Kaempferide: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{more footnotes|date=October 2013}}
-{{chembox
+{{more citations needed|date=October 2013}}
-|   Name = Kaempferide
+{{Chembox
-|   ImageFile = Kaempferide.svg
+| Verifiedfields = changed
-|   ImageSize = 250px
+| Watchedfields = changed
-|   ImageName = Kaempferide structure
+| verifiedrevid = 401009231
-|   IUPACName = 3,5,7-trihydroxy-2-(4-methoxyphenyl)chromen-4-one
+| Name = Kaempferide
-|   OtherNames= Kaempferid<br>4'-Methylkaempferol<br>Kaempferol 4'-methyl ether<br>4'-O-Methylkaempferol
+| ImageFile = Kaempferide.svg
-| Section1 = {{Chembox Identifiers
-|   CASNo = 491-54-3
+| ImageSize = 250px
+| ImageName = Kaempferide structure
-|   PubChem = 5281666
+| IUPACName = 3,5,7-Trihydroxy-4′-methoxyflavone
-|   SMILES = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O
+| SystematicName = 3,5,7-Trihydroxy-2-(4-methoxyphenyl)-4''H''-1-benzopyran-4-one
-  }}
+| OtherNames = Kaempferid<br>4′-Methylkaempferol<br>Kaempferol 4′-methyl ether<br>4′-''O''-Methylkaempferol
-| Section2 = {{Chembox Properties
+|Section1={{Chembox Identifiers
-|   Formula   = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub>
+| CASNo_Ref = {{cascite|correct|??}}
-|   MolarMass = 300.26 g/mol
+| CASNo = 491-54-3
-|   ExactMass = 300.063388
+| UNII_Ref = {{fdacite|correct|FDA}}
-|   Density   =
+| UNII = 508XL61MPD
-|   MeltingPt = <!-- °C -->
+| PubChem = 5281666
-|   BoilingPt =
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
-  }}
+| ChEMBL = 40919
+| ChEBI_Ref = {{ebicite|changed|EBI}}
+| ChEBI = 6099
+| KEGG_Ref = {{keggcite|changed|kegg}}
+| KEGG = C10098
+| SMILES = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
+| ChemSpiderID = 4444985
+| SMILES2 = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O
+| InChI = 1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3
+| InChIKey = SQFSKOYWJBQGKQ-UHFFFAOYAC
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChI = 1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = SQFSKOYWJBQGKQ-UHFFFAOYSA-N
+ }}
+|Section2={{Chembox Properties
+| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub>
+| MolarMass = 300.26 g/mol
+| Density =
+| MeltingPt =
+| BoilingPt =
+ }}
 }}
-'''Kaempferide''' is an [[O-methylated flavonol]], a type of chemical compound. It can be found in ''[[Kaempferia galanga]]'' (aromatic ginger).
+'''Kaempferide''' is an [[O-methylated flavonol|''O''-methylated flavonol]], a type of chemical compound. It can be found in ''[[Kaempferia galanga]]'' (aromatic ginger). It has been noted to inhibit [[pancreatic cancer]] growth by blockading an [[Epidermal growth factor receptor|EGFR]]-related pathway.<ref>{{cite journal|title=Kaempferol Inhibits Pancreatic Cancer Cell Growth and Migration through the Blockade of EGFR-Related Pathway In Vitro|journal=PLOS ONE|volume=11|issue=5|pages=e0155264|doi=10.1371/journal.pone.0155264|pmid=27175782|pmc=4866780|year=2016|last1=Lee|first1=Jungwhoi|last2=Kim|first2=Jae Hoon|bibcode=2016PLoSO..1155264L|doi-access=free}}</ref>
-==Metabolism==
+== Metabolism ==
-The enzyme [[kaempferol 4'-O-methyltransferase]] uses S-adenosyl methionine and [[kaempferol]] to produce S-adenosylhomocysteine and kaempferide.
+The enzyme [[kaempferol 4'-O-methyltransferase|kaempferol 4'-''O''-methyltransferase]] uses [[S-adenosyl-L-methionine|''S''-adenosyl-<small>L</small>-methionine]] and [[kaempferol]] to produce [[S-adenosyl-L-homocysteine|''S''-adenosyl-<small>L</small>-homocysteine]] and kaempferide.
-==Glycosides==
+== Glycosides ==
-[[Icariin]] is the tert-amyl alcohol acetylation of kaempferide 3,7-O-diglycoside.
+[[Icariin]] is the [[tert-amyl alcohol]] derivative of kaempferide 3,7-''O''-diglycoside.
-==External links==
+==References==
+{{Reflist}}
-* [http://www.rdchemicals.com/chemicals.php?mode=details&mol_id=7973 Kaempferide on rechemicals.com]
+== External links ==
+* [http://www.hmdb.ca/metabolites/HMDB0037441 Kaempferide at the HMDB]
 {{flavonol}}
-[[category:flavonols]]
+[[Category:O-methylated flavonols]]
-[[Category:Phenol ethers]]
-[[Category:Resorcinols]]
-{{Polyphenol-stub}}
+{{Aromatic-stub}}
-[[fr:Kaempféride]]