Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Tetra-tert-butylmethane: Difference between pages

{{DISPLAYTITLE:Tetra-''tert''-butylmethane}}

| verifiedrevid = 470603218

| ImageSize = 100

| PIN = 3,3-Di-''tert''-butyl-2,2,4,4-tetramethylpentane

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 4103-17-7

| PubChem = 14123361

| ChemSpiderID = 14288112

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| SMILES = CC(C)(C)C(C(C)(C)C)(C(C)(C)C)C(C)(C)C

| StdInChI = 1S/C17H36/c1-13(2,3)17(14(4,5)6,15(7,8)9)16(10,11)12/h1-12H3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CHNAIAPYMXIYRV-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

|Section2={{Chembox Properties

| C=17 | H=36

|Section3={{Chembox Related

| OtherFunction_label = alkanes

| OtherFunction = {{Unbulleted list|[[2,2-Dimethylbutane]]|[[2,3-Dimethylbutane]]|[[Triptane]]|[[Tetramethylbutane]]|[[Tetraethylmethane]]|[[2,2,4-Trimethylpentane]]|[[2,3,3-Trimethylpentane]]|[[2,3,4-Trimethylpentane]]|[[2,3-Dimethylhexane]]|[[2,5-Dimethylhexane]]}}

}}

'''Tetra-''tert''-butylmethane''' is a hypothetical [[organic compound]] with formula C₁₇H₃₆, consisting of four [[tert-butyl|''tert''-butyl]] groups bonded to a central carbon atom. It would be an [[alkane]], specifically the most compact branched [[isomer]] of [[heptadecane]].

Some calculations suggest this compound cannot exist due to the [[steric hindrance]] among the closely packed ''tert''-butyl groups, which would make it one of the smallest, if not the smallest itself, [[alkane|saturated and acyclic hydrocarbon]] that cannot exist.<ref name=deSilva>{{cite journal | last1=da Silva | first1=K.M. | last2=Goodman | first2=J.M. | title=What is the smallest saturated acyclic alkane that cannot be made? | journal=Journal of Chemical Information and Modeling | volume=45 | issue=1 | pages=81–87 | year=2005 | doi=10.1021/ci0497657 | pmid=15667132| citeseerx=10.1.1.94.8695 }}</ref>

Other calculations suggest that the molecule would be stable, with the C–C bonds to the central ("methane") carbon having a [[bond length|length]] of 166.1 [[picometre|pm]] — longer than the typical C−C bond in order to reduce steric effects, but still shorter than those found in some other real molecules.<ref name=Cheng>{{cite journal | last1=Cheng | first1=M-F | last2=Li | first2=W-K | title=Structural and energetics studies of tri- and tetra-''tert''-butylmethane | journal=Journal of Physical Chemistry A | volume=78 | issue=1 | pages=5492–5498 | year=2003 | doi=10.1021/jp034879r| bibcode=2003JPCA..107.5492C }}</ref>

==See also==

* [[Neopentane]]

* [[Tetrakis(trimethylsilyl)methane]]

* [[Tetrafluoromethane]]

* [[Tetrachloromethane]]

* [[Tetrabromomethane]]

* [[Tetraiodomethane]]

* [[Tetraazidomethane]]

* [[Tetracyanomethane]]

* [[Tetraethynylmethane]]

* [[Tetranitromethane]]

==References==

{{Reflist}}

{{DEFAULTSORT:Tetra-tert-butylmethane}}

[[Category:Alkanes]]

[[Category:Hypothetical chemical compounds]]

[[Category:Tert-butyl compounds]]

{{theoretical-chem-stub}}