Aminophenazone: Difference between revisions
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEBI'). |
Added bibcode. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. |
||
(51 intermediate revisions by 36 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Non-narcotic analgesic drug}} |
|||
{{cs1 config|name-list-style=vanc}} |
|||
{{more citations needed|date=March 2020}} |
|||
{{Drugbox |
{{Drugbox |
||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 443384468 |
||
| INN = aminophenazone |
|||
| IUPAC_name = 4-dimethylamino- 1,5-dimethyl- 2-phenylpyrazol- 3-one |
|||
| IUPAC_name = 4-Dimethylamino-1,5-dimethyl-2-phenylpyrazol-3-one |
|||
| image = Aminophenazone-2d-skeletal.png |
|||
| image = Aminophenazone-2d-skeletal.png |
|||
| width = 180px |
|||
| width = 180px |
|||
| image2 = Aminophenazone-3D-balls.png |
|||
| image2 = Aminophenazone-3D-balls.png |
|||
<!--Clinical data--> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|international|aminophenazone}} |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|||
| legal_status = |
|||
| routes_of_administration = |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = N-demethylation<ref name="Caubet2007">{{cite journal | vauthors = Caubet MS, Laplante A, Caillé J, Brazier JL | title = [<sup>13</sup>C]aminopyrine and [<sup>13</sup>C]caffeine breath test: influence of gender, cigarette smoking and oral contraceptives intake | journal = Isotopes in Environmental and Health Studies | volume = 38 | issue = 2 | pages = 71–7 | date = June 2002 | pmid = 12219983 | doi = 10.1080/10256010208033314 | bibcode = 2002IEHS...38...71C | s2cid = 22002940 }}</ref> |
|||
| elimination_half-life = |
|||
| excretion = |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 58-15-1 |
|||
| ATC_prefix = N02 |
|||
| ATC_suffix = BB03 |
|||
| PubChem = 6009 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB01424 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 5787 |
| ChemSpiderID = 5787 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 01704YP3MO |
| UNII = 01704YP3MO |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| InChI = 1/C13H17N3O/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11/h5-9H,1-4H3 |
|||
| KEGG = D00556 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 160246 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 288470 |
|||
<!--Chemical data--> |
|||
| C=13 | H=17 |
|||
| N=3 | O=1 |
|||
| smiles = O=C2\C(=C(/N(N2c1ccccc1)C)C)N(C)C |
| smiles = O=C2\C(=C(/N(N2c1ccccc1)C)C)N(C)C |
||
| InChIKey = RMMXTBMQSGEXHJ-UHFFFAOYAM |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C13H17N3O/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11/h5-9H,1-4H3 |
| StdInChI = 1S/C13H17N3O/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11/h5-9H,1-4H3 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = RMMXTBMQSGEXHJ-UHFFFAOYSA-N |
| StdInChIKey = RMMXTBMQSGEXHJ-UHFFFAOYSA-N |
||
| CAS_number = 58-15-1 |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| ATC_prefix = N02 |
|||
| ATC_suffix = BB03 |
|||
| ChEBI = 160246 |
|||
| PubChem = 6009 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 288470 |
|||
| DrugBank = DB01424 |
|||
| KEGG = D00556 |
|||
| C=13 | H=17 | N=3 | O=1 |
|||
| molecular_weight = 231.29358 |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| excretion = |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category= |
|||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|||
| legal_status = |
|||
| routes_of_administration = |
|||
}} |
}} |
||
'''Aminophenazone''' (or '''aminopyrine, amidopyrine, Pyramidon''') is a non-narcotic [[analgesic]] substance. It is a [[pyrazolone]] and a derivative of [[phenazone]], which also has anti-inflammatory and [[antipyretic]] properties. While inexpensive and effective, especially in the treatment of [[rheumatism]], the drug carries a serious risk of severe and sometimes fatal side-effects, including [[agranulocytosis]].{{cn|date=April 2023}} While its production and use have been banned in many countries, including France, Thailand, India and Japan, it is still sometimes used in the developing world.{{Cn|date=April 2023}} |
|||
'''Aminophenazone''' — a [[pyrazolone]] with analgesic, anti-inflammatory, and antipyretic properties but has risk of [[agranulocytosis]]. A breath test with 13C-labeled aminopyrine has been used as a non-invasive measure of [[cytochrome]] P-450 metabolic activity in [[liver function test]]s.<ref>{{cite web |
|||
|date=2005-03-26 |
|||
A breath test with [[Carbon-13|<sup>13</sup>C]]-labeled aminopyrine has been used as a non-invasive measure of [[cytochrome]] P-450 metabolic activity in liver-function tests.<ref name="Caubet2007" /> It is also used in measuring the total body water in the human body system.<ref>{{cite web |
|||
|url=http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6009&loc=ec_rcs |
|||
| date= 2005-03-26 |
|||
|title=Aminophenazone — Compound Summary |
|||
| url= https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6009&loc=ec_rcs |
|||
|work=PubChem |
|||
| title= Aminophenazone — Compound Summary |
|||
|publisher=The National Library of Medicine |
|||
| work= PubChem |
|||
|accessdate=June 12, 2008 |
|||
| publisher= The National Library of Medicine |
|||
|description= |
|||
| access-date= June 12, 2008 |
|||
}}</ref> |
}}</ref> |
||
== History == |
|||
Aminophenazone was first synthesized by [[Friedrich Stolz]] and [[Ludwig Knorr]] in the late nineteenth century, and sold as an anti-fever medicine known as Pyramidon by [[Hoechst AG]] from 1897 until its eventual replacement{{when|date=March 2020}} by the safer [[propyphenazone]] molecule. |
|||
== Symptoms == |
|||
Symptoms of exposure to this compound include:<ref name=":0">{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/aminopyrine#section=Health-Hazard|title=aminophenazone|last=Pubchem|website=pubchem.ncbi.nlm.nih.gov|language=en|access-date=2017-11-09}}</ref> |
|||
* allergic reactions |
|||
* strong [[Spasmolytics|spasmolytic]] effect on smooth muscle of peripheral blood vessels |
|||
* irritability |
|||
* [[Cerebral palsy|palsy]] |
|||
* copious sweating |
|||
* dilated pupils |
|||
* sharp drop then rise in body temperature |
|||
* [[dysuria]] |
|||
* [[dyspnea]] |
|||
* [[anxiety]] |
|||
* [[rectal tenesmus]] |
|||
* urinary frequency |
|||
* intermittent fever |
|||
* fatty infiltration of the liver |
|||
* heart muscle degeneration |
|||
* death due to circulatory failure following [[cardiovascular collapse]] |
|||
[[Agranulocytosis]] often occurs. Ingestion may cause central nervous system stimulation, vomiting, convulsions, [[cyanosis]], [[tinnitus]], [[leukopenia]], kidney damage and coma. Ingestion may also lead to nausea, mental disturbances, [[methemoglobinemia]], chocolate-colored blood, dizziness, epigastric pain, difficulty in hearing, thready pulse and liver damage. |
|||
Other symptoms reported via ingestion include [[hemolytic anemia]], [[porphyria]] and severe gastrointestinal bleeding. [[Bone marrow depression]] also occurs. Rare eye effects include [[Myopia|acute transient myopia]]. |
|||
Chronic symptoms include: |
|||
* [[Anorexia nervosa|anorexia]] |
|||
* [[edema]] |
|||
* [[oliguria]] |
|||
* [[urticaria]] |
|||
* hypersensitivity |
|||
* [[aplastic anemia]] |
|||
* sore throat |
|||
* fever |
|||
* pharyngeal membrane |
|||
* jaundice enlargement of the liver and spleen |
|||
* [[exfoliative dermatitis]] |
|||
* gastric or duodenal erosion with perforation or bleeding |
|||
* adrenal [[necrosis]] |
|||
* [[thrombocytopenic purpura]] |
|||
* acute [[leukemia]] |
|||
When heated to decomposition this compound emits toxic fumes of [[nitrogen oxide]]s. |
|||
== Metabolism == |
|||
Amidopyrine is metabolized by demethylation and acetylation. Amidopirina metabolites are 4-aminoantipyrine, metilaminoantipirin, rubazonovaya and metilrubazonovaya acid. These acids have a reddish color. At high amidopirine doses, urine can have a reddish brown coloration, due to the presence in the urine of these acid markers.<ref>{{Cite web|url=http://soundlike.ru/english/articles.php?id=4149|title=Amidopirina|last=Vyzanie|website=soundlike.ru|access-date=2017-11-09|archive-date=2022-02-01|archive-url=https://web.archive.org/web/20220201072441/http://soundlike.ru/english/articles.php?id=4149|url-status=dead}}</ref> |
|||
== References == |
== References == |
||
{{reflist |
{{reflist}} |
||
{{Analgesics}} |
|||
[[Category:Pyrazolones]] |
[[Category:Pyrazolones]] |
||
[[Category:Antipyretics]] |
|||
[[Category:Nonsteroidal anti-inflammatory drugs]] |
|||
{{analgesic-stub}} |
{{analgesic-stub}} |
||
[[de:Aminophenazon]] |
|||
[[hu:Aminofenazon]] |
|||
[[ja:アミノピリン]] |
|||
[[pl:Aminofenazon]] |
|||
[[ru:Аминофеназон]] |