Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Tetraoctylammonium bromide: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 401625522 of page Tetraoctylammonium_bromide for the Chem/Drugbox validation project (updated: 'CASNo').
 
correct IUPAC name
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Tetraoctylammonium_bromide|oldid=401625522}} 401625522] of page [[Tetraoctylammonium_bromide]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
| verifiedrevid = 401623936
| Watchedfields = changed
|Reference=<ref>[http://www.sigmaaldrich.com/catalog/search/ProductDetail/FLUKA/87994 Tetraoctylammonium bromide] at [[Sigma-Aldrich]]</ref>
| verifiedrevid = 470604932
|ImageFile=TOAB.png
| Reference =<ref>[http://www.sigmaaldrich.com/catalog/product/aldrich/294136 Tetraoctylammonium bromide] at [[Sigma-Aldrich]]</ref>
|ImageSize=200px
| ImageFile =TOAB.png
|IUPACName=Tetraoctylammonium bromide
| ImageSize =
|OtherNames=
| PIN =''N'',''N'',''N''-Tri(octyl)octan-1-aminium bromide
|Section1= {{Chembox Identifiers
| OtherNames =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2015873
| ChemSpiderID = 2015873
| InChI = 1/C32H68N.BrH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1
| InChI = 1/C32H68N.BrH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1
Line 16: Line 17:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QBVXKDJEZKEASM-UHFFFAOYSA-M
| StdInChIKey = QBVXKDJEZKEASM-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 14866-33-2 -->
| CASNo =14866-33-2
| PubChem=2734117
| UNII_Ref = {{fdacite|correct|FDA}}
|EINECS =238-936-9
| UNII = 52QW29OWOC
| SMILES=CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Br-]
| PubChem =2734117
| EINECS =238-936-9
| SMILES =CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Br-]
}}
}}
|Section2= {{Chembox Properties
|Section2={{Chembox Properties
| Formula=C<sub>32</sub>H<sub>68</sub>BrN
| Formula =C<sub>32</sub>H<sub>68</sub>BrN
| MolarMass=546.79
| MolarMass =546.79
| Appearance=
| Appearance =
| Density=
| Density =
| MeltingPtC = 95 to 98
| MeltingPt=95-98 °C
| MeltingPt_notes =
| BoilingPt=
| BoilingPt =
| Solubility=
| Solubility =
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
}}

'''Tetraoctylammonium bromide''' ('''TOAB''' or '''TOABr''') is a [[quaternary ammonium compound]] with the chemical formula: [CH<sub>3</sub>(CH<sub>2</sub>)<sub>7</sub>]<sub>4</sub>[[Nitrogen|N]] [[Bromine|Br]]. It is generally used as a [[phase transfer catalyst]] between an [[aqueous]] solution and an [[organic compound|organic]] solution.

==References==
<references/>

[[Category:Quaternary ammonium compounds]]


{{organic-compound-stub}}