Β-Eleostearic acid: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi
→‎See also: update wl
 
(19 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{lowercasetitle}}
{{DISPLAYTITLE:''beta''-Eleostearic acid}}
{{Chembox
{{Chembox
| Watchedfields = changed
| verifiedrevid = 443419870
| verifiedrevid = 443421231
| Name = β-Eleostearic acid
| Name = β-Eleostearic acid
| ImageFile = beta-Eleostearic acid.svg
| ImageFile = beta-Eleostearic acid.svg
| ImageSize = 250px
| ImageSize = 250px
| IUPACName = (9''E'',11''E'',13''E'')-Octadeca-9,11,13-trienoic acid
| PIN = (9''E'',11''E'',13''E'')-Octadeca-9,11,13-trienoic acid
| OtherNames = (''E'',''E'',''E'')-9​,11,13-O​ctadecatr​ienoic ac​id
| OtherNames = (''E'',''E'',''E'')-9,11,13-Octadecatrienoic acid
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 544-73-0
| CASNo = 544-73-0
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| PubChem = 5282820
| UNII = LA17B88161
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| PubChem = 5282820
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445947
| ChemSpiderID = 4445947
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 38384
| ChEBI = 38384
| SMILES = O=C(O)CCCCCCC\C=C\C=C\C=C\CCCC
| SMILES = O=C(O)CCCCCCC\C=C\C=C\C=C\CCCC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5+,8-7+,10-9+
| StdInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5+,8-7+,10-9+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CUXYLFPMQMFGPL-SUTYWZMXSA-N
| StdInChIKey = CUXYLFPMQMFGPL-SUTYWZMXSA-N
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=18|H=30|O=2
| C=18 | H=30 | O=2
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPtC = 71.5
| BoilingPt =
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
}}
}}
}}
}}


'''β-Eleostearic acid''', or '''(9''E'',11''E'',13''E'')-octadeca-9,11,13-trienoic acid''', is an [[organic compound]] with formula {{chem|C|18|H|30|O|2}} or H<sub>3</sub>C-(-CH<sub>2</sub>-)<sub>3</sub>(-CH=CH-)<sub>3</sub>-(-CH<sub>2</sub>-)<sub>7</sub>-(C=O)OH. It is the all-''trans'' [[conformational isomer]] of [[octadecatrienoic acid]].
'''β-Eleostearic acid''', or '''(9''E'',11''E'',13''E'')-octadeca-9,11,13-trienoic acid''', is an [[organic compound]] with formula {{chem|C|18|H|30|O|2}} or H<sub>3</sub>C(CH<sub>2</sub>)<sub>3</sub>(CH=CH)<sub>3</sub>(CH<sub>2</sub>)<sub>7</sub>COOH. It is an all-''trans'' [[isomer]] of [[octadecatrienoic acid]].


==See also==
==See also==
* [[alpha-eleostearic acid|α-Eleostearic acid]], the (9''Z'',11''E'',13''E'')-isomer, found in [[tung oil]] and [[bitter gourd]] seed oil.
* [[α-Eleostearic acid]], the (9''Z'',11''E'',13''E'')-isomer, found in [[tung oil]] and [[bitter gourd]] seed oil.
{{Fatty acids}}

{{DEFAULTSORT:Eleostearic acid, beta-}}
{{DEFAULTSORT:Eleostearic acid, beta-}}
[[Category:fatty acids]]
[[Category:Fatty acids]]
[[Category:Alkenoic acids]]

[[Category:Polyenes]]


{{organic-compound-stub}}
{{Organic-chem-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"