Dioctyl adipate: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
ester changed to diester
No edit summary
 
(30 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 402000786
| Watchedfields = changed
⚫
| verifiedrevid = 405788978
| ImageFile = Dioctyl adipate.svg
| ImageFile = Dioctyl adipate.svg
| ImageSize = 250px
| ImageSize = 250px
| IUPACName = Dioctyl hexanedioate
| PIN = Di(octyl) hexanedioate
| OtherNames =
| OtherNames = Di-''n''-octyl adipate
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 29011
| ChemSpiderID = 29011
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = MBY1SL921L
| UNII = 2BD76YG9SI
| InChI = 1/C22H42O4/c1-3-5-7-9-11-15-19-25-21(23)17-13-14-18-22(24)26-20-16-12-10-8-6-4-2/h3-20H2,1-2H3
| InChI = 1/C22H42O4/c1-3-5-7-9-11-15-19-25-21(23)17-13-14-18-22(24)26-20-16-12-10-8-6-4-2/h3-20H2,1-2H3
| InChIKey = NEHDRDVHPTWWFG-UHFFFAOYAJ
| InChIKey = NEHDRDVHPTWWFG-UHFFFAOYAJ
Line 16: Line 18:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NEHDRDVHPTWWFG-UHFFFAOYSA-N
| StdInChIKey = NEHDRDVHPTWWFG-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|changed|CAS}}
| CASNo =103-23-1
| CASNo =123-79-5
| PubChem = 31271
| PubChem = 31271
| SMILES = O=C(OCCCCCCCC)CCCCC(=O)OCCCCCCCC
| SMILES = O=C(OCCCCCCCC)CCCCC(=O)OCCCCCCCC
| EINECS = 204-652-9
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=22 | H=42 | O=4
| Formula =C<sub>22</sub>H<sub>42</sub>O<sub>4</sub>
| Appearance = Colourless to yellowish liquid<ref name=GESTIS>{{GESTIS|ZVG= 12820}}</ref>
| MolarMass=370.57 g/mol
| Density = 0.98 g/mL<ref name=GESTIS/>
| Appearance =
| Density = 0.92 g/mL
| MeltingPtC = -7.48
| MeltingPt_ref = <ref name=GESTIS/>
| MeltingPt = -67.8 °C
| BoilingPtC = 404.84
| BoilingPt = 214 °C (at 0.67 kPa)
| BoilingPt_ref = <ref name=GESTIS/>
| Solubility =
| Solubility = 0.78 mg/L (22 °C)<ref name=GESTIS/>
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
}}
}}
}}
}}
'''Dioctyl adipate''' or '''DOA''' is a [[plasticizer]]. DOA is a [[diester]] of [[adipic acid]] and two equivalents of [[N-Octanol|''n''-octanol]]. Its chemical formula is {{Carbon}}<sub>22</sub>{{Hydrogen}}<sub>42</sub>{{Oxygen}}<sub>4</sub>.


'''Dioctyl adipate''' ('''DOA''') is an [[organic compound]] with the formula (CH<sub>2</sub>CH<sub>2</sub>CO<sub>2</sub>C<sub>8</sub>H<sub>17</sub>)<sub>2</sub>. It is a colorless oily liquid . As well as related [[diester]]s derived from [[2-ethylhexanol]], [[decanol]], isodecanol, etc., it is used as a [[plasticizer]].<ref name="Ullmann">{{cite book | first = M. T. | last = Musser | chapter = Adipic Acid | title = Ullmann's Encyclopedia of Industrial Chemistry | publisher = Wiley-VCH | location = Weinheim | year = 2005 | doi = 10.1002/14356007.a01_269| isbn = 3527306730 }}</ref><ref>{{cite web | url = http://www.chemicalland21.com/industrialchem/solalc/DIMETHYL%20ADIPATE.htm | title = Dimethyl Adipate | publisher = chemicalland21.com}}</ref>
⚫
[[Bis(2-ethylhexyl) adipate|DEHA]] is sometimes incorrectly called dioctyl adipate.


⚫
[[Bis(2-ethylhexyl) adipate|DEHA]] is sometimes incorrectly called dioctyl adipate. The abbreviation DOA has also been used for bis(2-ethylhexyl) adipate (CAS # 103-23-1).
DOA features flexibility at low temperatures, good electrical properties, good resistance to [[weathering]], and good stability to heat. DOA is used to produce clear films for [[food packaging]] applications. In addition, it is compatible with [[nitrocellulose]], [[ethyl cellulose]], most [[synthetic rubber]]s, and high-butyryl cellulose acetate butyrates. Short chain esters are used as high-boiling, [[biodegradable]], low-toxicity [[solvent]]s and [[antiperspirant]]s. Long chain [[ester]]s of adipic acid are used as [[lubricant]]s for the functions of stability, superior lubricity, corrosion protection, biodegradability, and excellent performance at both high and low temperatures. Adipic acid esters (C5 - C10) are used as low-temperature-resistant and low-viscosity [[plasticizer]]s for [[polymer]]s and cellulose esters.


==Toxicity==
Harmonised tariff code 32151100
Esters of adipic acid exhibit low acute toxicities in animal models. The [[LD50]] of the related ethylhexanoate is estimated at 900&nbsp;mg/kg (rat, i.v.).<ref name="Ullmann"/>


==External links==
==References==
*{{ICSC|1292|12}}
{{reflist}}
*[[International Agency for Research on Cancer|IARC]] Monograph "[http://www-cie.iarc.fr/htdocs/monographs/vol77/77-02.html Di(2-ethylhexyl) adipate.]"


{{HealthIssuesOfPlastics}}
{{HealthIssuesOfPlastics}}


[[Category:Adipates]]
[[Category:Adipate esters]]
[[Category:Plasticizers]]
[[Category:Plasticizers]]
[[Category:IARC Group 3 carcinogens]]
[[Category:IARC Group 3 carcinogens]]

[[nl:Dioctyladipaat]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"