Panipenem: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
Luckas-bot (talk | contribs)
929,662 edits
m robot Adding: zh:帕尼培南
Add: s2cid. | Use this bot. Report bugs. | #UCB_CommandLine 112/644
 
(21 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| IUPAC_name = (5''R'',6''S'')-3-{[(3''S'')-1-ethanimidoylpyrrolidin-3-yl]sulfanyl}- 6-[(''1''R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene- 2-carboxylic acid
| Watchedfields = changed
⚫
| image = Panipenem.svg
| verifiedrevid = 397252594
⚫
| CAS_number = 87726-17-8
⚫
| IUPAC_name = (5''R'',6''S'')-3-{[(3''S'')-1-ethanimidoylpyrrolidin-3-yl]sulfanyl}- 6-[(''1''R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene- 2-carboxylic acid
| CAS_supplemental =
⚫
| image = Panipenem.svg
⚫
| ATC_prefix = J01

⚫
| ATC_suffix = DH55
<!--Clinical data-->
⚫
| ATC_supplemental = (with [[betamipron]])
| tradename =
⚫
| PubChem = 72015
| Drugs.com = {{drugs.com|international|panipenem}}
⚫
| DrugBank =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| chemical_formula =
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| C=15 | H=21 | N=3 | O=4 | S=1
⚫
| pregnancy_category =
| molecular_weight = 339.40 g/mol
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| bioavailability =
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| protein_bound =
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| metabolism =
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| elimination_half-life =
| excretion =
| legal_status =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 87726-17-8
⚫
| ATC_prefix = J01
⚫
| ATC_suffix = DH55
⚫
| ATC_supplemental = (with [[betamipron]])
⚫
| PubChem = 72015
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = W9769W09JF
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 339323
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 16736434
| KEGG = D01048

<!--Chemical data-->
⚫
| chemical_formula =
⚫
| C=15 | H=21 | N=3 | O=4 | S=1
| smiles = C[C@H]([C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)O)S[C@H]3CCN(C3)C(=N)C)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H21N3O4S/c1-7(19)12-10-5-11(13(15(21)22)18(10)14(12)20)23-9-3-4-17(6-9)8(2)16/h7,9-10,12,16,19H,3-6H2,1-2H3,(H,21,22)/t7-,9+,10-,12-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = TYMABNNERDVXID-DLYFRVTGSA-N
}}
}}
'''Panipenem''' ([[International Nonproprietary Name|INN]]) is a [[carbapenem]] antibiotic used in combination with [[betamipron]].
'''Panipenem''' ([[International Nonproprietary Name|INN]]) is a [[carbapenem]] antibiotic used in combination with [[betamipron]].<ref>{{cite journal | vauthors = Goa KL, Noble S | title = Panipenem/betamipron | journal = Drugs | volume = 63 | issue = 9 | pages = 913–25; discussion 926 | year = 2003 | pmid = 12678575 | doi = 10.2165/00003495-200363090-00005 | s2cid = 263994230 | url = https://www.researchgate.net/publication/10818753 }}</ref> It is not used in the United States.{{cn|date=March 2023}}


==See also==
== See also ==
*[[Panipenem/betamipron]]
* [[Panipenem/betamipron]]


== References ==
{{reflist}}


{{CephalosporinAntiBiotics}}
{{CephalosporinAntiBiotics}}
Line 37: Line 65:
[[Category:Carbapenem antibiotics]]
[[Category:Carbapenem antibiotics]]
[[Category:Pyrrolidines]]
[[Category:Pyrrolidines]]
[[Category:Daiichi Sankyo]]



{{antibiotic-stub}}
{{antibiotic-stub}}

[[zh:帕尼培南]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"