Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Rolitetracycline: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 457002229 of page Rolitetracycline for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
removed Category:Pyrrolidines; added Category:1-Pyrrolidinyl compounds using HotCat |
||
Line 1: | Line 1: | ||
{{Short description|Pharmaceutical drug}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Rolitetracycline|oldid=457002229}} 457002229] of page [[Rolitetracycline]] with values updated to verified values.}} |
|||
{{More references|date=December 2014}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 464383386 |
||
| IUPAC_name = (2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-( |
| IUPAC_name = (2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-(Dimethylamino)-6,10,11,12a-tetrahydroxy-2-{hydroxy[(pyrrolidin-1-ylmethyl)amino]methylene}-6-methyl-4a,5a,6,12a-tetrahydrotetracene-1,3,12(2''H'',4''H'',5''H'')-trione |
||
| image = Rolitetracycline. |
| image = Rolitetracycline.svg |
||
| alt = Skeletal formula of rolitetracycline |
|||
| width = 240 |
|||
| image2 = Rolitetracycline 3D spacefill.png |
|||
| alt2 = Space-filling model of the rolitetracycline molecule |
|||
| width2 = 260 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
||
| legal_CA = <!-- |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
||
| legal_US = <!-- OTC |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 751-97-3 |
| CAS_number = 751-97-3 |
||
| ATC_prefix = J01 |
| ATC_prefix = J01 |
||
| ATC_suffix = AA09 |
| ATC_suffix = AA09 |
||
| PubChem = |
| PubChem = 54682938 |
||
| DrugBank_Ref = {{drugbankcite| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB01301 |
| DrugBank = DB01301 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 10469507 |
| ChemSpiderID = 10469507 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = GH9IW85221 |
| UNII = GH9IW85221 |
||
| KEGG_Ref = {{keggcite| |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D02282 |
| KEGG = D02282 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1214184 |
||
⚫ | |||
<!--Chemical data--> |
|||
| molecular_weight = 527.566 g/mol |
|||
⚫ | |||
| smiles = O=C(NCN1CCCC1)\C2=C(/O)[C@@H](N(C)C)[C@@H]3CC5C(=C(\O)[C@]3(O)C2=O)\C(=O)c4c(O)cccc4[C@@]5(C)O |
| smiles = O=C(NCN1CCCC1)\C2=C(/O)[C@@H](N(C)C)[C@@H]3CC5C(=C(\O)[C@]3(O)C2=O)\C(=O)c4c(O)cccc4[C@@]5(C)O |
||
| InChI = 1/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14?,15-,20-,26+,27-/m0/s1 |
|||
| InChIKey = HMEYVGGHISAPJR-VQCPGFMQBB |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14?,15-,20-,26+,27-/m0/s1 |
| StdInChI = 1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14?,15-,20-,26+,27-/m0/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = HMEYVGGHISAPJR-VQCPGFMQSA-N |
| StdInChIKey = HMEYVGGHISAPJR-VQCPGFMQSA-N |
||
| synonyms = <small>(2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4- |
| synonyms = <small>(2''Z'',4''S'',4a''S'',5a''S'',6''S'',12a''S'')-4-Dimethylamino-6,10,11,12a-tetrahydroxy-2-[hydroxy-(pyrrolidin-1-ylmethylamino)methylidene]-6-methyl-4,4a,5,5a-tetrahydrotetracene-1,3,12-trione</small> |
||
}} |
}} |
||
'''Rolitetracycline''' is a [[tetracycline antibiotic]].<ref>{{cite web |title=Rolitetracycline |url=https://pubchem.ncbi.nlm.nih.gov/compound/Rolitetracycline |website=PubChem |publisher=National Library of Medicine |access-date=8 June 2020}}</ref> Tetracycline is ''N''-[[Mannich base]] [[prodrug]] that is prepared from [[tetracycline]] by condensation with [[pyrrolidine]] and [[formaldehyde]] to produce rolitetracycline. Rolitetracycline is used as an antibacterial drug, a protein synthesis inhibitor, an antiprotozoal drug and a prodrug.<ref>{{Cite web |last=PubChem |title=Rolitetracycline |url=https://pubchem.ncbi.nlm.nih.gov/compound/54682938 |access-date=2022-07-29 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref><ref name="pmid14066734">{{cite journal | vauthors = Smith L | title = Rolitetracycline, an antibiotic for parenteral use. (syntetrin, velacycline) | journal = JAMA | volume = 187 | issue = 2 | pages = 141 | date = January 1964 | pmid = 14066734 | doi = 10.1001/jama.1964.03060150065017 }}</ref> |
|||
==References== |
|||
{{Reflist}} |
|||
{{TetracyclineAntiBiotics}} |
|||
[[Category:Tetracycline antibiotics]] |
|||
[[Category:1-Pyrrolidinyl compounds]] |
|||
[[Category:Triketones]] |
|||
{{antibiotic-stub}} |