Leukotriene D4: Difference between revisions

{{DISPLAYTITLE:Leukotriene D₄}}

| Name = Leukotriene D₄

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428848536

| ImageFile=Leukotriene D4.svg

| ImageSize=

| SystematicName=(5''S'',6''R'',7''E'',9''E'',11''Z'',14''Z'')-6-({(2''R'')-2-Amino-3-[(carboxymethyl)amino]-3-oxopropyl}sulfanyl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=73836-78-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5FNY4416UE

| PubChem=5280878

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 28666

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 288943

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4444401

| SMILES= CCCCC\C=C/C\C=C/C=C/C=C/[C@@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O

| InChI = 1/C25H40N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h6-7,9-13,16,20-22,28H,2-5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t20-,21-,22+/m0/s1

| InChIKey = YEESKJGWJFYOOK-IJHYULJSBX

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C25H40N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h6-7,9-13,16,20-22,28H,2-5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t20-,21-,22+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YEESKJGWJFYOOK-IJHYULJSSA-N

| MeSHName=Leukotriene+D4

|Section2={{Chembox Properties

| C = 25 | H = 40 | N = 2 | O = 6 | S = 1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

'''Leukotriene D₄''' ('''LTD₄''') is one of the [[leukotrienes]]. Its main function in the body is to induce the [[Muscle contraction|contraction of smooth muscle]], resulting in [[bronchoconstriction]] and [[vasoconstriction]]. It also increases [[vascular permeability]]. LTD₄ is released by [[basophil]]s. Other leukotrienes that function in a similar manner are leukotrienes [[Leukotriene C4|C₄]] and [[Leukotriene E4|E₄]]. Pharmacological agents that inhibit the function of these leukotrienes are [[antileukotriene|leukotriene receptor antagonists]] (e.g., [[zafirlukast]], [[montelukast]]) and are useful for [[Asthma|asthmatic individuals]].<ref>{{cite web | url = https://www.drugs.com/monograph/montelukast.html | title = Montelukast (Monograph) | publisher = drugs.com }}</ref>

==References==

{{Reflist}}

{{Leukotrienergics}}