Methimepip: Difference between revisions
Content deleted Content added
m activated IUPHAR link |
m Added UNII (not yet published) and Validated CAS |
||
| (12 intermediate revisions by 8 users not shown) | |||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| verifiedrevid = 360227021 |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| |
| CASNo = 151070-80-3 |
||
| ⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 259YSH2WL6 |
|||
| ⚫ | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 175782 |
|||
| IUPHAR_ligand = 1254 |
| IUPHAR_ligand = 1254 |
||
| |
| SMILES=CN1CCC(CC1)CC2=CN=CN2 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 9488804 |
|||
| InChI = 1/C10H17N3/c1-13-4-2-9(3-5-13)6-10-7-11-8-12-10/h7-9H,2-6H2,1H3,(H,11,12) |
|||
| InChIKey = KIAVPENCSGKVQP-UHFFFAOYAQ |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C10H17N3/c1-13-4-2-9(3-5-13)6-10-7-11-8-12-10/h7-9H,2-6H2,1H3,(H,11,12) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = KIAVPENCSGKVQP-UHFFFAOYSA-N |
|||
| RTECS = |
|||
| MeSHName = C500075 |
|||
}} |
}} |
||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| |
| Formula=C<sub>10</sub>H<sub>17</sub>N<sub>3</sub> |
||
| |
| MolarMass=179.262 g/mol |
||
| |
| Appearance= |
||
| |
| Density= |
||
| |
| MeltingPt= |
||
| |
| BoilingPt= |
||
| |
| Solubility= |
||
}} |
}} |
||
|Section3={{Chembox Hazards |
|Section3={{Chembox Hazards |
||
| |
| MainHazards= |
||
| |
| FlashPt= |
||
| AutoignitionPt = |
|||
| Autoignition= |
|||
}} |
}} |
||
}} |
}} |
||
'''Methimepip''' is a [[histamine agonist]] which is highly selective for the [[Histamine H3 receptor|H<sub>3</sub>]] subtype. It is the ''N''-[[methyl group|methyl]] derivative of [[immepip]].<ref>{{cite journal | |
'''Methimepip''' is a [[histamine agonist]] which is highly selective for the [[Histamine H3 receptor|H<sub>3</sub>]] subtype. It is the ''N''-[[methyl group|methyl]] derivative of [[immepip]].<ref>{{cite journal |vauthors=Kitbunnadaj R, Hashimoto T, Poli E, etal |title=''N''-substituted piperidinyl alkyl imidazoles: discovery of methimepip as a potent and selective histamine H3 receptor agonist |journal=[[Journal of Medicinal Chemistry]] |volume=48 |issue=6 |pages=2100–7 |date=March 2005 |pmid=15771452 |doi=10.1021/jm049475h}}</ref> |
||
==References== |
==References== |
||