxy]]-N-[[methamphetamine|methylamphetamine]]''', is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is similar in structure to [[2,5-dimethoxy-4-bromoamphetamine|DOB]]. Methyl-DOB was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]'', the minimum dosage is listed as 8 mg, and the effects onset begin after 3 hours and last up to 36 hours. Methyl-DOB produces many physical effects, such as [[mydriasis]] and [[muscle]] tenseness, but few [[psychoactive]] effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Methyl-DOB.

== See also ==

Line 44:

Line 48:

* [http://pihkal.info/read.php?domain=pk&id=127 Methyl-DOB entry in PiHKAL • info]

⚫

[[Category:Methamphetamines]]

⚫

[[Category:~~Amphetamines~~]]