UK-432,097: Difference between revisions
Content deleted Content added
No edit summary |
move systematic name |
||
(29 intermediate revisions by 22 users not shown) | |||
Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
| ImageSize = 300 |
|||
| verifiedrevid = 420447010 |
|||
⚫ | |||
⚫ | |||
| IUPACName = 6-(2,2-diphenylethylamino)-9-((2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxytetrahydrofuran-2-yl)-N-(2-(3-(1-(pyridin-2-yl)piperidin-4-yl)ureido)ethyl)-9H-purine-2-carboxamide |
|||
| |
| ImageSize = 330 |
||
⚫ | |||
⚫ | |||
| SystematicName = (1<sup>2</sup>''R'',1<sup>3</sup>''R'',1<sup>4</sup>''S'',1<sup>5</sup>''S'')-2<sup>6</sup>-[(2,2-Diphenylethyl)amino]-''N''-ethyl-1<sup>3</sup>,1<sup>4</sup>-dihydroxy-3,8-dioxo-4,7,9-triaza-2(9,2)-purina-11(2)-pyridina-10(4,1)-piperidina-1(2)-oxolanaundecaphane-1<sup>5</sup>-carboxamide |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| PubChem = 9833519 |
|||
| CASNo_Ref = {{cascite|correct|??}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
⚫ | |||
| |
| UNII = 8L3OAJ1R5A |
||
| |
| PubChem = 9833519 |
||
| |
| ChEMBL = 1096896 |
||
⚫ | |||
| O = 6 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ExactMass = 777.89 g mol<sup>-1</sup> |
|||
| ChemSpiderID = 8009243 |
|||
| SMILES2 = O=C(NC2CCN(c1ncccc1)CC2)NCCNC(=O)c5nc3c(ncn3[C@@H]4O[C@H](C(=O)NCC)[C@@H](O)[C@H]4O)c(n5)NCC(c6ccccc6)c7ccccc7 |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C40H47N11O6/c1-2-41-37(54)33-31(52)32(53)39(57-33)51-24-46-30-34(45-23-28(25-11-5-3-6-12-25)26-13-7-4-8-14-26)48-35(49-36(30)51)38(55)43-19-20-44-40(56)47-27-16-21-50(22-17-27)29-15-9-10-18-42-29/h3-15,18,24,27-28,31-33,39,52-53H,2,16-17,19-23H2,1H3,(H,41,54)(H,43,55)(H2,44,47,56)(H,45,48,49)/t31-,32+,33-,39+/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = ZOTHAEBAWXWVID-HXEFRTELSA-N |
|||
⚫ | |||
⚫ | |||
| C=40 | H=47 | N=11 | O=6 |
|||
}} |
}} |
||
}} |
}} |
||
'''UK-432,097''' is a drug developed by [[Pfizer]] for the treatment of [[chronic obstructive pulmonary disease]], which acts as a potent and selective [[agonist]] of the [[adenosine A2A receptor|adenosine A<sub>2A</sub> receptor]].<ref>{{Cite |
'''UK-432,097''' is a drug developed by [[Pfizer]] for the treatment of [[chronic obstructive pulmonary disease]], which acts as a potent and selective [[agonist]] of the [[adenosine A2A receptor|adenosine A<sub>2A</sub> receptor]].<ref>{{Cite journal | last1 = Russo | first1 = Cristina | last2 = Arcidiacono | first2 = Giuseppe | last3 = Polosa | first3 = Riccardo | doi = 10.1111/j.1472-8206.2005.00388.x | title = Adenosine receptors: promising targets for the development of novel therapeutics and diagnostics for asthma | journal = Fundamental and Clinical Pharmacology | volume = 20 | issue = 1 | pages = 9–19 | year = 2006 | pmid = 16448391| s2cid = 20463970 }}</ref> It was discontinued from [[clinical trial]]s following poor efficacy results,<ref>[http://clinicaltrials.gov/ct2/show/results/NCT00430300 Safety And Efficacy Of UK-432,097 In Chronic Obstructive Pulmonary Disease. ClinicalTrials.gov]</ref> but its high selectivity has made it useful for detailed mapping of the internal structure of the A<sub>2A</sub> receptor.<ref name="pmid21393508">{{cite journal |vauthors=Xu F, Wu H, Katritch V, Han GW, Jacobson KA, Gao ZG, Cherezov V, Stevens RC |title=Structure of an Agonist-Bound Human A2A Adenosine Receptor |journal=Science |volume= 332|issue= 6027|pages= 322–7|date=March 2011 |pmid=21393508 |doi=10.1126/science.1202793 |pmc=3086811|bibcode=2011Sci...332..322X }}</ref> |
||
⚫ | |||
⚫ | |||
⚫ | |||
[[Category:Adenosine receptor agonists]] |
|||
⚫ | |||
[[Category:Abandoned drugs]] |
|||
⚫ | |||
{{respiratory-system-drug-stub}} |
|||
{{Organic-compound-stub}} |
{{Organic-compound-stub}} |
||
{{Pharma-stub}} |
|||
⚫ |