Tetraphenylborate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Ion}}
 {{chembox
+| Verifiedfields = changed
 | Watchedfields = changed
-| verifiedrevid = 408870883
+| verifiedrevid = 414858755
 | ImageFile = Tetraphenylborate.png
 | ImageSize = 200px
-| IUPACName = Tetraphenylboranuide (parent hydride)<br>Tetraphenylborate(1-) (additive)
+| PIN = Tetraphenylboranuide
-| OtherNames =
+| OtherNames = Tetraphenylborate(1−) (additive)
-| Section1 = {{Chembox Identifiers
+|Section1={{Chembox Identifiers
 | CASNo = 4358-26-3
+| CASNo_Ref = {{cascite|correct|}}
 | PubChem = 8934
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
-| SMILES = [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4}}
+| ChemSpiderID = 8592
-| Section2 = {{Chembox Properties
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
-| C=24|H=20|B=1
+| StdInChI = 1S/C24H20B/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H/q-1
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = SVHQOIWIRUVWII-UHFFFAOYSA-N
+| RTECS =
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 587884
+| UNII_Ref = {{fdacite|changed|FDA}}
+| UNII = 8TYC18K6NX
+| MeSHName = D013775
+| SMILES = [B-](c1ccccc1)(c2ccccc2)(c3ccccc3)c4ccccc4
+  }}
+|Section2={{Chembox Properties
+| C=24 | H=20 | B=1
 | Appearance =
 | Density =
 | MeltingPt =
 | BoilingPt =
-| Solubility = }}
+| Solubility =
+  }}
-| Section3 = {{Chembox Hazards
+|Section3={{Chembox Hazards
 | MainHazards =
 | FlashPt =
-| Autoignition = }}
+| AutoignitionPt =
+  }}
 }}
-'''Tetraphenylborate''' ([[IUPAC]] name: '''Tetraphenylboranuide''') is an [[organoboron chemistry|organoboron]] [[anion]] consisting of a central [[boron]] atom with four [[phenyl group]]s.  Tetraphenylborate uncouples [[oxidative phosphorylation]].<ref>{{cite journal| doi = 10.1016/0003-9861(67)90226-3| author = Utsumi, Kozo; Packer, Lester | title = Uncoupling of energy transfer reactions in mitochondria by tetraphenylboron | journal = Archives of Biochemistry and Biophysics |year = 1967 | volume=122 | issue=2| pages=509–15| pmid = 4229179}}</ref>
+'''Tetraphenylborate''' ([[IUPAC]] name: '''tetraphenylboranuide''') is an [[organoboron chemistry|organoboron]] [[anion]] consisting of a central [[boron]] atom with four [[phenyl group]]s.  Salts of tetraphenylborate [[uncoupler|uncouple]] [[oxidative phosphorylation]].<ref>{{cite journal| doi = 10.1016/0003-9861(67)90226-3|author1=Utsumi, Kozo |author2=Packer, Lester | title = Uncoupling of energy transfer reactions in mitochondria by tetraphenylboron | journal = Archives of Biochemistry and Biophysics |year = 1967 | volume=122 | issue=2| pages=509–15| pmid = 4229179}}</ref>
 ==See also==
@@ Line 29: / Line 47: @@
 *[[Potassium tetraphenylborate]]
 *[[Triphenylborane]]
+*[[Tetrakis(3,5-bis(trifluoromethyl)phenyl)borate|BARF]] and other fluorinated derivatives are used as [[non-coordinating anions]].
 ==References==
 {{reflist}}
-[[Category:Tetraphenylborates|*]]
+[[Category:Tetraphenylborates| ]]
+[[Category:Anions]]
+[[Category:Uncouplers]]
-{{chemistry-stub}}
+{{Organic-compound-stub}}
-[[nl:Tetrafenylboraat]]