Cefradine: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEBI').
 
(69 intermediate revisions by 50 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{drugbox | verifiedrevid = 411550719
{{Drugbox
|
| Watchedfields = changed
| IUPAC_name = (6''R'',7''R'')-7-{[(2''R'')-2-amino-2-(1-cyclohexa-1,4-<br>dienyl)acetyl]amino}-3-methyl-8-oxo-5-thia-<br>1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
| verifiedrevid = 443510316
| IUPAC_name = (6''R'',7''R'')-7-{[(2''R'')-2-Amino-2-(1-cyclohexa-1,4-dienyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
| image = Cefradine.svg
| image = Cefradine.svg
<!--Clinical data-->
| tradename = Intracef, Velocef
| Drugs.com = {{drugs.com|international|cefradine}}
| MedlinePlus = a601206
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral, [[Intramuscular injection|IM]], [[Intravenous therapy|IV]]
<!--Pharmacokinetic data-->
| bioavailability = Well absorbed
| protein_bound = <10%
| metabolism = Nil
| elimination_half-life = 0.9 hours
| excretion = [[Kidney|Renal]], unchanged
<!--Identifiers-->
| IUPHAR_ligand = 4830
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 38821-53-3
| ATC_prefix = J01
| ATC_suffix = DB09
| PubChem = 38103
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01333
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 34933
| ChemSpiderID = 34933
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9YA6SX5S4D
| UNII = 9YA6SX5S4D
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChI = 1/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1
| KEGG = D00264
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3547
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1604
<!--Chemical data-->
| C=16 | H=19 | N=3 | O=4 | S=1
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](C/3=C/C\C=C/C\3)N)C)C(=O)O
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](C/3=C/C\C=C/C\3)N)C)C(=O)O
| InChIKey = RDLPVSKMFDYCOR-UEKVPHQBBU
| CASNo_Ref = {{cascite|correct|CAS}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1
| StdInChI = 1S/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RDLPVSKMFDYCOR-UEKVPHQBSA-N
| StdInChIKey = RDLPVSKMFDYCOR-UEKVPHQBSA-N
| melting_point = 140
| CAS_number = 38821-53-3
| ATC_prefix = J01
| melting_high = 142
| melting_notes = (dec.)
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1604
| ATC_suffix = DB09
| ChEBI = 3547
| PubChem = 38103
| DrugBank = DB01333
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00264
| C = 16 | H = 19 | N = 3 | O = 4 | S = 1
| molecular_weight = 349.406 g/mol
| bioavailability = Well absorbed
| protein_bound = <10%
| metabolism = Nil
| elimination_half-life = 0.9 hours
| excretion = [[Kidney|Renal]], unchanged
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral, [[Intramuscular injection|IM]], [[Intravenous therapy|IV]]
}}
}}
'''Cefradine''' ([[International Nonproprietary Name|INN]]) (formerly '''cephradine''' [[British Approved Name|BAN]]) is a first generation [[cephalosporin]] [[antibiotic]].
'''Cefradine''' ([[International Nonproprietary Name|INN]]) or '''cephradine''' ([[British Approved Name|BAN]]) is a first generation [[cephalosporin]] [[antibiotic]].<ref>{{cite book|title=British National Formulary|date=2003|publisher=British Medical Association|location=London|edition=45}}</ref>


==Indications==
== Indications ==
* Respiratory tract infections (such as [[tonsillitis]], [[pharyngitis]], and [[lobar pneumonia]]) caused by group A beta-hemolytic [[streptococci]] and [[Streptococcus pneumoniae|''S. pneumoniae'']] (formerly ''D. pneumonia'').<ref group=note>[[Penicillin]] is the usual drug of choice in the treatment and prevention of streptococcal infections, including the prophylaxis of rheumatic fever. [[Cefuroxime]] is generally effective in the eradication of streptococci from the nasopharynx</ref>
It has similar spectrum of activity to [[cefalexin]].
* Otitis media caused by group A beta-hemolytic streptococci, ''S. pneumoniae'', [[Haemophilus influenzae|''H. influenzae'']], and [[staphylococci]].
* Skin and skin structure infections caused by staphylococci (penicillin-susceptible and penicillin-resistant) and beta-hemolytic streptococci.
* Urinary tract infections, including prostatitis, caused by [[Escherichia coli|''E. coli'']], [[Proteus mirabilis|''P. mirabilis'']] and ''[[Klebsiella]]'' species.


==Formulations==
== Formulations ==
Capsules containing 250 mg or 500 mg, Syrup containing 250 mg/5 ml, or vials for injection containing 500 mg or 1 g.
Cefradine is distributed in the form of capsules containing 250&nbsp;mg or 500&nbsp;mg, as a syrup containing 250&nbsp;mg/5 ml, or in vials for injection containing 500&nbsp;mg or 1&nbsp;g.{{cn|date=March 2023}}


It is not approved by the FDA for use in the United States.{{cn|date=March 2023}}
==References==

* [[British National Formulary]] ''45'' March 2003
== Synthesis ==
[[Birch reduction]] of D-α-[[phenylglycine]] led to diene ('''2'''). This was N-protected using ''tert''-butoxycarbonylazide and activated for amide formation via the mixed anhydride method using isobutylchloroformate to give '''3'''. Mixed anhydride '''3''' reacted readily with 7-aminodesacetoxycephalosporanic acid to give, after deblocking, cephradine ('''5''').

[[File:Cefradine synthesis.svg|thumb|center|700px|Cefradin synthesis:<ref>{{cite journal | vauthors = Dolfini JE, Applegate HE, Bach G, Basch H, Bernstein J, Schwartz J, Weisenborn FL | title = A new class of semisynthetic penicillins and cephalosporins derived from D-2-(1,4-cyclohexadienyl)glycine | journal = Journal of Medicinal Chemistry | volume = 14 | issue = 2 | pages = 117–9 | date = February 1971 | pmid = 5544394 | doi = 10.1021/jm00284a008 }}</ref><ref>{{US patent|3485819}}</ref><ref>{{cite patent|country=DE|number=1931722|title=α-Amino-cyclohexadienyl-alkylen-penicilline und -cephalosporine, ihre Salze, und Verfahren zu ihrer Herstellung [Alpha-amino-cyclohexadienyl-alkylene-penicillins and cephalosporins, their salts, and processes for their preparation]
|pubdate=1970-01-08
|assign=[[Bristol Myers Squibb|E. R. Squibb & Sons Inc.]]
|inventor1-last=Weisenborn |inventor1-first=Frank L.
|inventor2-last=Dolfini |inventor2-first=Joseph E.
|inventor3-last=Bach |inventor3-first=Georges G.
|inventor4-last=Bernstein |inventor4-first=Jack
}}</ref>]]{{clear-left}}

== Production names ==
The antibiotic is produced under many brand names across the world.<ref>{{cite web|url=https://www.drugs.com/international/cefradine.html|title=Cefradine|access-date=5 May 2016}}</ref>
* {{flagicon|Bangladesh}} Bangladesh: Ancef, Ancef forte, Aphrin, Avlosef, Cefadin, Cephadin, Cephran, Cephran-DS, Cusef, Cusef DS, Dicef , Dicef forte, Dolocef, Efrad, Elocef, Extracef, Extracef-DS, Intracef, Kefdrin, Lebac, Lebac Forte, Medicef, Mega-Cef, Megacin, Polycef, Procef, Procef, Procef forte, Rocef, Rocef Forte DS, Sefin, Sefin DS, Sefnin, Sefrad, Sefrad DS, Sefril, Sefril-DS, Sefro, Sefro-HS, Sephar, Sephar-DS, Septa, Sinaceph, SK-Cef, Sk-Cef DS, Supracef and Supracef-F, Torped, Ultrasef, Vecef, Vecef-DS, Velogen, Sinaceph, Velox
* {{flagicon|China}} China: Cefradine, Cephradine, Kebili, Saifuding, Shen You, Taididing, Velosef, Xianyi, and Xindadelei
* {{flagicon|Colombia}} Colombia: Cefagram, Cefrakov, Cefranil , Cefrex, and Kliacef
* {{flagicon|Egypt}} Egypt: Cefadrin, Cefadrine, Cephradine, Cephraforte, Farcosef, Fortecef, Mepadrin, Ultracef, and Velosef
* {{flagicon|France}} France: Dexef
* {{flagicon|Hong Kong}} Hong Kong: Cefradine and ChinaQualisef-250
* {{flagicon|Indonesia}} Indonesia: Dynacef, Velodine, and Velodrom
* {{flagicon|Lebanon}} Lebanon: Eskacef, Julphacef, and Velosef
* {{flagicon|Lithuania}} Lithuania: Tafril
* {{flagicon|Myanmar}} Myanmar: Sinaceph
* {{flagicon|Oman}} Oman: Ceframed, Eskasef, Omadine, and Velocef
* {{flagicon|Pakistan}} Pakistan: Abidine, Ada-Cef, Ag-cef, Aksosef, Amspor, Anasef, Antimic, Atcosef, Bactocef, Biocef, Biodine, Velora, Velosef
* {{flagicon|Peru}} Peru: Abiocef, Cefradinal, Cefradur, Cefrid, Terbodina II, Velocef, Velomicin
* {{flagicon|Philippines}} Philippines: Altozef, Racep, Senadex, Solphride, Yudinef, Zefadin, Zefradil, and Zolicef
* {{flagicon|Poland}} Poland: Tafril
* {{flagicon|Portugal}} Portugal: Cefalmin, Cefradur
* {{flagicon|South Africa}} South Africa: Cefril A
* {{flagicon|South Korea}} South Korea: Cefradine and Tricef
* {{flagicon|Taiwan}} Taiwan: Cefadin, Cefamid, Cefin, Cekodin, Cephradine, Ceponin, Lacef, Licef-A, Lisacef, Lofadine, Recef, S-60, Sefree, Sephros, Topcef, Tydine, Unifradine, and U-Save
* {{flagicon|United Kingdom}} UK: Cefradune (Kent)
* {{flagicon|Vietnam}} Vietnam: Eurosefro and Incef

== See also ==
* [[Cephapirin]]
* [[Cephacetrile]]
* [[Cefamandole]]
* [[Ampicillin]] (Has the same chemical formula)

== Notes ==
{{reflist|group=note}}

== References ==
{{reflist}}


{{CephalosporinAntiBiotics}}
{{CephalosporinAntiBiotics}}
{{Xenobiotic-sensing receptor modulators}}


[[Category:Cephalosporin antibiotics]]
[[Category:Cephalosporin antibiotics]]
[[Category:Enantiopure drugs]]
[[Category:Enantiopure drugs]]
{{antibiotic-stub}}

[[es:Cefradina]]
[[fr:Céfradine]]
[[it:Cefradina]]
[[pl:Cefradyna]]
[[pt:Cefradina]]
[[th:เซฟราดีน]]