Cyclopentobarbital: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:Wi
 
(32 intermediate revisions by 18 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
⚫
{{drugbox | verifiedrevid = 399737060
{{Drugbox
|
⚫
| verifiedrevid = 399738699
| IUPAC_name = 5-(1-cyclopent-2-enyl)-5-prop-2-enyl-1,3-<br>diazinane-2,4,6-trione
| IUPAC_name = 5-(1-cyclopent-2-enyl)-5-prop-2-enyl-1,3-<br>diazinane-2,4,6-trione
| image = Cyclopal.svg
| image = Cyclopal.svg
| width = 120
| width = 120

<!--Clinical data-->
| tradename =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = Schedule IV
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
⚫
| CAS_number = 76-68-6
| CAS_supplemental = <br />302-34-1 ([[sodium]] salt)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2230XWG55Q
⚫
| ATC_prefix = None
⚫
| ATC_suffix =
⚫
| PubChem = 6454
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6212
| ChemSpiderID = 6212

| InChI = 1/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17)
<!--Chemical data-->
⚫
| C=12 | H=14 | N=2 | O=3
| smiles = O=C1NC(=O)NC(=O)C1(C2/C=C\CC2)C\C=C
| smiles = O=C1NC(=O)NC(=O)C1(C2/C=C\CC2)C\C=C
| InChIKey = XOVJAYNMQDTIJD-UHFFFAOYAJ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17)
| StdInChI = 1S/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XOVJAYNMQDTIJD-UHFFFAOYSA-N
| StdInChIKey = XOVJAYNMQDTIJD-UHFFFAOYSA-N
⚫
| synonyms = Allylpental, Cyclopental, 5-Allyl-5-Δ<sup>2</sup>-Cyclopentenyl Barbituric Acid
⚫
| CAS_number = 76-68-6
⚫
| synonyms = Allylpental, Cyclopental, Dormisan, 5-Allyl-5-Δ<sup>2</sup>-Cyclopentenyl Barbituric Acid
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| PubChem = 6454
⚫
| DrugBank =
⚫
| C = 12 | H = 14 | N = 2 | O = 3
| molecular_weight = 234.251 g/mol
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}


'''Cyclopal''' ('''Dormisan''') is a [[barbiturate]] derivative invented in the 1940s. It has [[sedative]] and [[anticonvulsant]] properties, and was used primarily as an anaesthetic in [[veterinary]] medicine.<ref> Vander Brook MJ, Cartland GF. A Pharmacologic Study of 5-Allyl-5-Cyclopentenyl Barbituric Acid (Cyclopal). Journal of Pharmacology And Experimental Therapeutics, 1944, 80(2): 119-125 </ref> Cyclopal is considered similar in effects to [[phenobarbital]] but lasts almost three times as long, and is considered a long-acting barbiturate with a fairly slow onset of action.
'''Cyclopentobarbital sodium''' ('''Cyclopal''', '''Dormisan''') is a [[barbiturate]] derivative invented in the 1940s.<ref name="MartinGodel2000">{{cite book | vauthors = Martin JR, Godel T, Hunkeler W, Jenck F, Moreau JL, Sleight AJ, Widmer U | chapter = Psychopharmacological agents. | title = Kirk-Othmer Encyclopedia of Chemical Technology | date = December 2000 | doi = 10.1002/0471238961.1619250313011820.a01 | isbn = 0471238961 }} </ref> It has [[sedative]] and [[anticonvulsant]] properties, and was used primarily as an anaesthetic in [[veterinary]] medicine.<ref>{{cite journal | vauthors = Vander Brook MJ, Cartland GF | title = A Pharmacologic Study of 5-Allyl-5-Cyclopentenyl Barbituric Acid (Cyclopal). | journal = Journal of Pharmacology and Experimental Therapeutics | date = 1944 | volume = 80 | issue = 2 | pages = 119–125 | citeseerx = 10.1.1.983.6071 }}</ref> Cyclopal is considered similar in effects to [[phenobarbital]] but lasts almost three times as long, and is considered a long-acting barbiturate with a fairly slow onset of action.


== See also ==
* [[Barbiturate]]


== References ==
== References ==
<references />
<references />


{{pharma-stub}}
{{Anesthetics}}
{{GABAAR PAMs}}

{{barbiturates}}


[[Category:Allyl compounds]]
[[Category:General anesthetics]]
[[Category:Barbiturates]]
[[Category:Barbiturates]]
[[Category:Alkenes]]
[[Category:Cyclopentenes]]

{{sedative-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"