Repirinast: Difference between revisions
Appearance
Content deleted Content added
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
(11 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 448119998 |
||
| IUPAC_name = 3-methylbutyl 7,8-dimethyl-4,5-dioxo-5,6-dihydro-4''H''-pyrano[3,2-''c'']quinoline-2-carboxylate |
| IUPAC_name = 3-methylbutyl 7,8-dimethyl-4,5-dioxo-5,6-dihydro-4''H''-pyrano[3,2-''c'']quinoline-2-carboxylate |
||
| image = Repirinast. |
| image = Repirinast.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
Line 8: | Line 10: | ||
| Drugs.com = {{drugs.com|international|repirinast}} |
| Drugs.com = {{drugs.com|international|repirinast}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
Line 25: | Line 27: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 73080-51-0 |
| CAS_number = 73080-51-0 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
Line 36: | Line 39: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D01890 |
| KEGG = D01890 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 4874 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=20 | H=21 | N=1 | O=5 |
| C=20 | H=21 | N=1 | O=5 |
||
| molecular_weight = 355.38 g/mol |
|||
| smiles = CC1=C(C2=C(C=C1)C3=C(C(=O)C=C(O3)C(=O)OCCC(C)C)C(=O)N2)C |
| smiles = CC1=C(C2=C(C=C1)C3=C(C(=O)C=C(O3)C(=O)OCCC(C)C)C(=O)N2)C |
||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C20H21NO5/c1-10(2)7-8-25-20(24)15-9-14(22)16-18(26-15)13-6-5-11(3)12(4)17(13)21-19(16)23/h5-6,9-10H,7-8H2,1-4H3,(H,21,23) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = NFQIAEMCQGTTIR-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Repinirast''' ([[International Nonproprietary Name|INN]]; marketed under the tradename '''Romet''') is an [[antihistamine]].<ref>{{cite journal | vauthors = Yamada N, Ohgaki M, Muramatsu M | title = Repirinast inhibits antigen-induced early and late pulmonary responses and airway hyperresponsiveness in guinea pigs | journal = International Archives of Allergy and Immunology | volume = 100 | issue = 4 | pages = 367–72 | date = 1993 | pmid = 8386963 | doi = 10.1159/000236440 }}</ref><ref>{{cite journal | vauthors = Yamada N, Kadowaki S, Takahashi K, Umezu K | title = MY-1250, a major metabolite of the anti-allergic drug repirinast, induces phosphorylation of a 78-kDa protein in rat mast cells | journal = Biochemical Pharmacology | volume = 44 | issue = 6 | pages = 1211–3 | date = September 1992 | pmid = 1358073 | doi = 10.1016/0006-2952(92)90387-x }}</ref> |
|||
'''Repinirast''' ([[International Nonproprietary Name|INN]]; marketed under the tradename '''Romet''') is an [[antihistamine]]. |
|||
⚫ | |||
⚫ | |||
==References== |
==References== |
||
{{Reflist}} |
|||
1.Yamada et al.: Int Arch Allergy Immunol 1993;100: 367-372, DOI: 10.1159/000236440 |
|||
2.Yamada et al.: Biochemical Pharmacology 1992,44(6):1211-1213 [http://dx.doi.org/10.1016/0006-2952(92)90387-X doi:10.1016/0006-2952(92)90387-x.] |
|||
⚫ | |||
⚫ | |||
{{Antihistamines}} |
{{Antihistamines}} |
||
[[Category:H1 receptor antagonists]] |
[[Category:H1 receptor antagonists]] |
||
[[Category:4-Pyrones]] |
|||
{{respiratory-system-drug-stub}} |
{{respiratory-system-drug-stub}} |