Imetit: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
-{{chembox
+{{Chembox
+| Verifiedfields = changed
-|ImageFile=Imetit.png
+| Watchedfields = changed
-|ImageSize=200px
+| verifiedrevid = 400565709
-|IUPACName=2-(1''H''-imidazol-5-yl)ethyl imidothiocarbamate
+| ImageFile =Imetit.svg
-|OtherNames=
+| IUPACName = 2-(1''H''-imidazol-5-yl)ethyl carbamimidothioate
-|Section1= {{Chembox Identifiers
+| OtherNames =
-|  CASNo=102203-18-9
-|  PubChem=3692
+|Section1 = {{Chembox Identifiers
+| CASNo_Ref = {{cascite|correct|??}}
+| CASNo = 102203-18-9
+| UNII_Ref = {{fdacite|changed|FDA}}
+| UNII = 677MJ4VPZC
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 19439
 | IUPHAR_ligand = 1250
-|  SMILES=C1=C(NC=N1)CCSC(=N)N
+| SMILES = C1=C(NC=N1)CCSC(=N)N
+| PubChem = 3692
-  }}
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
-|Section2= {{Chembox Properties
+| ChemSpiderID = 3564
-|  Formula=C<sub>6</sub>H<sub>10</sub>N<sub>4</sub>S
+| SMILES2 = S(C(=[N@H])N)CCc1cnc[nH]1
-|  MolarMass=170.2354
+| InChI = 1/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10)
-|  Appearance=
+| InChIKey = PEHSVUKQDJULKE-UHFFFAOYAJ
-|  Density=
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
-|  MeltingPt=
+| StdInChI = 1S/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10)
-|  BoilingPt=
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
-|  Solubility=
+| StdInChIKey = PEHSVUKQDJULKE-UHFFFAOYSA-N
-  }}
+ }}
-|Section3= {{Chembox Hazards
-|  MainHazards=
+|Section2 = {{Chembox Properties
-|  FlashPt=
+| Formula = C<sub>6</sub>H<sub>10</sub>N<sub>4</sub>S
-|  Autoignition=
+| MolarMass = 170.2354 g/mol
-  }}
+| Appearance =
+| Density =
+| MeltingPt =
+| BoilingPt =
+| Solubility =
+ }}
+|Section3 = {{Chembox Hazards
+| MainHazards =
+| FlashPt =
+| AutoignitionPt =
+ }}
 }}
-'''Imetit''' is a [[Histamine H3 receptor]] [[agonist]].<ref>{{cite journal | last1 = Garbarg | first1 = M | last2 = Arrang | first2 = JM | last3 = Rouleau | first3 = A | last4 = Ligneau | first4 = X | last5 = Tuong | first5 = MD | last6 = Schwartz | first6 = JC | last7 = Ganellin | first7 = CR | title = S-2-(4-imidazolyl)ethylisothiourea, a highly specific and potent histamine H3 receptor agonist | journal = The Journal of pharmacology and experimental therapeutics | volume = 263 | issue = 1 | pages = 304–10 | year = 1992 | pmid = 1383495 }}</ref>
+'''Imetit''' is a [[Histamine H3 receptor|histamine H<sub>3</sub> receptor]] [[agonist]].<ref>{{cite journal | last1 = Garbarg | first1 = M | last2 = Arrang | first2 = JM | last3 = Rouleau | first3 = A | last4 = Ligneau | first4 = X | last5 = Tuong | first5 = MD | last6 = Schwartz | first6 = JC | last7 = Ganellin | first7 = CR | title = S-2-(4-imidazolyl)ethylisothiourea, a highly specific and potent histamine H3 receptor agonist | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 263 | issue = 1 | pages = 304–10 | year = 1992 | pmid = 1383495 }}</ref>
 ==References==
@@ Line 35: / Line 56: @@
 [[Category:Imidazoles]]
+{{nervous-system-drug-stub}}
-{{pharm-stub}}