EMD-386088: Difference between revisions

| verifiedrevid = 400123895

| IUPAC_name = 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-1''H''-indole

| image = EMD386088.png

| CAS_number = 54635-62-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 10131112

| C = 14 | H = 14 | Cl = 1 | N = 2

| molecular_weight = 245.727 g/mol

| smiles = Clc2cc1c(cc2)nc(C)c1C=3CCNCC=3

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

'''EMD-386,088''' is an [[indole]] derivative which is used in [[scientific research]]. It acts as a [[potency (pharmacology)|potent]] and [[binding selectivity|selective]] [[5-HT6 receptor|5-HT₆ receptor]] [[agonist]], with a [[Dissociation constant|K_i]] of 1 nM, a significantly higher [[affinity (pharmacology)|affinity]] than older 5-HT₆ agonists such as [[EMDT]], although it possesses moderate affinity for the [[5-HT3 receptor|5-HT₃ receptor]] as well.<ref>{{cite journal | last1 = Mattsson | first1 = C | last2 = Sonesson | first2 = C | last3 = Sandahl | first3 = A | last4 = Greiner | first4 = HE | last5 = Gassen | first5 = M | last6 = Plaschke | first6 = J | last7 = Leibrock | first7 = J | last8 = Böttcher | first8 = H | title = 2-Alkyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indoles as novel 5-HT6 receptor agonists | journal = Bioorganic & medicinal chemistry letters | volume = 15 | issue = 19 | pages = 4230–4 | year = 2005 | pmid = 16055331 | doi = 10.1016/j.bmcl.2005.06.067 }}</ref>

{{Serotonergics}}

[[Category:Pyridines]]

[[Category:Serotonin receptor agonists]]

[[Category:Organochlorides]]