Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sodium adipate: Difference between pages

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
-{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Sodium_adipate|oldid=453911915}} 453911915] of page [[Sodium_adipate]] with values updated to verified values.}}
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 425042641
+| verifiedrevid = 464392698
-| ImageFile = Sodium adipate.png
+| ImageFile = Sodium adipate formula V.1.svg
-| ImageSize = 200px
+| ImageSize = 320px
-| IUPACName = Sodium hexanedioate
-| OtherNames = Disodium adipate
+| PIN = Disodium hexanedioate
+| OtherNames = Disodium adipate<br>Adipic acid, sodium salt
-| Section1 = {{Chembox Identifiers
+|Section1={{Chembox Identifiers
-|   ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 22505
 | UNII_Ref = {{fdacite|correct|FDA}}
-| UNII = 76A0JE0FKJ
+| UNII = 3XG6T5KYKM
-| InChI = 1/C6H10O4.2Na/c7-5(8)3-1-2-4-6(9)10;;/h1-4H2,(H,7,8)(H,9,10);;/q;2*+1/p-2
-| InChIKey = KYKFCSHPTAVNJD-NUQVWONBAF
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C6H10O4.2Na/c7-5(8)3-1-2-4-6(9)10;;/h1-4H2,(H,7,8)(H,9,10);;/q;2*+1/p-2
@@ Line 18: / Line 16: @@
 | StdInChIKey = KYKFCSHPTAVNJD-UHFFFAOYSA-L
 | CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo = <!-- blanked - oldvalue: 7486-38-6 -->
+| CASNo = 7486-38-6
-|   PubChem = 24073
+| PubChem = 24073
-|   SMILES = [Na+].[Na+].[O-]C(=O)CCCCC(=O)[O-]
+| SMILES = [Na+].[Na+].[O-]C(=O)CCCCC(=O)[O-]
 }}
-| Section2 = {{Chembox Properties
+|Section2={{Chembox Properties
+| Na = 2 | C = 6 | H = 8 | O =4
-|   Formula = Na<sub>2</sub>C<sub>6</sub>H<sub>8</sub>O<sub>4</sub>
+| Appearance = Solid white to off-white powder or crystals
-|   MolarMass = 190.10 g/mol
-|   Appearance =
+| Density =
-|   Density =
+| MeltingPt =
-|   MeltingPt =
+| BoilingPt =
-|   BoilingPt =
+| Solubility =
-|   Solubility =
 }}
-| Section3 = {{Chembox Hazards
+|Section3={{Chembox Hazards
-|   MainHazards =
+| MainHazards =
-|   FlashPt =
+| FlashPt =
-|   Autoignition =
+| AutoignitionPt =
+| GHSPictograms = {{GHS07}}
+| GHSSignalWord = Warning
+| PPhrases = {{P-phrases|261|305+351+338}}
+| HPhrases = {{H-phrases|302|315|319|335}}
+| LD50 = 4000 mg/kg (intraperitoneal, mouse)
+| NFPA-H = 1
+| NFPA-F = 0
+| NFPA-I = 0
+| ExternalSDS = [https://datasheets.scbt.com/sds/aghs/en/sc-472373.pdf]
 }}
 }}
+'''Sodium adipate''' is a chemical [[Organic compound|organic compound]] with formula Na<sub>2</sub>C<sub>6</sub>H<sub>8</sub>O<sub>4</sub>. It is the [[sodium]] [[salt (chemistry)|salt]] of [[adipic acid]].
+As a [[food additive]], it has the [[E number]] E356 as is used as a buffering agent and as an [[acidity regulator]].<ref>{{cite web | url = http://www.food-info.net/uk/e/e356.htm | title = E356 Sodium adipate | website = food-info.net }}</ref>
+== Preparation ==
+Sodium adipate is prepared by reacting [[adipic acid]] with [[sodium hydroxide]]:<ref>{{cite web | url = https://healthknight.com/sodium-adipate-side-effects-benefits | title = Sodium Adipate (E356) – Overview, Uses, Side Effects & More | website = healthknight.com }}</ref>
+:<chem>C6H10O4 + 2NaOH -> 2C6H8O4 + H2O</chem>
+== Safety ==
+If consumed in excess, it can lead to high levels of sodium and gastrointestinal problems. It can also cause allergic reactions which may lead to swelling, itching, difficulty breathing. Sodium adipate has no proven health benefits.
+==References==
+{{Reflist}}
+[[Category:Adipates]]
+[[Category:Organic sodium salts]]
+[[Category:Food acidity regulators]]
+[[Category:E-number additives]]
+{{organic-compound-stub}}