Siamenoside I: Difference between revisions
Content deleted Content added
m r2.7.1) (robot Adding: ar:سايامنوسايد |
m Added UNII |
||
| (11 intermediate revisions by 9 users not shown) | |||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| verifiedrevid = |
| verifiedrevid = 430182933 |
||
| Name = Siamenoside I |
| Name = Siamenoside I |
||
| ImageFile = Siamenosid I.svg |
| ImageFile = Siamenosid I.svg |
||
| ImageSize = 200px |
|||
| ImageName = Chemical structure of siamenoside I |
| ImageName = Chemical structure of siamenoside I |
||
| ImageAlt = Chemical structure of siamenoside I |
| ImageAlt = Chemical structure of siamenoside I |
||
| IUPACName = |
| IUPACName = |
||
| OtherNames = <!-- <br> --> |
| OtherNames = <!-- <br> --> |
||
|Section1= |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 126105-12-2 |
| CASNo = 126105-12-2 |
||
| |
| CASNoOther = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| CASOther = |
|||
| |
| UNII = L34LUJ2UPB |
||
| |
| PubChem = 71307460 |
||
| ChemSpiderID = 24534173 |
|||
| InChI = |
|||
| SMILES = C[C@H](CC[C@H](C(C)(C)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)[C@H]4CC[C@@]5([C@@]4(C[C@H]([C@@]6([C@@H]5CC=C7[C@H]6CC[C@@H](C7(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C)O)C)C |
|||
| StdInChI = 1S/C54H92O24/c1-22(23-15-16-52(6)30-12-10-24-25(54(30,8)31(58)17-53(23,52)7)11-14-32(50(24,2)3)76-47-43(68)39(64)35(60)27(19-56)73-47)9-13-33(51(4,5)70)77-49-45(78-48-44(69)40(65)36(61)28(20-57)74-48)41(66)37(62)29(75-49)21-71-46-42(67)38(63)34(59)26(18-55)72-46/h10,22-23,25-49,55-70H,9,11-21H2,1-8H3/t22-,23-,25-,26-,27-,28-,29-,30-,31-,32+,33-,34-,35-,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,46-,47+,48+,49+,52+,53-,54+/m1/s1 |
|||
| StdInChIKey = XJIPREFALCDWRQ-KGFBLRRZSA-N |
|||
| MeSHName = |
| MeSHName = |
||
}} |
}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| Formula = C<sub>54</sub>H<sub>92</sub>O<sub>24</sub> |
| Formula = C<sub>54</sub>H<sub>92</sub>O<sub>24</sub> |
||
| MolarMass = 1125.29 g/mol |
| MolarMass = 1125.29 g/mol |
||
| ExactMass = <!-- u --> |
|||
| Appearance = white powder |
| Appearance = white powder |
||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = |
| Solubility = |
||
}} |
}} |
||
}} |
}} |
||
'''Siamenoside''' is a natural sweetener |
'''Siamenoside''' is a [[cucurbitane]], a natural sweetener from the fruit of ''[[Siraitia grosvenorii]]'' combined with [[neomogroside]]. The mixture is about 300 times sweeter than sucrose. It is used as a natural sweetener in China.<ref>[http://www.chromadex.com/chemicals/Siamenosidei_P.html Siamenoside I] on www.chromadex.com</ref> |
||
==See also== |
== See also == |
||
*[[Mogroside]], related compounds also found in ''S. grosvenorii''. |
* [[Mogroside]], related compounds also found in ''S. grosvenorii''. |
||
==References== |
==References== |
||
<references/> |
<references/> |
||
==External links== |
|||
| ⚫ | |||
*{{Commonscatinline}} |
|||
[[Category:Sweeteners]] |
|||
[[Category:Triterpene glycosides]] |
|||
[[ar:سايامنوسايد]] |
|||
| ⚫ | |||
[[fr:Siamenoside I]] |
|||