Muscazone: Difference between revisions
Content deleted Content added
Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk: |
|||
| (17 intermediate revisions by 13 users not shown) | |||
| Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 426003687 |
||
| ImageFileL1 = muscazone.png |
| ImageFileL1 = muscazone.png |
||
| ImageSizeL1 = 120px |
|||
| ImageFileR1= Muscazone_3d_structure.png |
| ImageFileR1= Muscazone_3d_structure.png |
||
| ImageSizeR2 = 120px |
|||
| IUPACName = 2-Amino-2-(2-oxo-3''H''-1,3-oxazol-5-yl)acetic acid |
| IUPACName = 2-Amino-2-(2-oxo-3''H''-1,3-oxazol-5-yl)acetic acid |
||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| InChI = 1/C5H6N2O4/c6-3(4(8)9)2-1-7-5(10)11-2/h1,3H,6H2,(H,7,10)(H,8,9)/t3-/m1/s1 |
| InChI = 1/C5H6N2O4/c6-3(4(8)9)2-1-7-5(10)11-2/h1,3H,6H2,(H,7,10)(H,8,9)/t3-/m1/s1 |
||
| InChIKey = ASBGWPLVVIASBE-GSVOUGTGBI |
| InChIKey = ASBGWPLVVIASBE-GSVOUGTGBI |
||
| Line 15: | Line 13: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = ASBGWPLVVIASBE-GSVOUGTGSA-N |
| StdInChIKey = ASBGWPLVVIASBE-GSVOUGTGSA-N |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 2255-39-2 |
| CASNo = 2255-39-2 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = K97K88B7WE |
|||
| PubChem = 92925 |
| PubChem = 92925 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID=16735919 |
| ChemSpiderID=16735919 |
||
| SMILES = O=C([O-])[C@H]([NH3+])C\1=C\NC(=O)O/1 |
| SMILES = O=C([O-])[C@H]([NH3+])C\1=C\NC(=O)O/1 |
||
| EINECS = 218-853-4 |
|||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=5|H=6|N=2|O=4 |
| C=5 | H=6 | N=2 | O=4 |
||
| Appearance = Crystalline solid |
| Appearance = Crystalline solid |
||
| Density = |
| Density = |
||
| MeltingPtC = 190 |
|||
| |
| MeltingPt_notes = (decomposes)<ref name=Merck>''[[Merck Index]]'', 12th Edition, '''6390'''</ref> |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
'''Muscazone''' is a [[toxic]] |
'''Muscazone''' is a [[toxic]] [[chemical compound]]. It is an [[amino acid]] found in European [[Amanita muscaria|fly agaric]] mushrooms.<ref name=Merck/> |
||
| ⚫ | |||
Consumption causes visual damage, mental confusion, and memory loss.<ref>{{Cite book | title = Lewis' Dictionary of Toxicology | author = Robert Alan Lewis | page = 719 | publisher = CRC Press | date = 1998 | isbn = 978-0849366079}}</ref> |
|||
| ⚫ | |||
==See also== |
==See also== |
||
| Line 43: | Line 49: | ||
==References== |
==References== |
||
{{reflist}} |
{{reflist}} |
||
{{Poisonous Amanitas}} |
{{Poisonous Amanitas}} |
||
[[Category:Amino acids]] |
[[Category:Alpha-Amino acids]] |
||
[[Category:Mycotoxins]] |
[[Category:Mycotoxins]] |
||
[[Category: |
[[Category:Oxazolones]] |
||
[[Category:Toxic amino acids]] |
|||
{{organic-compound-stub}} |
{{organic-compound-stub}} |
||
[[it:Muscazone]] |
|||
[[ja:ムスカゾン]] |
|||
[[no:Muskazon]] |
|||
[[pl:Muskazon]] |
|||
[[fi:Muskatsoni]] |
|||