Sulbentine: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharmacology|er |
Citation bot (talk | contribs) Add: s2cid, bibcode, issue. | Use this bot. Report bugs. | Suggested by Abductive | Category:Antifungals | #UCB_Category 69/98 |
||
| (18 intermediate revisions by 16 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 448221865 |
||
| IUPAC_name = 3,5-bis(phenylmethyl)-1,3,5-thiadiazinane-2-thione |
| IUPAC_name = 3,5-bis(phenylmethyl)-1,3,5-thiadiazinane-2-thione |
||
| image = dibenzthione.png |
| image = dibenzthione.png |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 350-12-9 |
| CAS_number = 350-12-9 |
||
| ATC_prefix = D01 |
| ATC_prefix = D01 |
||
| Line 30: | Line 33: | ||
| PubChem = 67686 |
| PubChem = 67686 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = D0NR12WK9J |
| UNII = D0NR12WK9J |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D01335 |
| KEGG = D01335 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 61005 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=17 | H=18 | N=2 | S=2 |
| C=17 | H=18 | N=2 | S=2 |
||
| smiles = c1ccc(cc1)CN2CN(C(=S)SC2)Cc3ccccc3 |
|||
| molecular_weight = 314.47 g/mol |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C17H18N2S2/c20-17-19(12-16-9-5-2-6-10-16)13-18(14-21-17)11-15-7-3-1-4-8-15/h1-10H,11-14H2 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = QFVAWNPSRQWSDU-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Sulbentine''' (or '''dibenzthione''') is an [[Antifungal medication|antifungal]].<ref>{{cite journal | vauthors = Hänel H, Raether W, Dittmar W | title = Evaluation of fungicidal action in vitro and in a skin model considering the influence of penetration kinetics of various standard antimycotics | journal = Annals of the New York Academy of Sciences | volume = 544 | pages = 329–37 | year = 1988 | issue = 1 | pmid = 3214073 | doi = 10.1111/j.1749-6632.1988.tb40417.x | bibcode = 1988NYASA.544..329H | s2cid = 13183316 }}</ref> |
|||
'''Sulbentine''' (or '''dibenzthione''') is an [[antifungal]]. |
|||
== References == |
|||
{{reflist}} |
|||
{{Antifungals}} |
{{Antifungals}} |
||
| Line 49: | Line 59: | ||
[[Category:Antifungals]] |
[[Category:Antifungals]] |
||
[[Category:Sulfur heterocycles]] |
[[Category:Sulfur heterocycles]] |
||
[[Category: |
[[Category:Dithiocarbamates]] |
||
[[Category:Nitrogen heterocycles]] |
|||
[[Category:Heterocyclic compounds with 1 ring]] |
|||
| ⚫ | |||
| ⚫ | |||
[[de:Sulbentin]] |
|||