Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Rolitetracycline: Difference between pages

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Pharmaceutical drug}}
-{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Rolitetracycline|oldid=457002229}} 457002229] of page [[Rolitetracycline]] with values updated to verified values.}}
+{{More references|date=December 2014}}
 {{Drugbox
 | Verifiedfields = changed
 | Watchedfields = changed
-| verifiedrevid = 401044012
+| verifiedrevid = 464383386
-| IUPAC_name = (2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-(dimethylamino)-6,10,11,12a-tetrahydroxy-2-{hydroxy[(pyrrolidin-1-ylmethyl)amino]methylene}-6-methyl-4a,5a,6,12a-tetrahydrotetracene-1,3,12(2''H'',4''H'',5''H'')-trione
+| IUPAC_name = (2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-(Dimethylamino)-6,10,11,12a-tetrahydroxy-2-{hydroxy[(pyrrolidin-1-ylmethyl)amino]methylene}-6-methyl-4a,5a,6,12a-tetrahydrotetracene-1,3,12(2''H'',4''H'',5''H'')-trione
-| image = Rolitetracycline.png
+| image = Rolitetracycline.svg
+| alt = Skeletal formula of rolitetracycline
+| width = 240
+| image2 = Rolitetracycline 3D spacefill.png
+| alt2 = Space-filling model of the rolitetracycline molecule
+| width2 = 260
 <!--Clinical data-->
 | tradename =
 | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_US = <!-- A / B / C / D / X -->
 | pregnancy_category =
 | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
-| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
+| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
-| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
+| legal_US = <!-- OTC / Rx-only  / Schedule I, II, III, IV, V -->
 | legal_status =
 | routes_of_administration =
 <!--Pharmacokinetic data-->
 | bioavailability =
 | protein_bound =
 | metabolism =
 | elimination_half-life =
 | excretion =
 <!--Identifiers-->
-| CAS_number_Ref = {{cascite|changed|??}}
+| CAS_number_Ref = {{cascite|correct|??}}
 | CAS_number = 751-97-3
 | ATC_prefix = J01
 | ATC_suffix = AA09
-| PubChem = 5282179
+| PubChem = 54682938
-| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank = DB01301
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 10469507
-| UNII_Ref = {{fdacite|changed|FDA}}
+| UNII_Ref = {{fdacite|correct|FDA}}
 | UNII = GH9IW85221
-| KEGG_Ref = {{keggcite|changed|kegg}}
+| KEGG_Ref = {{keggcite|correct|kegg}}
 | KEGG = D02282
 | ChEMBL_Ref = {{ebicite|changed|EBI}}
-| ChEMBL = <!-- blanked - oldvalue: 1214184 -->
+| ChEMBL = 1214184
-| C=27 | H=33 | N=3 | O=8
+<!--Chemical data-->
-| molecular_weight = 527.566 g/mol
+| C=27 | H=33 | N=3 | O=8
 | smiles = O=C(NCN1CCCC1)\C2=C(/O)[C@@H](N(C)C)[C@@H]3CC5C(=C(\O)[C@]3(O)C2=O)\C(=O)c4c(O)cccc4[C@@]5(C)O
-| InChI = 1/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14?,15-,20-,26+,27-/m0/s1
-| InChIKey = HMEYVGGHISAPJR-VQCPGFMQBB
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14?,15-,20-,26+,27-/m0/s1
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = HMEYVGGHISAPJR-VQCPGFMQSA-N
-| synonyms = <small>(2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-dimethylamino-6,10,11,12a-tetrahydroxy-2-[hydroxy-(pyrrolidin-1-ylmethylamino)methylidene]-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione</small>
+| synonyms = <small>(2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-Dimethylamino-6,10,11,12a-tetrahydroxy-2-[hydroxy-(pyrrolidin-1-ylmethylamino)methylidene]-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione</small>
 }}
+'''Rolitetracycline''' is a [[tetracycline antibiotic]].<ref>{{cite web |title=Rolitetracycline |url=https://pubchem.ncbi.nlm.nih.gov/compound/Rolitetracycline |website=PubChem |publisher=National Library of Medicine |access-date=8 June 2020}}</ref> Tetracycline is ''N''-[[Mannich base]] [[prodrug]] that is prepared from [[tetracycline]] by condensation with [[pyrrolidine]] and [[formaldehyde]] to produce rolitetracycline. Rolitetracycline is used as an antibacterial drug, a protein synthesis inhibitor, an antiprotozoal drug and a prodrug.<ref>{{Cite web |last=PubChem |title=Rolitetracycline |url=https://pubchem.ncbi.nlm.nih.gov/compound/54682938 |access-date=2022-07-29 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref><ref name="pmid14066734">{{cite journal | vauthors = Smith L | title = Rolitetracycline, an antibiotic for parenteral use. (syntetrin, velacycline) | journal = JAMA | volume = 187 | issue = 2 | pages = 141 | date = January 1964 | pmid = 14066734 | doi = 10.1001/jama.1964.03060150065017 }}</ref>
+==References==
+{{Reflist}}
+{{TetracyclineAntiBiotics}}
+[[Category:Tetracycline antibiotics]]
+[[Category:1-Pyrrolidinyl compounds]]
+[[Category:Triketones]]
+{{antibiotic-stub}}