Pectic acid: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{Chembox
+| verifiedrevid = 442035884
 | ImageFile = pectic acid.svg
-|  ImageSize = 180px
+| ImageSize = 180px
-|  ImageAlt =
+| ImageAlt =
 | IUPACName =
 | OtherNames = Pectate; Poly(1,4-α-<small>D</small>-galacturonate); α-<small>D</small>-Polygalacturonic acid
-| Section1 = {{Chembox Identifiers
+|Section1={{Chembox Identifiers
+| ChemSpiderID_Ref =
-|  ChemSpiderID = 388376
+| ChemSpiderID =
-| StdInChI = 1S/C18H26O19/c19-1-2(20)10(13(26)27)36-17(6(1)24)35-9-4(22)7(25)18(37-12(9)15(30)31)34-8-3(21)5(23)16(32)33-11(8)14(28)29/h1-12,16-25,32H,(H,26,27)(H,28,29)(H,30,31)/t1-,2+,3+,4+,5+,6+,7+,8+,9+,10-,11-,12-,16-,17?,18?/m0/s1
+| StdInChI_Ref =
-| StdInChIKey = LCLHHZYHLXDRQG-ZNKJPWOQSA-N
-| CASNo = 9046-40-6
+| StdInChI =
+| StdInChIKey_Ref =
-|   CASNo_Ref = {{cascite|correct|CAS}}
-|  PubChem = 439239
+| StdInChIKey =
+| CASNo_Ref = {{cascite|correct|CAS}}
-|  SMILES = O=C(O)[C@H]3OC(O[C@@H]1[C@H](O)[C@@H](O)C(O[C@@H]1C(=O)O)O[C@H]2[C@H](O[C@H](O)[C@H](O)[C@H]2O)C(=O)O)[C@H](O)[C@@H](O)[C@H]3O
+| CASNo = 25249-06-3
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = VV3XD4CL04
+| PubChem =
+| SMILES =
 }}
-| Section2 = {{Chembox Properties
+|Section2={{Chembox Properties
-|  Formula = (C<sub>6</sub>H<sub>8</sub>O<sub>6</sub>)<sub>n</sub>
+| Formula = (C<sub>6</sub>H<sub>8</sub>O<sub>6</sub>)<sub>n</sub>
-|  MolarMass = Variable
+| MolarMass = Variable
-|  Appearance =
+| Appearance =
-|  Density =
+| Density =
-|  MeltingPt =
+| MeltingPt =
-|  BoilingPt =
+| BoilingPt =
-|  Solubility = }}
+| Solubility = }}
-| Section3 = {{Chembox Hazards
+|Section3={{Chembox Hazards
-|  MainHazards =
+| MainHazards =
-|  FlashPt =
+| FlashPt =
-|  Autoignition = }}
+| AutoignitionPt = }}
 }}
-'''Pectic acid''', also known as '''polygalacturonic acid''' is a water insoluble, [[Transparency (optics)|transparent]] gelatinous [[acid]] existing in ripe [[fruit]] and some [[vegetables]]. It is a product of [[pectin]] degradation in plants, and is produced via the interaction between [[pectinase]] and pectin (the latter being common in the wine-making industry).
+'''Pectic acid''', also known as '''polygalacturonic acid''', is a water-soluble, [[Transparency (optics)|transparent]] gelatinous [[acid]] existing in over-ripe [[fruit]] and some [[vegetables]]. It is a product of [[pectin]] degradation in plants, and is produced via the interaction between [[pectinase]] and [[pectin]] (the latter being common in the wine-making industry.) In the early stage of development of fruits, the pectic substance is a water-insoluble protopectin which is converted into pectin by the enzyme protopectinase during ripening of fruit. In over-ripe fruits, due to the presence of pectic methyl esterase enzyme, the pectin gets largely converted to pectic acid which is water-insoluble. Due to this reason both immature and over-ripe fruits are not suitable for making jelly and only ripe fruits are used.
+== References ==
+{{morefootnotes|date=November 2020}}
+*{{cite journal |author= G. O. Aspinall and A. Cañas-Rodriguez |title= 810. Sisal pectic acid|year= 1958|journal= Journal of the Chemical Society|pages= 4020–4027|doi= 10.1039/JR9580004020}}