Sclarene: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Watchedfields = changed
-| verifiedrevid = 355696737
+| verifiedrevid = 419853772
 |   Name = Sclarene
 |   ImageFile = Sclarene.svg
-<!-- | ImageSize = 200px -->
 |   ImageName = Sclarene
-|   IUPACName =?
+|   IUPACName = Labda-8(20),13(16),14-triene
+|   SystematicName = (4a''S'',5''S'',8a''S'')-1,1,4a-Trimethyl-6-methylidene-5-(3-methylidenepent-4-en-1-yl)decahydronaphthalene
 | Section1 = {{Chembox Identifiers
+| CASNo_Ref = {{cascite|correct|CAS}}
-|   CASNo = 511-02-4
-|   SMILES =
+| CASNo = 511-02-4
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = 95E3AV9Y7E
+| ChEBI = 64281
+| ChemSpiderID = 9498211
+| PubChem = 11323257
+| StdInChI=1S/C20H32/c1-7-15(2)9-11-17-16(3)10-12-18-19(4,5)13-8-14-20(17,18)6/h7,17-18H,1-3,8-14H2,4-6H3/t17-,18-,20+/m0/s1
+| StdInChIKey = KYLKKZSVPLUGCC-CMKODMSKSA-N
+| SMILES = C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2CCC(=C)C=C)(C)C
   }}
 | Section2 = {{Chembox Properties
-|   Formula = C<sub>20</sub>H<sub>32</sub>
+|   C=20|H=32
-|   MolarMass = 272.47 g/mol
 |   Density =
 |   MeltingPt =
@@ Line 18: / Line 28: @@
   }}
 }}
-'''Sclarene''' is a [[diterpene]] present in the foliage of ''[[Podocarpus hallii]]''.[http://findarticles.com/p/articles/mi_qa4091/is_200307/ai_n9287893/pg_2]
+'''Sclarene''' is a [[diterpene]] present in the foliage of ''[[Podocarpus hallii]]''.<ref>[http://findarticles.com/p/articles/mi_qa4091/is_200307/ai_n9287893/pg_2] {{dead link|date=June 2012}}</ref>
-[[Category:diterpenes]]
+==References==
+{{reflist}}
+[[Category:Diterpenes]]
 [[Category:Decalins]]
+[[Category:Polyenes]]
+[[Category:Vinylidene compounds]]