Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Silicon disulfide: Difference between pages

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464390444

| ImageSize1 = 300px

| ImageFile2 = SiS2-chain-from-Ibam-xtal-2015-3D-balls.png

| ImageFile3 = SiS2.png

| ImageSize3 = 300px

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 13759-10-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 35Y5PHW16K

| SMILES_Comment = monomer

| SMILES1 = S=[Si](S0)S[Si]0(S0)S[Si]0(S0)S[Si]0(S0)S[Si]0(S0)S[Si]0(S0)S[Si]0=S

| SMILES1_Comment = polymer

}}

|Section2={{Chembox Properties

| Appearance = White (samples are sometimes grey or brown) needles.<br/>Rotten egg smell in moist air.

| MeltingPtC = 1090

| MeltingPt_notes = sublimes

| BoilingPtC =

| BoilingPt_notes =

| Solubility = Decomposes

| pKb =

}}

|Section3={{Chembox Structure

| Coordination = [[Tetrahedral]]

| CrystalStruct = [[Orthorhombic]], [[Pearson symbol|oI12]]

| SpaceGroup = Ibam, No.72<ref>{{cite journal |author1=Weiss, A. |author2=Weiss, A. | title = Über Siliciumchalkogenide. VI. Zur Kenntnis der faserigen Siliciumdioxyd-Modifikation | journal = Zeitschrift für Anorganische und Allgemeine Chemie | year = 1954 | volume = 276 | issue = 1–2 | pages = 95–112 | doi = 10.1002/zaac.19542760110 }}</ref>

}}

|Section4={{Chembox Thermochemistry

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| AutoignitionPt =

| PEL =

}}

|Section8={{Chembox Related

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

'''Silicon disulfide''' is the [[inorganic compound]] with the formula [[Silicon|Si]][[Sulfur|S₂]]. Like [[silicon dioxide]], this material is [[polymer]]ic, but it adopts a 1-dimensional structure quite different from the usual [[polymorphism (materials science)|forms]] of SiO₂.

==Synthesis, structure, and properties==

The material is formed by heating silicon and sulfur or by the exchange reaction between [[Silicon dioxide|SiO₂]] and [[Aluminium sulfide|Al₂S₃]]. The material consists of chains of edge-shared [[tetrahedra]], Si(μ-S)₂Si(μS)₂, etc.<ref>{{ cite book |author1=Holleman, A. F. |author2=Wiberg, E. | title = Inorganic Chemistry | publisher = Academic Press | location = San Diego | year = 2001 | isbn = 0-12-352651-5 }} A printing error in this book states that r_SiSi is 214 [[picometer]]s, when in fact that distance describes r_SiS.</ref>

Like other silicon sulfur-compounds (e.g., [[bis(trimethylsilyl)sulfide]]) SiS₂ hydrolyzes readily to release H₂S.

In liquid [[ammonia]] it is reported to form the imide Si(NH)₂ and NH₄SH,<ref name="Greenwood">{{Greenwood&Earnshaw1st| pages =359}}</ref> but a recent report has identified crystalline (NH₄)₂[SiS₃(NH₃)]·2NH₃ as a product which contains the tetrahedral thiosilicate anion, SiS₃(NH₃)^2-.<ref name="MeierKorber2009">{{cite journal| last1 =Meier| first1 =Martin| last2 =Korber| first2 =Nikolaus| title =The first thiosilicate from solution: synthesis and crystal structure of (NH4)2[SiS3(NH3)]·2NH3| journal =Dalton Transactions| issue =9| year =2009| pages =1506–1508| issn =1477-9226| doi =10.1039/b818856d| pmid =19421590}}</ref>

Reaction with ethanol gives the [[alkoxide]] [[tetraethyl orthosilicate]] and H₂S.<ref name="Greenwood"/> With bulky tert-butanol, alcoholysis gives [[tris(tert-butoxy)silanethiol]]:<ref>{{cite journal|author=R. Piękoś, W. Wojnowski|title=Untersuchungen über die Alkoholyse des SiS2. II. Darstellung von Trialkoxysilanthiolen und Tetraalkoxycyclodisilthianen aus den tertiären Alkoholen|journal=Z. Anorg. Allg. Chem.|volume=318|year=1962|issue=3–4 |pages=212–216|doi=10.1002/zaac.19623180310}}</ref>

:3 (CH₃)₃COH + SiS₂ → [(CH₃)₃CO]₃SiSH + H₂S

Reaction with [[sodium sulfide]], [[magnesium sulfide]] and [[aluminum sulfide]] give [[thiosilicate]]s.<ref name="Greenwood"/>

SiS₂ is claimed to occur in certain interstellar objects.<ref>{{ cite journal | author = Goebel, J. H. | title = SiS₂ in Circumstellar Shells | journal = Astronomy and Astrophysics | year = 1993 | volume = 278 | issue = 1 | pages = 226–230 | bibcode = 1993A&A...278..226G | url = http://articles.adsabs.harvard.edu/cgi-bin/nph-iarticle_query?1993A%26A...278..226G&amp;data_type=PDF_HIGH&amp;whole_paper=YES&amp;type=PRINTER&amp;filetype=.pdf }}</ref>

==References==

{{reflist}}

{{silicon compounds}}

{{Sulfides}}

[[Category:Inorganic silicon compounds]]

[[Category:Sulfides]]

[[Category:Inorganic polymers]]

[[Category:Dichalcogenides]]

{{Inorganic-compound-stub}}