Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Voglibose: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 462253378 of page Voglibose for the Chem/Drugbox validation project (updated: 'ChEMBL').
 
consistent citation formatting
 
Line 1: Line 1:
{{Short description|Alpha-glucosidase inhibitor}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Voglibose|oldid=462253378}} 462253378] of page [[Voglibose]] with values updated to verified values.}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
{{Drugbox
| verifiedrevid = 447722435
| verifiedrevid = 470631324
| IUPAC_name = (1''S'',2''S'',3''R'',4''S'',5''S'')-5-(1,3-dihydroxypropan-2-ylamino)-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetraol
| IUPAC_name = (1''S'',2''S'',3''R'',4''S'',5''S'')-5-(1,3-dihydroxypropan-2-ylamino)-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetraol
| image = Voglibose structure.svg
| image = Voglibose structure.svg

<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
Line 17: Line 17:
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =

<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
Line 24: Line 23:
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =

<!--Identifiers-->
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 83480-29-9
| CAS_number = 83480-29-9
| ATC_prefix = A10
| ATC_prefix = A10
| ATC_suffix = BF03
| ATC_suffix = BF03
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 476960
| ChEMBL = 476960
| PubChem = 444020
| PubChem = 444020
Line 41: Line 39:
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01665
| KEGG = D01665

<!--Chemical data-->
<!--Chemical data-->
| C=10 | H=21 | N=1 | O=7
| C=10 | H=21 | N=1 | O=7
| molecular_weight = 267.28 g/mol
| smiles = OC[C@@]1(O)C[C@H](NC(CO)CO)[C@H](O)[C@@H](O)[C@@H]1O
| smiles = OC[C@@]1(O)C[C@H](NC(CO)CO)[C@H](O)[C@@H](O)[C@@H]1O
| InChI = 1/C10H21NO7/c12-2-5(3-13)11-6-1-10(18,4-14)9(17)8(16)7(6)15/h5-9,11-18H,1-4H2/t6-,7-,8+,9-,10-/m0/s1
| InChIKey = FZNCGRZWXLXZSZ-CIQUZCHMBI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H21NO7/c12-2-5(3-13)11-6-1-10(18,4-14)9(17)8(16)7(6)15/h5-9,11-18H,1-4H2/t6-,7-,8+,9-,10-/m0/s1
| StdInChI = 1S/C10H21NO7/c12-2-5(3-13)11-6-1-10(18,4-14)9(17)8(16)7(6)15/h5-9,11-18H,1-4H2/t6-,7-,8+,9-,10-/m0/s1
Line 53: Line 47:
| StdInChIKey = FZNCGRZWXLXZSZ-CIQUZCHMSA-N
| StdInChIKey = FZNCGRZWXLXZSZ-CIQUZCHMSA-N
}}
}}
'''Voglibose''' ([[International Nonproprietary Name|INN]] and [[United States Adopted Name|USAN]], trade name '''Voglib''', marketed by Mascot Health Series) is an [[alpha-glucosidase inhibitor]] used for lowering postprandial blood glucose levels in people with [[diabetes mellitus]].<ref name="pmid16457643">{{cite journal | vauthors = Chen X, Zheng Y, Shen Y | title = Voglibose (Basen, AO-128), one of the most important alpha-glucosidase inhibitors | journal = Current Medicinal Chemistry | volume = 13 | issue = 1 | pages = 109–116 | date = 2006 | pmid = 16457643 | doi = 10.2174/092986706789803035 }}</ref> Voglibose is a research product of [[Takeda Pharmaceutical Company]], Japan's largest pharmaceutical company. Vogilbose was discovered in 1981, and was first launched in Japan in 1994,<ref name="NCBIDec72013">{{cite journal | vauthors = Dabhi AS, Bhatt NR, Shah MJ | title = Voglibose: an alpha glucosidase inhibitor | journal = Journal of Clinical and Diagnostic Research | volume = 7 | issue = 12 | pages = 3023–3027 | date = December 2013 | pmid = 24551718 | pmc = 3919386 | doi = 10.7860/JCDR/2013/6373.3838 }}</ref> under the trade name BASEN, to improve postprandial hyperglycemia in [[diabetes mellitus]].<ref>{{cite web | title = Voglibose | url = https://adisinsight.springer.com/drugs/800001172 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref>

[[Postprandial]] [[hyperglycemia]] (PPHG) is primarily due to first phase insulin secretion. Alpha glucosidase inhibitors delay glucose absorption at the intestine level and thereby prevent sudden surge of glucose after a meal.<ref name="NCBIDec72013"/>

There are three major drugs which belong to this class, [[acarbose]], [[miglitol]] and voglibose,<ref name="NCBIDec72013"/> of which voglibose is the newest.

== Efficacy ==
A [[Cochrane (organisation)|Cochrane]] [[systematic review]] assessed the effect of alpha-glucosidase inhibitors in people with impaired [[Prediabetes|glucose tolerance]], impaired [[Glucose test|fasting blood glucose]], elevated glycated hemoglobin A1c ([[Glycated hemoglobin|HbA1c]]).<ref name=":0">{{cite journal | vauthors = Moelands SV, Lucassen PL, Akkermans RP, De Grauw WJ, Van de Laar FA | title = Alpha-glucosidase inhibitors for prevention or delay of type 2 diabetes mellitus and its associated complications in people at increased risk of developing type 2 diabetes mellitus | journal = The Cochrane Database of Systematic Reviews | volume = 2018 | issue = 12 | pages = CD005061 | date = December 2018 | pmid = 30592787 | pmc = 6517235 | doi = 10.1002/14651858.CD005061.pub3 |collaboration = Cochrane Metabolic and Endocrine Disorders Group }}</ref> It was found that there was no conclusive evidence that voglibose compared to diet and exercise or placebo reduced incidence of diabetes mellitus type 2, improved [[Mortality rate|all-cause mortality]], reduced or increased risk of cardiovascular mortality, serious or non-serious adverse events, non-fatal [[stroke]], [[Heart failure|congestive heart failure]], or non-fatal [[myocardial infarction]].<ref name=":0" />

== References ==
{{Reflist}}

== Further reading ==
{{refbegin}}
* {{cite book | vauthors = Miller CK | chapter = New therapeutic options in the treatment of diabetes mellitus | veditors = Greenstein B | date = 2004 | title = Clinical Pharmacology for nurses | edition = 17th | publisher = Elsevier Limited, Churchill Livingstone }}
* {{cite book | vauthors = Wilson L |date = 1997| veditors = Mehra IV |publisher=[[Aspen Publishers]]|pages=62–63|title=Managing the Patient with Type II Diabetes |url= https://books.google.com/books?id=NiKUGHtQrvsC&dq=voglibose&pg=PA62 |isbn=978-0-8342-1018-9}}
{{refend}}

{{Oral hypoglycemics and insulin analogs}}

[[Category:Alpha-glucosidase inhibitors]]
[[Category:Amino sugars]]