Tribromoisocyanuric acid: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 416327053
+| Watchedfields = changed
-|   Name = Tribromoisocyanuric acid
+| verifiedrevid = 428799512
-|   ImageFile = Tribromoisocyanuric acid.png
+| Name = Tribromoisocyanuric acid
-|   ImageSize = 150px
+| ImageFile = Tribromoisocyanuric acid.svg
-|   IUPACName = 1,3,5-Tribromo-1,3,5-<br />triazinane-2,4,6-trione
+| ImageSize = 150px
-|   OtherNames = TBCA<br />1,3,5-tribromo-1,3,5-triazine<br />-2,4,6(1H,3H,5H)-trione
+| PIN = 1,3,5-Tribromo-1,3,5-triazinane-2,4,6-trione
-| Section1 = {{Chembox Identifiers
+| OtherNames = TBCA<br />1,3,5-tribromo-1,3,5-triazine<wbr />-2,4,6(1H,3H,5H)-trione
-|   SMILES = C1(=O)N(C(=O)N(C(=O)N1Br)Br)Br
+|Section1={{Chembox Identifiers
-|   CASNo = 17497-85-7
-|   RTECS =
+|  PubChem = 9863943
+|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
+| ChemSpiderID = 8039637
+|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChI = 1S/C3Br3N3O3/c4-7-1(10)8(5)3(12)9(6)2(7)11
+|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = ZKWDCFPLNQTHSH-UHFFFAOYSA-N
+| SMILES = C1(=O)N(C(=O)N(C(=O)N1Br)Br)Br
+| CASNo_Ref = {{cascite|correct|??}}
+| CASNo = 17497-85-7
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = L8RKK5P98Z
+| RTECS =
   }}
-| Section2 = {{Chembox Properties
+|Section2={{Chembox Properties
-|   Formula = C<sub>3</sub>Br<sub>3</sub>N<sub>3</sub>O<sub>3</sub>
+| Formula = C<sub>3</sub>Br<sub>3</sub>N<sub>3</sub>O<sub>3</sub>
-|   MolarMass =  366 g/mol
+| MolarMass = 366 g/mol
-|   Appearance = colourless solid
+| Appearance = colourless solid
-|   Density =
+| Density =
-|   Solubility =
+| Solubility =
-|   Solvent = [[sulfuric acid]]
+| Solvent = [[sulfuric acid]]
-|   SolubleOther = Soluble
+| SolubleOther = Soluble
-|   MeltingPt =
+| MeltingPt =
-|   BoilingPt = decomp.
+| BoilingPt = decomposes
   }}
-| Section3 = {{Chembox Structure
+|Section3={{Chembox Structure
-|   Coordination = planar
+| Coordination = planar
-|   CrystalStruct =
+| CrystalStruct =
-|   Dipole = 0 [[Debye|D]]
+| Dipole = 0 [[Debye|D]]
   }}
-| Section7 = {{Chembox Hazards
+|Section7={{Chembox Hazards
-|   ExternalMSDS =
+| ExternalSDS =
-|   MainHazards = lung irritant
+| MainHazards = lung irritant
-|   FlashPt = NA
+| FlashPt = N/A
-|   RPhrases =
+| HPhrases =
-|   SPhrases =
+| PPhrases =
+| GHS_ref  =
-  }}
+}}
-| Section8 = {{Chembox Related
+|Section8={{Chembox Related
-|   OtherCpds = [[Cyanuric bromide]]<br />[[Dibromoisocyanuric acid]]<br />[[Trichloroisocyanuric acid]]
+| OtherCompounds = [[Cyanuric bromide]]<br />[[Dibromoisocyanuric acid]]<br />[[Trichloroisocyanuric acid]]
   }}
 }}
-'''Tribromoisocyanuric acid''' (C<sub>3</sub>Br<sub>3</sub>N<sub>3</sub>O<sub>3</sub>) is a [[chemical compound]] used as a reagent for [[bromination]] in [[organic synthesis]].<ref>A New Regioselective Bromination of Activated Aromatic Rings, Almeida, L. S. de; Esteves, P. M.; Mattos, M. C. S. Synthesis 2006, No 2 , 221-223. (http://www.thieme-connect.com/ejournals/pdf/synthesis/doi/10.1055/s-2005-918511.pdf)</ref>  It is a white crystalline powder with a strong [[bromine]] odour.  It is similar to [[trichloroisocyanuric acid]].
+'''Tribromoisocyanuric acid''' (C<sub>3</sub>Br<sub>3</sub>N<sub>3</sub>O<sub>3</sub>) is a [[chemical compound]] used as a reagent for [[bromination]] in [[organic synthesis]].<ref>A New Regioselective Bromination of Activated Aromatic Rings, Almeida, L. S. de; Esteves, P. M.; Mattos, M. C. S. Synthesis 2006, No 2 , 221-223. DOI: 10.1055/s-2005-918511 (https://www.thieme-connect.com/products/ejournals/html/10.1055/s-2005-918511)</ref>  It is a white crystalline powder with a strong [[bromine]] odour.  It is similar to [[trichloroisocyanuric acid]].
 ==Uses==
@@ Line 52: / Line 66: @@
 [[Category:Ureas]]
 [[Category:Triazines]]
-[[ja:トリブロモイソシアヌル酸]]