LY-334370: Difference between revisions

{{chembox

| verifiedrevid = 376944058

| ImageFile = LY334370.png

| ImageSize = 200px

| IUPACName = 4-fluoro-''N''-[3-(1-methyl-4-piperidinyl)-1''H''-indol-5-yl]benzamide

| Section1 = {{Chembox Identifiers

| CASNo=182563-08-2

| PubChem=5311258

| IUPHAR_ligand = 151

| SMILES=CN1CCC(c2c3cc(N([H])C(c4ccc(F)cc4)=O)ccc3n([H])c2)CC1

}}

| Section2 = {{Chembox Properties

| Formula=C₂₁H₂₂FN₃O

| MolarMass=351.42 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

| Section3 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| Autoignition=

}}

'''LY-334,370''' is a selective [[5-HT1F receptor|5-HT_1F]] receptor [[agonist]]<ref name="pmid9641544">{{cite journal | author = Dupuis DS, Colpaert FC, Pauwels PJ | title = G-protein activation at 5-HT_1A receptors by the 5-HT_1F ligand LY-334,370 in guinea-pig brain sections and recombinant cell lines | journal = Br. J. Pharmacol. | volume = 124 | issue = 2 | pages = 283–90 | year = 1998 | pmid = 9641544 | doi = 10.1038/sj.bjp.0701832 | issn = }}</ref> which was under development by [[Eli Lilly and Company]] for the treatment of [[migraine]] headaches.<ref name="pmid10668103">{{cite journal | author = Shepheard S, Edvinsson L, Cumberbatch M, Williamson D, Mason G, Webb J, Boyce S, Hill R, Hargreaves R | title = Possible antimigraine mechanisms of action of the 5HT_1F receptor agonist LY-334,370 | journal = Cephalalgia | volume = 19 | issue = 10 | pages = 851–8 | year = 1999 | pmid = 10668103 | doi = 10.1046/j.1468-2982.1999.1910851.x | issn = }}</ref> The drug showed efficacy in a phase II clinical trial<ref name="pmid11675061">{{cite journal | author = Goldstein DJ, Roon KI, Offen WW, Ramadan NM, Phebus LA, Johnson KW, Schaus JM, Ferrari MD | title = Selective seratonin 1F (5-HT_1F) receptor agonist LY334370 for acute migraine: a randomised controlled trial | journal = Lancet | volume = 358 | issue = 9289 | pages = 1230–4 | year = 2001 | pmid = 11675061 | doi = 10.1016/S0140-6736(01)06347-4 | issn = }}</ref> but further development was halted due to toxicity detected in animals.<ref name="pmid16797716">{{cite journal | author = Ramadan NM, Buchanan TM | title = New and future migraine therapy | journal = Pharmacol. Ther. | volume = 112 | issue = 1 | pages = 199–212 | year = 2006 | pmid = 16797716 | doi = 10.1016/j.pharmthera.2005.04.010 | issn = }}</ref>

* [[Lasmiditan]], another 5-HT_1F agonist for the treatment of migraine

{{Serotonergics}}

[[Category:Serotonin receptor agonists]]

[[Category:Eli Lilly and Company]]

[[Category:Organofluorides]]

[[sr:LY-334,370]]