Jump to content

Visnadine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drugbox validation
consistent citation formatting
 
(14 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}}
| Watchedfields = changed
⚫
| verifiedrevid = 443998859
⚫
| UNII = 0RL4V0K263
⚫
| IUPAC_name = (9''R'',10''R'')-10-(acetyloxy)-8,8-dimethyl-2-oxo-9,10-dihydro-2''H'',8''H''-pyrano[2,3-''f'']chromen-9-yl (2''R'')-2-methylbutanoate
⚫
| verifiedrevid = 409097123
⚫
| image = Visnadine.png
⚫
| IUPAC_name = (9''R'',10''R'')-10-(acetyloxy)-8,8-dimethyl-2-oxo-9,10-dihydro-2''H'',8''H''-pyrano[2,3-''f'']chromen-9-yl (2''R'')-2-methylbutanoate

⚫
| image = Visnadine.png
<!--Clinical data-->
⚫
| CAS_number = 477-32-7
| tradename =
⚫
| ATC_prefix = C04
| Drugs.com = {{drugs.com|international|visnadine}}
⚫
| ATC_suffix = AX24
| PubChem = 10157
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
⚫
| CAS_number = 477-32-7
⚫
| ATC_prefix = C04
⚫
| ATC_suffix = AX24
| PubChem = 442151
| ChemSpiderID = 390669
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| UNII = 0RL4V0K263
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08735
| KEGG = D08735

| C=21|H=24|O=7
<!--Chemical data-->
| molecular_weight = 388.41 g/mol
| bioavailability =
| C=21 | H=24 | O=7
| smiles = CC[C@H](C(=O)O[C@H]1[C@@](OC2=C([C@H]1OC(=O)C)C3=C(C=CC(=O)O3)C=C2)(C)C)C
⚫
| protein_bound =
| StdInChI = 1S/C21H24O7/c1-6-11(2)20(24)27-19-18(25-12(3)22)16-14(28-21(19,4)5)9-7-13-8-10-15(23)26-17(13)16/h7-11,18-19H,6H2,1-5H3/t11-,18-,19-/m1/s1
⚫
| metabolism =
| StdInChIKey = GVBNSPFBYXGREE-CXWAGAITSA-N
⚫
| elimination_half-life =
⚫
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}


'''Visnadine''' (or '''visnadin''') is a natural [[vasodilator]].<ref>{{cite journal|last=Durate|first=J|coauthors=Vallejo I, Pérez-Vizcaino F, Jiménez R, Zarzuelo A, Tamargo J|date=1997|title=Effects of visnadine on rat isolated vascular smooth muscles. .|journal=Planta Med|publisher=Thieme Medical Publishers|volume=63|issue=3|pages=233–6|issn=1439-0221|url=http://www.thieme-connect.de/ejournals/abstract/plantamedica/doi/10.1055/s-2006-957660|doi=10.1055/s-2006-957660|pmid=9225605}}</ref> It was first isolated from [[Ammi visnaga|bishop's weed]] (''Ammi visnaga''), a plant indigenous to the Mediterranean region which has been used for centuries in Egypt as a spasmolytic.<ref>{{cite journal | title = Constitution of Samidin, Dihydrosamidin and Visnadin | author = Eric Smith, Norman Hosansky, W. G. Bywater, and Eugene E. van Tamelen | journal = J. Am. Chem. Soc. | year = 1957 | volume = 79 | issue = 13 | pages = 3534–3540 | doi = 10.1021/ja01570a062}}</ref>
'''Visnadine''' (or '''visnadin''') is a natural [[vasodilator]].<ref>{{cite journal | vauthors = Durate J, Vallejo I, Pérez-Vizcaino F, Jiménez R, Zarzuelo A, Tamargo J | title = Effects of visnadine on rat isolated vascular smooth muscles | journal = Planta Medica | volume = 63 | issue = 3 | pages = 233–6 | date = June 1997 | pmid = 9225605 | doi = 10.1055/s-2006-957660 | publisher = Thieme Medical Publishers | s2cid = 260248811 }}</ref> It was first isolated from [[Ammi visnaga|bishop's weed]] (''Ammi visnaga''), a plant indigenous to the Mediterranean region which has been used for centuries in Egypt as a spasmolytic.<ref>{{cite journal | title = Constitution of Samidin, Dihydrosamidin and Visnadin | vauthors = Smith E, Hosansky N, Bywater WG, van Tamelen EE | author-link4 = Eugene van Tamelen | journal = J. Am. Chem. Soc. | year = 1957 | volume = 79 | issue = 13 | pages = 3534–3540 | doi = 10.1021/ja01570a062}}</ref>


==References==
== References ==
{{reflist}}
{{reflist}}




{{Peripheral vasodilators}}
{{Peripheral vasodilators}}
Line 45: Line 57:
[[Category:Pyranochromenes]]
[[Category:Pyranochromenes]]
[[Category:Acetate esters]]
[[Category:Acetate esters]]



{{cardiovascular-drug-stub}}
{{cardiovascular-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"