Jump to content

Viscumitol: Difference between revisions

Page 1
Page 2
Content deleted Content added
Yobot (talk | contribs)
m →‎References: WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)
Added bibcode. | Use this tool. Report bugs. | #UCB_Gadget
 
(10 intermediate revisions by 8 users not shown)
Line 1: Line 1:
{{Chembox
{{Chembox
| verifiedrevid = 444244797
| verifiedrevid = 449650367
| ImageFile = Viscumitol.svg
| ImageFile = Viscumitol.svg
| ImageSize = 150px
| ImageSize = 150px
| ImageAlt =
| ImageAlt =
| IUPACName = (1''R'',2''S'',3''R'',4''S'',5''R'',6''S'')-5,6-Dimethoxycyclohexane-1,2,3,4-tetraol
| IUPACName = 1,2-Di-''O''-methyl-''muco''-inositol
| SystematicName = (1''R'',2''S'',3''R'',4''S'',5''R'',6''S'')-5,6-Dimethoxycyclohexane-1,2,3,4-tetrol
| OtherNames = 1,2-Di-''O''-methyl-''muco''-inositol
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 145680-48-4
| CASNo = 145680-48-4
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem =
| UNII = PU5UQL3NFY
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 57459394
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 24764943
| ChemSpiderID = 24764943
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+
| StdInChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+
| SMILES = CO[C@@H]1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1OC)O)O)O)O
| SMILES = CO[C@@H]1[C@H]([C@@H]([C@@H]([C@H]([C@@H]1OC)O)O)O)O
| InChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+
| InChI = 1S/C8H16O6/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-12H,1-2H3/t3-,4+,5+,6-,7-,8+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HREVPIABJKTEDU-CNVXYERZSA-N
| StdInChIKey = HREVPIABJKTEDU-CNVXYERZSA-N
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=8 | H=16 | O=6
| C=8 | H=16 | O=6
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| Solubility = }}
| Solubility = }}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition = }}
| AutoignitionPt = }}
}}
}}


'''Viscumitol''' is a [[cyclitol]]. It is a dimethyl-ether of [[muco-inositol]] that can be isolated from ''[[Viscum album]]''.<ref>{{cite journal | last1 = Richter | first1 = Andreas | title = Viscumitol, a dimethyl-ether of muco-inositol from Viscum album | journal = Phytochemistry | volume = 31 | pages = 3925 | year = 1992 | doi = 10.1016/S0031-9422(00)97555-1}}</ref>
'''Viscumitol''' is a [[cyclitol]]. It is a dimethyl-ether of [[muco-Inositol|''muco''-inositol]] that can be isolated from ''[[Viscum album]]''.<ref>{{cite journal | last1 = Richter | first1 = Andreas | title = Viscumitol, a dimethyl-ether of ''muco''-inositol from ''Viscum album'' | journal = Phytochemistry | volume = 31 | pages = 3925–3927 | year = 1992 | issue = 11 | doi = 10.1016/S0031-9422(00)97555-1| bibcode = 1992PChem..31.3925R }}</ref>


==References==
==References==
Line 38: Line 40:


[[Category:Cyclitols]]
[[Category:Cyclitols]]
[[Category:Methoxy compounds]]