Virginiamycin S1: Difference between revisions
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
move systematic name |
||
| (15 intermediate revisions by 13 users not shown) | |||
| Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| ImageFile = Virginiamycin S1.png |
| ImageFile = Virginiamycin S1.png |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| SystematicName = ''N''-[(6''R'',9''S'',10''R'',13''S'',15a''S'',22''S'',24a''S'')-22-Benzyl-6-ethyl-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyldocosahydro-12''H''-pyrido[2,1-''f'']pyrrolo[2,1-''l''] [1,4,7,10,13,16]oxapentaazacyclononadecin-9-yl]-3-hydroxypyridine-2-carboxamide |
|||
| IUPACName = |
|||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 23152-29-6 |
| CASNo = 23152-29-6 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| ⚫ | |||
| UNII = J91D5GN5AT |
|||
| ⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 4534976 |
|||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 46416 |
|||
| InChI = 1/C43H49N7O10/c1-4-29-40(56)49-21-12-17-30(49)41(57)48(3)32(23-26-13-7-5-8-14-26)42(58)50-22-19-28(51)24-31(50)37(53)47-35(27-15-9-6-10-16-27)43(59)60-25(2)34(38(54)45-29)46-39(55)36-33(52)18-11-20-44-36/h5-11,13-16,18,20,25,29-32,34-35,52H,4,12,17,19,21-24H2,1-3H3,(H,45,54)(H,46,55)(H,47,53)/t25-,29-,30+,31+,32+,34+,35+/m1/s1 |
|||
| InChIKey = FEPMHVLSLDOMQC-IYPFLVAKBH |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C43H49N7O10/c1-4-29-40(56)49-21-12-17-30(49)41(57)48(3)32(23-26-13-7-5-8-14-26)42(58)50-22-19-28(51)24-31(50)37(53)47-35(27-15-9-6-10-16-27)43(59)60-25(2)34(38(54)45-29)46-39(55)36-33(52)18-11-20-44-36/h5-11,13-16,18,20,25,29-32,34-35,52H,4,12,17,19,21-24H2,1-3H3,(H,45,54)(H,46,55)(H,47,53)/t25-,29-,30+,31+,32+,34+,35+/m1/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = FEPMHVLSLDOMQC-IYPFLVAKSA-N |
|||
| SMILES = O=C([C@H](CC2=CC=CC=C2)N(C)[C@]([C@H]6N(CCC6)C5=O)=O)N1[C@H]([C@](N[C@H](C(O[C@H](C)[C@@H](C(N[C@@H]5CC)=O)NC(C4=NC=CC=C4O)=O)=O)[C@]3=CC=CC=C3)=O)CC(CC1)=O |
| SMILES = O=C([C@H](CC2=CC=CC=C2)N(C)[C@]([C@H]6N(CCC6)C5=O)=O)N1[C@H]([C@](N[C@H](C(O[C@H](C)[C@@H](C(N[C@@H]5CC)=O)NC(C4=NC=CC=C4O)=O)=O)[C@]3=CC=CC=C3)=O)CC(CC1)=O |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=43 | H=49 | N=7 | O=10 |
| C=43 | H=49 | N=7 | O=10 |
||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| |
|Section3={{Chembox Hazards |
||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
'''Virginiamycin S1''' is a [[macrolide antibiotic]] in the group of antibiotics known as [[streptogramin B]]. |
'''Virginiamycin S1''' is a [[macrolide antibiotic]] in the group of antibiotics known as [[streptogramin B]].<ref>{{cite journal | title = Studies in the biosynthesis of antibiotics of the virginiamycin family | author = Kingston, David G. I.; Molinero, Anthony A.; Purvis, Michael B.; Reed, Josephine W.; LeFevre, Joseph W. | journal = Revista Latinoamericana de Química | date = 1989 | volume = 20 | issue = 3–4 | pages = 128–132 }}</ref> |
||
==References== |
|||
{{Reflist}} |
|||
[[Category:Macrolide antibiotics]] |
[[Category:Macrolide antibiotics]] |
||