Jump to content

PF-184563: Difference between revisions

Page 1
Page 2
Content deleted Content added
No edit summary
auto mw
 
(25 intermediate revisions by 18 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 452001339
| Watchedfields = changed
| IUPAC_name = 8-Chloro-5-methyl-1-(3,4,5,6-tetrahydro-2H-[1,2']bipyridinyl-4-yl)-5,6-dihydro-4H-2,3,5,10b-tetraaza-benzo[e]azulene| image = PF-184563.png
| verifiedrevid = 452024825
| IUPAC_name = 8-Chloro-5-methyl-1-(3,4,5,6-tetrahydro-2''H''-[1,2']bipyridinyl-4-yl)-5,6-dihydro-4''H''-2,3,5,10b-tetraaza-benzo[e]azulene| image = PF-184563.png
| width = 220
| width = 220

<!--Pharmacokinetic data -->
<!--Pharmacokinetic data -->
| bioavailability = 34%
| bioavailability = 34%
| protein_bound = 69%
| protein_bound = 69%
| elimination_half-life = 1.8h
| elimination_half-life = 1.8h

<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 748806-39-5
| CAS_number = 748806-39-5
| ATC_prefix = none
| ATC_prefix = none
Line 15: Line 17:
| ATC_supplemental =
| ATC_supplemental =
| PubChem =
| PubChem =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1837037
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9412479
<!--Chemical data-->
<!--Chemical data-->
| C=21 | H=23 | Cl=1 | N=6
| C=21 | H=23 | Cl=1 | N=6
| smiles = CN1CC2=C(C=CC(=C2)Cl)N3C(=NN=C3C4CCN(CC4)C5=CC=CC=N5)C1
| molecular_weight = 394.91
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| cLogP = 2.1
| StdInChI = 1S/C21H23ClN6/c1-26-13-16-12-17(22)5-6-18(16)28-20(14-26)24-25-21(28)15-7-10-27(11-8-15)19-4-2-3-9-23-19/h2-6,9,12,15H,7-8,10-11,13-14H2,1H3
| smiles =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LXHAZNJVVVBJIF-UHFFFAOYSA-N
}}
}}


'''PF-184563''' is a potent, selective non-peptidic antagonist of the [[Arginine vasopressin receptor 1A|V1a receptor]].<ref name="PMID21885275">{{cite journal | author = Johnson PS, Ryckmans T, Bryans J, Beal DM, Dack KN, Feeder N, Harrison A, Lewis M, Mason HJ, Mills J, Newman J, Pasquinet C, Rawson DJ, Roberts LR, Russell R, Spark D, Stobie A, Underwood TJ, Ward R and Wheeler S | title = Discovery of PF-184563, a potent and selective V1a antagonist for the treatment of dysmenorrhoea. The influence of compound flexibility on microsomal stability| journal = Bioorganic. Med. Chem. Lett. | issue = 21 | pages = 5684–5687| year = 2011 | month = October| pmid = 21885275 | doi = 10.1016/j.bmcl.2011.08.038}}</ref>. The compound was discovered by [[Pfizer]] in its [[Sandwich, Kent]] research center, as a potential treatment for [[dysmenorrhoea]], an indication for which V1a antagonists have shown efficacy.<ref name="PMID10826575"> {{cite journal | author = Brouard R, Bossmar T, Fournie-Lloret D, Chassard D and Akerlund M | title = Effect of SR49059, an orally active V1a vasopressin receptor antagonist, in the prevention of dysmenorrhoea| journal = Br. J. Obstet. Gynaecol. | issue = 107 | volume = 5|pages = 614-619| year = 2000 | pmid = 10826575 | doi = 10.1111/j.1471-0528.2000.tb13302.x}}</ref>.
'''PF-184563''' is a potent, selective non-peptidic antagonist of the [[Arginine vasopressin receptor 1A|V1a receptor]].<ref name="PMID21885275">{{cite journal |vauthors=Johnson PS, Ryckmans T, Bryans J, Beal DM, Dack KN, Feeder N, Harrison A, Lewis M, Mason HJ, Mills J, Newman J, Pasquinet C, Rawson DJ, Roberts LR, Russell R, Spark D, Stobie A, Underwood TJ, Ward R, Wheeler S | title = Discovery of PF-184563, a potent and selective V1a antagonist for the treatment of dysmenorrhoea. The influence of compound flexibility on microsomal stability| journal = Bioorg. Med. Chem. Lett. | volume = 21 | pages = 5684–5687|date=October 2011| pmid = 21885275 | doi = 10.1016/j.bmcl.2011.08.038 | issue=19}}</ref> The compound was discovered by [[Pfizer]] in its [[Sandwich, Kent]] research center, as a potential treatment for [[dysmenorrhoea]], an indication for which V1a antagonists have shown efficacy.<ref name="PMID10826575">{{cite journal |vauthors=Brouard R, Bossmar T, Fournie-Lloret D, Chassard D, Akerlund M | title = Effect of SR49059, an orally active V1a vasopressin receptor antagonist, in the prevention of dysmenorrhoea| journal = Br. J. Obstet. Gynaecol. | volume = 107 |pages = 614–619| year = 2000 | pmid = 10826575 | doi = 10.1111/j.1471-0528.2000.tb13302.x | issue=5| s2cid = 19439985| doi-access = }}</ref>



==References==
==References==
{{Reflist}}
{{Reflist|2}}


{{Pituitary and hypothalamic hormones and analogues}}
{{Oxytocin and vasopressin receptor modulators}}
{{Neuropeptide agonists and antagonists}}


[[Category:Hormonal agents]]
[[Category:Drugs developed by Pfizer]]
[[Category:Vasopressin receptor antagonists]]


{{systemic-hormonal-drug-stub}}
{{systemic-hormonal-drug-stub}}