PSN-632,408: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
 {{Drugbox
-| verifiedrevid = 386416659
+| verifiedrevid = 424766281
-| IUPAC_name               = ''tert''-butyl 4-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methoxy]piperidine-1-carboxylate
+| IUPAC_name = ''tert''-butyl 4-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methoxy]piperidine-1-carboxylate
-| image                    = PSN-632408-structure.png
+| image = PSN-632408-structure.png
-| CAS_number               = 857652-30-3
+<!--Clinical data-->
-| ATC_prefix               = none
+| tradename =
-| ATC_suffix               =
+| pregnancy_category =
-| PubChem                  = 11462546
+| legal_status =
-| C = 18 | H = 24 | N = 4 | O = 4
+| routes_of_administration =
-| molecular_weight         = 360.407 g/mol
-| smiles                   = CC(C)(C)OC(=O)N1CCC(CC1)OCc2nc(no2)-c3ccncc3
+<!--Pharmacokinetic data-->
-| bioavailability          =
+| bioavailability =
-| metabolism               =
+| metabolism =
-| elimination_half-life    =
+| elimination_half-life =
-| excretion                =
+| excretion =
-| pregnancy_category       =
-| legal_status             =
+<!--Identifiers-->
-| routes_of_administration =
+| IUPHAR_ligand = 3319
+| CAS_number_Ref = {{cascite|correct|CAS}}
+| CAS_number = 857652-30-3
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = V4434XWK2P
+| ATC_prefix = none
+| PubChem = 11462546
+| ChemSpiderID      = 9637386
+| ChEMBL = 1081913
+<!--Chemical data-->
+| C=18 | H=24 | N=4 | O=4
+| smiles = CC(C)(C)OC(=O)N1CCC(CC1)OCc2nc(no2)-c3ccncc3
+| StdInChI          = 1S/C18H24N4O4/c1-18(2,3)25-17(23)22-10-6-14(7-11-22)24-12-15-20-16(21-26-15)13-4-8-19-9-5-13/h4-5,8-9,14H,6-7,10-12H2,1-3H3
+| StdInChIKey       = LHZWKWCEAXQUMX-UHFFFAOYSA-N
 }}
-'''PSN-632,408''' is a [[binding_selectivity|selective]] [[ligand]] for the suggested novel [[cannabinoid receptor]] [[GPR119]].<ref name="pmid16517404">{{cite journal |author = Overton HA, Babbs AJ, Doel SM, Fyfe MC, Gardner LS, Griffin G, Jackson HC, Procter MJ, Rasamison CM, Tang-Christensen M, Widdowson PS, Williams GM, Reynet C. |title = Deorphanization of a G protein-coupled receptor for oleoylethanolamide and its use in the discovery of small-molecule hypophagic agents. | journal = Cell Metab. | volume = 3 | issue = 3 | pages = 167–175 | year = 2006 |pmid = 16517404 |doi = 10.1016/j.cmet.2006.02.004 }}</ref>
+'''PSN-632,408''' is a [[binding selectivity|selective]] [[ligand]] for the suggested novel [[cannabinoid receptor]] [[GPR119]].<ref name="pmid16517404">{{cite journal |vauthors = Overton HA, Babbs AJ, Doel SM, Fyfe MC, Gardner LS, Griffin G, Jackson HC, Procter MJ, Rasamison CM, Tang-Christensen M, Widdowson PS, Williams GM, Reynet C |title = Deorphanization of a G protein-coupled receptor for oleoylethanolamide and its use in the discovery of small-molecule hypophagic agents. | journal = Cell Metab. | volume = 3 | issue = 3 | pages = 167–175 | year = 2006 |pmid = 16517404 |doi = 10.1016/j.cmet.2006.02.004 | doi-access = free }}</ref>
 == See also ==
@@ Line 26: / Line 42: @@
 == References ==
-{{Reflist|2}}
+{{Reflist}}
 {{Cannabinoids}}
+[[Category:4-Pyridyl compounds]]
-{{cannabinoid-stub}}
-[[Category:Pyridines]]
 [[Category:Oxadiazoles]]
 [[Category:Piperidines]]
 [[Category:Carbamates]]
+[[Category:Tert-butyl compounds]]
+{{cannabinoid-stub}}