Techtochrysin: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Verifiedfields = changed
 | Watchedfields = changed
-| verifiedrevid = 401018834
+| verifiedrevid = 449646890
-|   Name = Techtochrysin
+| Name = Techtochrysin
-|   ImageFile = Tectochrysin.svg
+| ImageFile = Tectochrysin.svg
-|   ImageSize = 250px
+| ImageSize = 220
+| ImageAlt = Skeletal formula
-|   ImageName = Techtochrysin structure
+| ImageFile1 = Techtochrysin molecule ball.png
-|   IUPACName = 5-hydroxy-7-methoxy-2-phenylchromen-4-one
+| ImageSize1 = 220
-|   OtherNames = Tectochrysin<br>Methyl chrysin<br>5-Hydroxy-7-methoxyflavone<br>7-Methoxy-5-hydroxyflavone
+| ImageAlt1 = Ball-and-stick model
-| Section1 = {{Chembox Identifiers
+| ImageName = Techtochrysin structure
-|   CASNo = 520-28-5
+| IUPACName = 5-Hydroxy-7-methoxyflavone
-|   SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O
+| SystematicName = 5-Hydroxy-7-methoxy-2-phenyl-4''H''-1-benzopyran-4-one
-|   InChI =
+| OtherNames = Tectochrysin<br>Methyl chrysin<br>7-Methoxy-5-hydroxyflavone
-|   PubChem = 5281954
+|Section1={{Chembox Identifiers
-  }}
+| CASNo_Ref = {{cascite|correct|??}}
-| Section2 = {{Chembox Properties
+| CASNo = 520-28-5
-|   Formula = C<sub>16</sub>H<sub>12</sub>O<sub>4</sub>
+| UNII_Ref = {{fdacite|correct|FDA}}
-|   MolarMass = 268.26 g/mol
+| UNII = 9UBO28W2AK
-|   ExactMass = 268.073559 u
+| SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O
-|   Density =
-|   MeltingPt =
+| PubChem = 5281954
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
-|   BoilingPt =
+| ChemSpiderID = 4445231
-  }}
+| InChI = 1/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3
+| InChIKey = IRZVHDLBAYNPCT-UHFFFAOYAP
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChI = 1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = IRZVHDLBAYNPCT-UHFFFAOYSA-N
+| RTECS =
+| MeSHName =
+| KEGG_Ref = {{keggcite|changed|kegg}}
+| KEGG = C11621
+| ChEBI_Ref = {{ebicite|changed|EBI}}
+| ChEBI = 9426
+ }}
+|Section2={{Chembox Properties
+| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>4</sub>
+| MolarMass = 268.26 g/mol
+| Density =
+| MeltingPt =
+| BoilingPt =
+ }}
 }}
-'''Techtochrysin''' is a chemical compound. It is a [[O-methylated flavone]], a flavonoid isolated from ''Prunus cerasus'',<ref>[http://books.google.com/books?id=Ab5pDQQD6YUC&pg=PA105&lpg=PA105&dq=Techtochrysin+plant&source=bl&ots=M_grtpNTDT&sig=dZ_NyVrWd7eUiNVyGGdyCtQ_aN4&hl=en&ei=Ad2SSouzEKC7jAe28vz3DQ&sa=X&oi=book_result&ct=result&resnum=3#v=onepage&q=Techtochrysin&f=false Handbook of plant and fungal toxicants By J. P. Felix D'Mello]</ref> the [[sour cherry]], a plant native to much of Europe and southwest Asia.
+'''Techtochrysin''' is a chemical compound. It is an [[O-methylated flavone]], a flavonoid isolated from ''Prunus cerasus'',<ref>[https://books.google.com/books?id=Ab5pDQQD6YUC&q=Techtochrysin&pg=PA105 Handbook of plant and fungal toxicants By J. P. Felix D'Mello]</ref> the [[sour cherry]], a plant native to much of Europe and southwest Asia.
-==Glycosides==
+== Glycosides ==
 * Techtochrysin 5-[[glucoside]]
-==References==
+== References ==
 {{Reflist}}
@@ Line 36: / Line 58: @@
 {{flavone}}
-[[Category:Flavones]]
+[[Category:Aromatase inhibitors]]
-[[Category:Phenol ethers]]
+[[Category:O-methylated flavones]]
-{{Natural-phenol-stub}}
+{{Aromatic-stub}}
-[[fr:Techtochrysine]]