ORG-37684: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (
Importing Wikidata short description: "Chemical compound" (Shortdesc helper)
 
(23 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox | verifiedrevid = 405763311
{{Drugbox
|
| verifiedrevid = 413650153
| IUPAC_name = (3S)-3-[(2,3-dihydro-5-methoxy-1H-inden-4-yl)oxy]pyrrolidine
| IUPAC_name = (3S)-3-[(2,3-dihydro-5-methoxy-1H-inden-4-yl)oxy]pyrrolidine
| image = Org37684_structure.png
| width = 240
| image = ORG-37684.svg
| CAS_number =
| width = 200

| ATC_prefix =
<!--Clinical data-->
| ATC_suffix =
| PubChem = 9794656
| tradename =
| pregnancy_category =
| IUPHAR_ligand = 171
| C = 14 | H = 19 | N = 1 | O = 2
| molecular_weight = 233.305 g/mol
| smiles = COc1ccc2CCCc2c1OC3CNCC3
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_category =
| legal_status = Uncontrolled
| legal_status = Uncontrolled
| routes_of_administration =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number = 213007-95-5
| ATC_prefix =
| ATC_suffix =
| IUPHAR_ligand = 171
| PubChem = 9794656
| ChemSpiderID = 7970423

<!--Chemical data-->
| C=14 | H=19 | N=1 | O=2
| smiles = O(c1c(OC)ccc2c1CCC2)[C@H]3CCNC3
| StdInChI = 1S/C14H19NO2/c1-16-13-6-5-10-3-2-4-12(10)14(13)17-11-7-8-15-9-11/h5-6,11,15H,2-4,7-9H2,1H3/t11-/m0/s1
| StdInChIKey = QDJAYXYEXHVXJV-NSHDSACASA-N
}}
}}


'''ORG-37,684''' is a [[drug]] developed by [[Organon International|Organon]], which acts as a [[potency_(pharmacology)|potent]] and [[functional_selectivity|selective]] [[agonist]] for the [[5-HT2 receptor|5-HT<sub>2</sub>]] [[receptor (biochemistry)|receptor]] family, with highest [[affinity_(pharmacology)|affinity]] at [[5-HT2C receptor|5-HT<sub>2C</sub>]] and lowest at [[5-HT2B receptor|5-HT<sub>2B</sub>]] subtypes.<ref>{{cite doi|10.1081/SCC-100104420}}</ref><ref>Knight AR, Misra A, Quirk K, Benwell K, Revell D, Kennett G, Bickerdike M. Pharmacological characterisation of the agonist radioligand binding site of 5-HT(2A), 5-HT(2B) and 5-HT(2C) receptors. ''Naunyn Schmiedebergs Archives of Pharmacology''. 2004;370:114-123. {{DOI|10.1007/s00210-004-0951-4}} PMID 15322733</ref> It has [[anorectic]] effects in animal studies and has been researched as a potential [[weight loss]] drug for use in humans.<ref>Schreiber R, De Vry J. Role of 5-hT2C receptors in the hypophagic effect of m-CPP, ORG 37684 and CP-94,253 in the rat. ''Progress in Neuropsychopharmacology and Biological Psychiatry''. 2002 Apr;26(3):441-9. PMID 11999893</ref>
'''ORG-37684''' is a [[drug]] developed by [[Organon International|Organon]], which acts as a [[potency (pharmacology)|potent]] and [[functional selectivity|selective]] [[agonist]] for the [[5-HT2 receptor|5-HT<sub>2</sub>]] [[receptor (biochemistry)|receptor]] family, with highest [[affinity (pharmacology)|affinity]] at [[5-HT2C receptor|5-HT<sub>2C</sub>]] and lowest at [[5-HT2B receptor|5-HT<sub>2B</sub>]] subtypes.<ref>{{Cite journal| doi = 10.1081/SCC-100104420| year = 2001| vauthors = Adams D, Duncton M | title = Efficient Synthesis of the 5-Ht2C Receptor Agonist, Org 37684 | journal = Synthetic Communications| volume = 31| issue = 13| pages = 2029–2036 | s2cid = 83706335}}</ref><ref>{{cite journal | vauthors = Knight AR, Misra A, Quirk K, Benwell K, Revell D, Kennett G, Bickerdike M | title = Pharmacological characterisation of the agonist radioligand binding site of 5-HT(2A), 5-HT(2B) and 5-HT(2C) receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 370 | issue = 2 | pages = 114–23 | date = August 2004 | pmid = 15322733 | doi = 10.1007/s00210-004-0951-4 | s2cid = 8938111 }}</ref> It has [[anorectic]] effects in animal studies and has been researched as a potential [[weight loss]] drug for use in humans.<ref>{{cite journal | vauthors = Schreiber R, De Vry J | title = Role of 5-hT2C receptors in the hypophagic effect of m-CPP, ORG 37684 and CP-94,253 in the rat | journal = Progress in Neuro-Psychopharmacology & Biological Psychiatry | volume = 26 | issue = 3 | pages = 441–9 | date = April 2002 | pmid = 11999893 | doi = 10.1016/s0278-5846(01)00284-6 | s2cid = 25689931 }}</ref>


==See also==
== See also ==
* [[Org 12,962]]
* [[ORG-12962]]
* [[Quipazine]]


== References ==
== References ==
{{Reflist|2}}
{{Reflist|2}}


{{Serotonin receptor modulators}}

{{Anorectics}}
{{Serotonergics}}


[[Category:Serotonin receptor agonists]]
[[Category:Serotonin receptor agonists]]
Line 38: Line 49:
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:Pyrrolidines]]
[[Category:Pyrrolidines]]



{{gastrointestinal-drug-stub}}
{{gastrointestinal-drug-stub}}