Ro60-0213: Difference between revisions

{{drugbox

| IUPAC_name = (S)-1-(7-methoxyindeno[1,2-b]pyrrol-1(4H)-yl)propan-2-amine

| image = Ro60-0213_structure.png

| CAS_number =

| ATC_prefix =

| ATC_suffix =

| PubChem =

| C=15 | H=20 | N=2 | O=1

| molecular_weight = 244.331 g/mol

| smiles = C2=CN(CC(C)N)C1C2Cc3c1cc(OC)cc3

| melting_point =

| melting_high =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

'''Ro60-0213''' ('''Org 35032''') is a drug developed by [[Hoffmann–La Roche]], which acts as a potent and selective [[agonist]] for the [[5-HT2C receptor|5-HT_2C]] [[serotonin]] [[Receptor (biochemistry)|receptor]], with more than 100x selectivity over other closely related serotonin receptor subtypes, and little or no affinity at other receptors. It was developed as a potential [[antidepressant]],<ref>{{Cite doi|10.1016/S0165-7208(98)80044-5}}</ref> but was discontinued from clinical development at an early stage due to toxicity concerns.<ref>Albertini S, Bös M, Gocke E, Kirchner S, Muster W, Wichmann J. Suppression of mutagenic activity of a series of 5HT2c receptor agonists by the incorporation of a gem-dimethyl group: SAR using the Ames test and a DNA unwinding assay. ''Mutagenesis''. 1998 Jul;13(4):397-403. PMID 9717178</ref> However the high selectivity of Ro60-0213 for 5-HT_2C makes it of continued interest for research into serotonin receptors.<ref>{{cite journal | last1 = Shimada | first1 = I | last2 = Maeno | first2 = K | last3 = Kazuta | first3 = K | last4 = Kubota | first4 = H | last5 = Kimizuka | first5 = T | last6 = Kimura | first6 = Y | last7 = Hatanaka | first7 = K | last8 = Naitou | first8 = Y | last9 = Wanibuchi | first9 = F | title = Synthesis and structure-activity relationships of a series of substituted 2-(1H-furo2,3-gindazol-1-yl)ethylamine derivatives as 5-HT2C receptor agonists | journal = Bioorganic & medicinal chemistry | volume = 16 | issue = 4 | pages = 1966–82 | year = 2008 | pmid = 18035544 | doi = 10.1016/j.bmc.2007.10.100 }}</ref>

==See also==

==References==

[[Category:Hoffmann-La Roche]]

{{pharm-stub}}