Dillapiole: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL KEGG.
Neyvous (talk | contribs)
mNo edit summary
 
(43 intermediate revisions by 27 users not shown)
Line 1: Line 1:
{{Refimprove|date=July 2009}}
{{chembox
{{chembox
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 399906885
| verifiedrevid = 414425598
| Name = Dillapiole
| Name = Dillapiole
| ImageFile = Dillapiole acsv.svg
| ImageFile = Dillapiole structure.svg
| ImageAlt = Skeletal formula
<!-- | ImageSize = 120px -->
| ImageFile1 = Dillapiole-3D-balls.png
| ImageName =
| ImageSize1 = 180
| IUPACName = 1-Allyl-2,3-dimethoxy-4,5-<br />(methylenedioxy)benzene
| ImageAlt1 = Ball-and-stick model
| PIN = 4,5-Dimethoxy-6-(prop-2-en-1-yl)-2''H''-1,3-benzodioxole
| OtherNames = 6-Allyl-4,5-dimethoxybenzo[''d''][1,3]dioxole<br />1-Allyl-2,3-dimethoxy-4,5-(methylenedioxy)benzene
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9814
| ChemSpiderID = 9814
| EINECS = 621-020-1
| PubChem = 10231
| PubChem = 10231
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C10449
| KEGG = C10449
| InChI = 1/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3
| InChI = 1/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3
| InChIKey = LIKYNOPXHGPMIH-UHFFFAOYAI
| InChIKey = LIKYNOPXHGPMIH-UHFFFAOYAI
| SMILES = O1c2cc(c(OC)c(OC)c2OC1)CC=C
| SMILES = O1c2cc(c(OC)c(OC)c2OC1)CC=C
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 470874
| ChEMBL = 470874
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 21: Line 26:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LIKYNOPXHGPMIH-UHFFFAOYSA-N
| StdInChIKey = LIKYNOPXHGPMIH-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 484-31-1
| CASNo = 484-31-1
| CASNo_Comment = {{Citation needed|date=July 2009}}
| CASNo_Comment = {{Citation needed|date=July 2009}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 438CJQ562D
}}
}}
| Section2 = {{Chembox Properties
| Section2 = {{Chembox Properties
| Formula = C<sub>12</sub>H<sub>14</sub>O<sub>4</sub>
| C=12 | H=14 | O=4
| MolarMass = 222.24 g/mol
| Density = 1.163 g/cm<sup>3</sup>
| Density = 1.163 g/cm³
}}
}}
}}
}}


'''Dillapiole''' is an [[organic chemical compound]] and [[essential oil]] commonly extracted from [[dill weed]], though it can be found in a variety of other plants such as [[fennel]] root.<ref>{{cite book|last=Azeez|first=Shamina|title=Chemistry of Spices|year=2008|publisher=Biddles Ltd.|location=Calicut, Kerala, India|isbn=9781845934057|pages=227–241 [230]|url=https://books.google.com/books?id=5WY08iuJyawC&q=Chemistry+of+Spices}}</ref> This compound is closely related to [[apiole]], having a [[methoxy]] group positioned differently on the [[benzene ring]].<ref>{{Cite journal | last1 = Santos | first1 = P. A. G. | last2 = Figueiredo | first2 = A. C. | last3 = Lourenço | first3 = P. M. L. | last4 = Barroso | first4 = J. G. | last5 = Pedro | first5 = L. G. | last6 = Oliveira | first6 = M. M. | last7 = Schripsema | first7 = J. | last8 = Deans | first8 = S. G. | last9 = Scheffer | first9 = J. J. C. | title = Hairy root cultures of Anethum graveolens (Dill): Establishment, growth, time-course study of their essential oil and its comparison with parent plant oils| journal = Biotechnology Letters | volume = 24 | issue = 12 | pages = 1031–1036| year = 2002 | doi = 10.1023/A:1015653701265 | s2cid = 10120732 }}</ref><ref>{{Cite journal | doi = 10.1038/2151494b0 | last1 = Shulgin | first1 = A. T. | last2 = Sargent | first2 = T. | title = Psychotrophic phenylisopropylamines derived from apiole and dillapiole | journal = Nature | volume = 215 | issue = 5109 | pages = 1494–1495 | year = 1967| pmid = 4861200| bibcode = 1967Natur.215.1494S | s2cid = 26334093 }}</ref> Dillapiole works synergically with certain insecticides like [[pyrethrin]]s similarly to [[piperonyl butoxide]], which likely results from inhibition of the [[Mixed-function_oxidase|MFO]] enzyme of insects.<ref>{{cite patent | country = IN | number = 128,129 | status = patent | title = Improvements in or relating to methylenedioxyphenyl derivatives | pubdate = 1970-08-21 | gdate = 1970-10-24 | fdate = | pridate = | inventor = Mankombu Sambasivan Swaminathan | invent1 = | invent2 = | assign1 = | assign2 = | class = | url = }}</ref>
'''Dillapiole''' is an [[organic chemical compound]] and [[essential oil]] commonly extracted from [[dill weed]], though can be found in a variety of other plants.


No carcinogenicity was detected with parsley apiol or dill apiol in mice.<ref>{{cite journal | doi = 10.1093/carcin/5.12.1623| pmid = 6499113| title = 32P-Post-labelling analysis of DNA adducts formed in the livers of animals treated with safrole, estragole and other naturally-occurring alkenylbenzenes. II. Newborn male B6C3F1 mice| journal = Carcinogenesis| volume = 5| issue = 12| pages = 1623–1628| year = 1984| last1 = Phillips| first1 = David H.| last2 = Reddy| first2 = M. Vijayaraj| last3 = Randerath| first3 = Kurt}}</ref>
This compound is closely related to [[apiole]] having a [[methoxy]] group positioned differently on the [[benzene ring]] {{Citation needed|date=July 2009}}.
== References ==

{{reflist}}
==References==
{{Citation style|date=September 2007}}
<references/>
* Shulgin, Alexander. "Psychotropic Phenylisopropylamines derived from Apiole and Dillapiole". Nature 215, 1494-95 (1967)


== See also ==
== See also ==
* [[Apiol]]
* [[Apiole]]
* [[Phenylpropene]]


{{Phenylpropene}}
[[Category:Aromatic compounds]]

[[Category:Phenylpropanoids]]
[[Category:Phenylpropenes]]
[[Category:O-methylated phenylpropanoids]]
[[Category:Benzodioxoles]]
[[Category:Benzodioxoles]]
[[Category:Phenol ethers]]
[[Category:Allyl compounds]]
[[Category:Alkenes]]
[[Category:Pyrogallol ethers]]
[[Category:Hydroxyquinol ethers]]



{{aromatic-stub}}
{{aromatic-stub}}

[[de:Dillapiol]]
[[id:Dilapiola]]