Zalospirone: Difference between revisions

| Watchedfields = changed

| verifiedrevid = 437131396

| IUPAC_name = (3aα,4α,4aβ,6aβ,7α,7aα)-hexahydro-2-(4-(4-(2-pyrimidinyl)-1-piperazinyl)butyl)-4,7-etheno-1''H''-cyclobut(f)isoindole-1,3(2''H'')-dione

| excretion =

| molecular_weight = 419.519 g/mol

| smiles = C1CN(CCN1CCCCN2C(=O)[C@H]3[C@H]4C=C[C@@H]([C@H]3C2=O)[C@H]5[C@@H]4C=C5)

'''Zalospirone''' ('''WY-47,846''') is a [[binding_selectivity|selective]] [[5-HT1A receptor|5-HT_1A]] [[partial agonist]] of the [[azapirone]] [[chemical class]].<ref>{{cite journal | last1 = Gleeson | first1 = S | last2 = Barrett | first2 = JE | title = 5-HT1A agonist effects on punished responding of squirrel monkeys | journal = Pharmacology, biochemistry, and behavior | volume = 37 | issue = 2 | pages = 335–7 | year = 1990 | pmid = 1981937 | doi=10.1016/0091-3057(90)90344-H}}</ref><ref>{{cite journal | last1 = Singh | first1 = A | last2 = Lucki | first2 = I | title = Antidepressant-like activity of compounds with varying efficacy at 5-HT1A receptors | journal = Neuropharmacology | volume = 32 | issue = 4 | pages = 331–40 | year = 1993 | pmid = 8497336 }}</ref> It was found to be effective in the treatment of [[anxiety]] and [[major depressive disorder|depression]] in [[clinical trial]]s, but a high proportion of subjects dropped out due to [[side effect]]s and development was subsequently never completed.<ref>{{cite journal | last1 = Rickels | first1 = K | last2 = Derivan | first2 = A | last3 = Kunz | first3 = N | last4 = Pallay | first4 = A | last5 = Schweizer | first5 = E | title = Zalospirone in major depression: a placebo-controlled multicenter study | journal = Journal of clinical psychopharmacology | volume = 16 | issue = 3 | pages = 212–7 | year = 1996 | pmid = 8784652 }}</ref>

[[Category:Pyrimidines]]

{{nervous-system-drug-stub}}