Eticlopride: Difference between revisions

{{short description|Chemical compound}}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 341777703

| IUPAC_name = 5-chloro-3-ethyl-''N''-<nowiki>[[</nowiki>(2''S'')-1-ethylpyrrolidin-2-yl]methyl]-2-hydroxy-6-methoxybenzamide

| image = Eticlopride.svg

| width = 222

<!--Clinical data-->

| tradename =

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->

| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| IUPHAR_ligand = 966

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 84226-12-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 57267

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 51626

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = J8M468HBH4

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 8946

| index2_label = HCl

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 97612-24-3

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = HJ2CAH4TZ1

<!--Chemical data-->

| C=17 | H=25 | Cl=1 | N=2 | O=3

| smiles = CCC1=CC(=C(C(=C1O)C(=O)NCC2CCCN2CC)OC)Cl

}}

'''Eticlopride''' is a selective [[dopamine antagonist]] that acts on [[dopamine receptor D2|D₂ dopamine receptor]]. It is primarily used in pharmacological research.<ref>{{cite web |title=Eticlopride hydrochloride |url=http://www.abcam.com/Eticlopride-hydrochloride-ab120602.html | work = Abcam }}</ref><ref>{{cite journal | vauthors = Claytor R, Lile JA, Nader MA | title = The effects of eticlopride and the selective D3-antagonist PNU 99194-A on food- and cocaine-maintained responding in rhesus monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 83 | issue = 3 | pages = 456–64 | date = March 2006 | pmid = 16631246 | doi = 10.1016/j.pbb.2006.03.007 | s2cid = 39482275 }}</ref><ref>{{cite journal | vauthors = Hemby SE, Smith JE, Dworkin SI | title = The effects of eticlopride and naltrexone on responding maintained by food, cocaine, heroin and cocaine/heroin combinations in rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 277 | issue = 3 | pages = 1247–58 | date = June 1996 | pmid = 8667185 }}</ref><ref>{{cite journal | vauthors = Haile CN, Kosten TA | title = Differential effects of D1- and D2-like compounds on cocaine self-administration in Lewis and Fischer 344 inbred rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 299 | issue = 2 | pages = 509–18 | date = November 2001 | pmid = 11602661 }}</ref>

{{reflist|2}}

== External links ==

*{{MeshName|Eticlopride}}

[[Category:Chloroarenes]]

[[Category:D2 antagonists]]

[[Category:Pyrrolidines]]

{{nervous-system-drug-stub}}