Rimcazole: Difference between revisions
Content deleted Content added
SVG |
IB autocalculates MW |
||
(37 intermediate revisions by 23 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{cs1 config|name-list-style=vanc}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
| verifiedrevid = 387268762 |
|||
⚫ | |||
| image = Rimcazole.svg |
| image = Rimcazole.svg |
||
⚫ | |||
<!--Clinical data--> |
|||
⚫ | |||
| |
| tradename = |
||
⚫ | |||
| ATC_supplemental= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank= |
|||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| UNII = C3N1PS8CX1 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 275707 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 48221 |
|||
<!--Chemical data--> |
|||
| C=21 | H=27 | N=3 |
| C=21 | H=27 | N=3 |
||
| smiles = C[C@@H]1CN(C[C@@H](N1)C)CCCN2C3=CC=CC=C3C4=CC=CC=C42 |
|||
| molecular_weight = 321.459 |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
⚫ | |||
| StdInChI = 1S/C21H27N3/c1-16-14-23(15-17(2)22-16)12-7-13-24-20-10-5-3-8-18(20)19-9-4-6-11-21(19)24/h3-6,8-11,16-17,22H,7,12-15H2,1-2H3/t16-,17+ |
|||
⚫ | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| elimination_half-life= |
|||
| StdInChIKey = GUDVQJXODNJRIJ-CALCHBBNSA-N |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''Rimcazole''' is an [[Receptor antagonist|antagonist]]<ref>Gilmore DL, Liu Y, Matsumoto RR |
'''Rimcazole''' is an [[Receptor antagonist|antagonist]]<ref name="Gilmore_2004">{{cite journal | vauthors = Gilmore DL, Liu Y, Matsumoto RR | title = Review of the pharmacological and clinical profile of rimcazole | journal = CNS Drug Reviews | volume = 10 | issue = 1 | pages = 1–22 | date = 2004 | pmid = 14978511 | pmc = 6741722 | doi = 10.1111/j.1527-3458.2004.tb00001.x }}</ref> of the [[sigma receptor]]<ref>{{cite journal | vauthors = Eaton MJ, Lookingland KJ, Moore KE | title = The sigma ligand rimcazole activates noradrenergic neurons projecting to the paraventricular nucleus and increases corticosterone secretion in rats | journal = Brain Research | volume = 733 | issue = 2 | pages = 162–166 | date = September 1996 | pmid = 8891298 | doi = 10.1016/0006-8993(96)00290-9 | s2cid = 42885767 }}</ref> as well as a [[dopamine reuptake inhibitor]].<ref>{{cite journal | vauthors = Husbands SM, Izenwasser S, Loeloff RJ, Katz JL, Bowen WD, Vilner BJ, Newman AH | title = Isothiocyanate derivatives of 9-[3-(cis-3,5-dimethyl-1-piperazinyl)propyl]carbazole (rimcazole): irreversible ligands for the dopamine transporter | journal = Journal of Medicinal Chemistry | volume = 40 | issue = 26 | pages = 4340–4346 | date = December 1997 | pmid = 9435903 | doi = 10.1021/jm9705519 }}</ref> Sigma receptors are thought to be involved in the drug [[psychosis]] that can be induced by some drugs such as [[phencyclidine]] and [[cocaine]], and rimcazole was originally researched as a potential [[antipsychotic]] with a different mechanism of action to traditional antipsychotic drugs. Trials proved inconclusive and rimcazole was not pursued for this application, but other sigma antagonists continue to be researched for a variety of potential applications.<ref name="pmid15547788">{{cite journal | vauthors = Volz HP, Stoll KD | title = Clinical trials with sigma ligands | journal = Pharmacopsychiatry | volume = 37 | issue = Suppl 3| pages = S214–S220 | date = November 2004 | pmid = 15547788 | doi = 10.1055/s-2004-832680 | s2cid = 260238757 }}</ref> Rimcazole has been shown to reduce the effects of cocaine,<ref name="pmid12742518">{{cite journal | vauthors = Katz JL, Libby TA, Kopajtic T, Husbands SM, Newman AH | title = Behavioral effects of rimcazole analogues alone and in combination with cocaine | journal = European Journal of Pharmacology | volume = 468 | issue = 2 | pages = 109–119 | date = May 2003 | pmid = 12742518 | doi = 10.1016/s0014-2999(03)01638-8 }}</ref> and analogues of rimcazole have been shown to be highly effective at blocking the [[convulsions]] caused by cocaine [[overdose]] in animal models.<ref name="pmid11684152">{{cite journal | vauthors = Matsumoto RR, Hewett KL, Pouw B, Bowen WD, Husbands SM, Cao JJ, Newman AH | title = Rimcazole analogs attenuate the convulsive effects of cocaine: correlation with binding to sigma receptors rather than dopamine transporters | journal = Neuropharmacology | volume = 41 | issue = 7 | pages = 878–886 | date = December 2001 | pmid = 11684152 | doi = 10.1016/s0028-3908(01)00116-2 | s2cid = 44328858 }}</ref> |
||
==References== |
== References == |
||
{{Reflist|2}} |
|||
<references/> |
|||
{{Monoamine reuptake inhibitors}} |
|||
{{biochem-stub}} |
|||
{{Sigma receptor modulators}} |
|||
{{pharm-stub}} |
|||
[[Category:Piperazines]] |
[[Category:Piperazines]] |
||
[[Category:Carbazoles]] |
[[Category:Carbazoles]] |
||
[[Category:Dopamine reuptake inhibitors]] |
|||
[[Category:Sigma antagonists]] |
|||
[[Category:Anticonvulsants]] |
|||
{{nervous-system-drug-stub}} |