1,3-Benzodioxolyl-N-ethylbutanamine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (
m typo
 
(29 intermediate revisions by 23 users not shown)
Line 1: Line 1:
{{Short description|Entactogen, stimulant, and psychedelic designer drug}}
{{Multiple issues|
{{one source|date=June 2015}}
{{notability|date=June 2015}}
}}
{{DISPLAYTITLE:1,3-Benzodioxolyl-''N''-ethylbutanamine}}
{{chembox
{{chembox
| Name = 1,3-Benzodioxolyl-''N''-ethylbutanamine
| verifiedrevid = 407302655
| verifiedrevid = 424770772
| ImageFile1 = Ethyl-J.png
| ImageFile1 = Ethyl-J_svg.svg
| ImageSize1 = 200px
| ImageSize1 =
| ImageFile2 =
| ImageFile2 =
| ImageSize2 = 200px
| ImageSize2 =
| IUPACName = (1-Benzo[1,3]dioxol-5-ylmethyl-propyl)-ethyl-amine
| PIN = 1-(2''H''-1,3-Benzodioxol-5-yl)-''N''-ethylbutan-2-amine
| OtherNames = 3,4-Methenedioxy-α,''N''-diethyl-phenethylamine
| OtherNames = 3,4-Methenedioxy-α,''N''-diethyl-phenethylamine; 3,4-Methylenedioxy-''N''-ethylbutanphenamine; MDEB
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 167394-39-0
| CASNo = 167394-39-0
| CASNo_Ref = {{cascite|correct|CAS}}
⚫
| PubChem =
| UNII = 5Y22MYG54G
⚫
| SMILES = C1=C2C(=CC=C1CC(CC)NCC)OCO2
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| PubChem = 10214504
| ChemSpiderID = 8389996
⚫
| SMILES = O1c2ccc(cc2OC1)CC(NCC)CC
| InChI = 1/C13H19NO2/c1-3-11(14-4-2)7-10-5-6-12-13(8-10)16-9-15-12/h5-6,8,11,14H,3-4,7,9H2,1-2H3
| InChIKey = IYZPKSQJPVUWRO-UHFFFAOYAT
| StdInChI = 1S/C13H19NO2/c1-3-11(14-4-2)7-10-5-6-12-13(8-10)16-9-15-12/h5-6,8,11,14H,3-4,7,9H2,1-2H3
| StdInChIKey = IYZPKSQJPVUWRO-UHFFFAOYSA-N
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C =13
| Formula = C<sub>13</sub>H<sub>19</sub>NO<sub>2</sub>
| H =19
| MolarMass = 221.30 g/mol
| N =1
| O =2
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPtC = 176 to 177
| MeltingPt = 176–177 °C
| MeltingPt_notes =
| BoilingPt =
| BoilingPt =
| Solubility = }}
| Solubility = }}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition = }}
| AutoignitionPt =
}}
}}
}}


'''Ethylbenzodioxolylbutanamine''' ('''EBDB'''; '''Ethyl-J''') is a lesser-known [[entactogen]], [[stimulant]], and [[psychedelic drug|psychedelic]]. It is the ''N''-[[ethyl group|ethyl]] [[analogue (chemistry)|analogue]] of [[benzodioxylbutanamine]] (BDB; "J"), and also the [[alpha carbon|α]]-[[ethyl group|ethyl]] analogue of [[methylenedioxyethylamphetamine]] (MDEA; "Eve").
'''Ethylbenzodioxolylbutanamine''' ('''EBDB'''; '''Ethyl-J''') is a lesser-known [[entactogen]], [[stimulant]], and [[psychedelic drug|psychedelic]]. It is the ''N''-[[ethyl group|ethyl]] [[analogue (chemistry)|analogue]] of [[benzodioxylbutanamine]] (BDB; "J"), and also the [[alpha carbon|α]]-[[ethyl group|ethyl]] analogue of [[methylenedioxyethylamphetamine]] (MDEA; "Eve").


EBDB was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]''), the minimum dosage consumed was 90 [[milligram|mg]], and the duration is unknown. EBDB produced few to no effects at the dosage range tested in PiHKAL, but at higher doses of several hundred milligrams it produces euphoric effects similar to those of [[methylbenzodioxylbutanamine]] (MBDB; "Eden", "Methyl-J"), although milder and shorter lasting.
EBDB was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', the minimum dosage consumed was 90 [[milligram|mg]], and the duration is unknown.<ref>[http://www.erowid.org/library/books_online/pihkal/pihkal077.shtml Ethyl-J Entry in ''PiHKAL'']</ref> EBDB produced few to no effects at the dosage range tested in ''PiHKAL'', but at higher doses of several hundred milligrams it produces euphoric effects similar to those of [[methylbenzodioxylbutanamine]] (MBDB; "Eden", "Methyl-J"), although milder and shorter lasting.{{citation needed|date=August 2016}}


Very little data exists about the pharmacological properties, metabolism, and toxicity of EBDB.
Very little data exists about the pharmacological properties, metabolism, and toxicity of EBDB.


==See also==
==See also==
* [[Benzodioxolylbutanamine]] (BDB; J)
⚫
* [[Eutylone]] (bk-EBDB)
* [[Methylbenzodioxolylbutanamine]] (MBDB; Methyl-J)
* [[Methylbenzodioxolylbutanamine]] (MBDB; Methyl-J)
* [[Ethylbenzodioxolylpentanamine]] (EBDP; Ethyl-K)
* [[Ethylbenzodioxolylpentanamine]] (EBDP; Ethyl-K)
⚫
* [[Eutylone]] (βk-Ethyl-J)


==References==
==References==
{{reflist|2}}
{{reflist}}

==External links==
* [http://www.erowid.org/library/books_online/pihkal/pihkal077.shtml Ethyl-J Entry in ''PiHKAL'']
* [http://pihkal.info/read.php?domain=pk&id=77 Ethyl-J Entry in PiHKAL • info]


{{Entactogens}}
{{Entactogens}}
{{Monoamine releasing agents}}
{{Stimulants}}
{{Adrenergics}}
{{Dopaminergics}}
{{Serotonergics}}
{{Phenethylamines}}
{{Phenethylamines}}
{{Methylenedioxyphenethylamines}}
{{PiHKAL}}


{{DEFAULTSORT:Benzodioxolyl-N-ethylbutanamine, 1,3-}}
[[Category:Psychedelic phenethylamines]]
[[Category:Psychedelic phenethylamines]]
[[Category:Designer drugs]]
[[Category:Benzodioxoles]]
[[Category:Benzodioxoles]]
[[Category:Serotonin-norepinephrine-dopamine releasing agents]]
[[Category:Entactogens and empathogens]]




{{pharm-stub}}
{{nervous-system-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"