ORG-37684: Difference between revisions
Appearance
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
(23 intermediate revisions by 16 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
⚫ | |||
{{Drugbox |
|||
| |
|||
⚫ | |||
| IUPAC_name = (3S)-3-[(2,3-dihydro-5-methoxy-1H-inden-4-yl)oxy]pyrrolidine |
| IUPAC_name = (3S)-3-[(2,3-dihydro-5-methoxy-1H-inden-4-yl)oxy]pyrrolidine |
||
| image = Org37684_structure.png |
|||
| |
| image = ORG-37684.svg |
||
| |
| width = 200 |
||
⚫ | |||
<!--Clinical data--> |
|||
⚫ | |||
| |
| tradename = |
||
⚫ | |||
⚫ | |||
⚫ | |||
| molecular_weight = 233.305 g/mol |
|||
| smiles = COc1ccc2CCCc2c1OC3CNCC3 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| legal_status = Uncontrolled |
| legal_status = Uncontrolled |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number = 213007-95-5 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| PubChem = 9794656 |
|||
| ChemSpiderID = 7970423 |
|||
<!--Chemical data--> |
|||
⚫ | |||
| smiles = O(c1c(OC)ccc2c1CCC2)[C@H]3CCNC3 |
|||
| StdInChI = 1S/C14H19NO2/c1-16-13-6-5-10-3-2-4-12(10)14(13)17-11-7-8-15-9-11/h5-6,11,15H,2-4,7-9H2,1H3/t11-/m0/s1 |
|||
| StdInChIKey = QDJAYXYEXHVXJV-NSHDSACASA-N |
|||
}} |
}} |
||
'''ORG- |
'''ORG-37684''' is a [[drug]] developed by [[Organon International|Organon]], which acts as a [[potency (pharmacology)|potent]] and [[functional selectivity|selective]] [[agonist]] for the [[5-HT2 receptor|5-HT<sub>2</sub>]] [[receptor (biochemistry)|receptor]] family, with highest [[affinity (pharmacology)|affinity]] at [[5-HT2C receptor|5-HT<sub>2C</sub>]] and lowest at [[5-HT2B receptor|5-HT<sub>2B</sub>]] subtypes.<ref>{{Cite journal| doi = 10.1081/SCC-100104420| year = 2001| vauthors = Adams D, Duncton M | title = Efficient Synthesis of the 5-Ht2C Receptor Agonist, Org 37684 | journal = Synthetic Communications| volume = 31| issue = 13| pages = 2029–2036 | s2cid = 83706335}}</ref><ref>{{cite journal | vauthors = Knight AR, Misra A, Quirk K, Benwell K, Revell D, Kennett G, Bickerdike M | title = Pharmacological characterisation of the agonist radioligand binding site of 5-HT(2A), 5-HT(2B) and 5-HT(2C) receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 370 | issue = 2 | pages = 114–23 | date = August 2004 | pmid = 15322733 | doi = 10.1007/s00210-004-0951-4 | s2cid = 8938111 }}</ref> It has [[anorectic]] effects in animal studies and has been researched as a potential [[weight loss]] drug for use in humans.<ref>{{cite journal | vauthors = Schreiber R, De Vry J | title = Role of 5-hT2C receptors in the hypophagic effect of m-CPP, ORG 37684 and CP-94,253 in the rat | journal = Progress in Neuro-Psychopharmacology & Biological Psychiatry | volume = 26 | issue = 3 | pages = 441–9 | date = April 2002 | pmid = 11999893 | doi = 10.1016/s0278-5846(01)00284-6 | s2cid = 25689931 }}</ref> |
||
==See also== |
== See also == |
||
* [[ |
* [[ORG-12962]] |
||
* [[Quipazine]] |
|||
== References == |
== References == |
||
{{Reflist|2}} |
{{Reflist|2}} |
||
{{Serotonin receptor modulators}} |
|||
{{Anorectics}} |
|||
{{Serotonergics}} |
|||
[[Category:Serotonin receptor agonists]] |
[[Category:Serotonin receptor agonists]] |
||
Line 38: | Line 49: | ||
[[Category:Phenol ethers]] |
[[Category:Phenol ethers]] |
||
[[Category:Pyrrolidines]] |
[[Category:Pyrrolidines]] |
||
{{gastrointestinal-drug-stub}} |
{{gastrointestinal-drug-stub}} |