Cefradine: Difference between revisions
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEBI'). |
|||
(69 intermediate revisions by 50 users not shown) | |||
Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{drugbox | verifiedrevid = 411550719 |
|||
{{Drugbox |
|||
| |
|||
| Watchedfields = changed |
|||
| IUPAC_name = (6''R'',7''R'')-7-{[(2''R'')-2-amino-2-(1-cyclohexa-1,4-<br>dienyl)acetyl]amino}-3-methyl-8-oxo-5-thia-<br>1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|||
| verifiedrevid = 443510316 |
|||
| IUPAC_name = (6''R'',7''R'')-7-{[(2''R'')-2-Amino-2-(1-cyclohexa-1,4-dienyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|||
| image = Cefradine.svg |
| image = Cefradine.svg |
||
<!--Clinical data--> |
|||
| tradename = Intracef, Velocef |
|||
| Drugs.com = {{drugs.com|international|cefradine}} |
|||
| MedlinePlus = a601206 |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_status = Rx-only |
|||
| routes_of_administration = Oral, [[Intramuscular injection|IM]], [[Intravenous therapy|IV]] |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = Well absorbed |
|||
| protein_bound = <10% |
|||
| metabolism = Nil |
|||
| elimination_half-life = 0.9 hours |
|||
| excretion = [[Kidney|Renal]], unchanged |
|||
<!--Identifiers--> |
|||
| IUPHAR_ligand = 4830 |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 38821-53-3 |
|||
| ATC_prefix = J01 |
|||
| ATC_suffix = DB09 |
|||
| PubChem = 38103 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = DB01333 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 34933 |
| ChemSpiderID = 34933 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 9YA6SX5S4D |
| UNII = 9YA6SX5S4D |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| InChI = 1/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
|||
| KEGG = D00264 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 3547 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 1604 |
|||
<!--Chemical data--> |
|||
| C=16 | H=19 | N=3 | O=4 | S=1 |
|||
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](C/3=C/C\C=C/C\3)N)C)C(=O)O |
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](C/3=C/C\C=C/C\3)N)C)C(=O)O |
||
| InChIKey = RDLPVSKMFDYCOR-UEKVPHQBBU |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
| StdInChI = 1S/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = RDLPVSKMFDYCOR-UEKVPHQBSA-N |
| StdInChIKey = RDLPVSKMFDYCOR-UEKVPHQBSA-N |
||
| melting_point = 140 |
|||
| CAS_number = 38821-53-3 |
|||
| |
| melting_high = 142 |
||
| melting_notes = (dec.) |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 1604 |
|||
| ATC_suffix = DB09 |
|||
| ChEBI = 3547 |
|||
| PubChem = 38103 |
|||
| DrugBank = DB01333 |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D00264 |
|||
| C = 16 | H = 19 | N = 3 | O = 4 | S = 1 |
|||
| molecular_weight = 349.406 g/mol |
|||
| bioavailability = Well absorbed |
|||
| protein_bound = <10% |
|||
| metabolism = Nil |
|||
| elimination_half-life = 0.9 hours |
|||
| excretion = [[Kidney|Renal]], unchanged |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_status = Rx-only |
|||
| routes_of_administration = Oral, [[Intramuscular injection|IM]], [[Intravenous therapy|IV]] |
|||
}} |
}} |
||
'''Cefradine''' ([[International Nonproprietary Name|INN]]) |
'''Cefradine''' ([[International Nonproprietary Name|INN]]) or '''cephradine''' ([[British Approved Name|BAN]]) is a first generation [[cephalosporin]] [[antibiotic]].<ref>{{cite book|title=British National Formulary|date=2003|publisher=British Medical Association|location=London|edition=45}}</ref> |
||
==Indications== |
== Indications == |
||
* Respiratory tract infections (such as [[tonsillitis]], [[pharyngitis]], and [[lobar pneumonia]]) caused by group A beta-hemolytic [[streptococci]] and [[Streptococcus pneumoniae|''S. pneumoniae'']] (formerly ''D. pneumonia'').<ref group=note>[[Penicillin]] is the usual drug of choice in the treatment and prevention of streptococcal infections, including the prophylaxis of rheumatic fever. [[Cefuroxime]] is generally effective in the eradication of streptococci from the nasopharynx</ref> |
|||
It has similar spectrum of activity to [[cefalexin]]. |
|||
* Otitis media caused by group A beta-hemolytic streptococci, ''S. pneumoniae'', [[Haemophilus influenzae|''H. influenzae'']], and [[staphylococci]]. |
|||
* Skin and skin structure infections caused by staphylococci (penicillin-susceptible and penicillin-resistant) and beta-hemolytic streptococci. |
|||
* Urinary tract infections, including prostatitis, caused by [[Escherichia coli|''E. coli'']], [[Proteus mirabilis|''P. mirabilis'']] and ''[[Klebsiella]]'' species. |
|||
==Formulations== |
== Formulations == |
||
Cefradine is distributed in the form of capsules containing 250 mg or 500 mg, as a syrup containing 250 mg/5 ml, or in vials for injection containing 500 mg or 1 g.{{cn|date=March 2023}} |
|||
It is not approved by the FDA for use in the United States.{{cn|date=March 2023}} |
|||
==References== |
|||
* [[British National Formulary]] ''45'' March 2003 |
|||
== Synthesis == |
|||
[[Birch reduction]] of D-α-[[phenylglycine]] led to diene ('''2'''). This was N-protected using ''tert''-butoxycarbonylazide and activated for amide formation via the mixed anhydride method using isobutylchloroformate to give '''3'''. Mixed anhydride '''3''' reacted readily with 7-aminodesacetoxycephalosporanic acid to give, after deblocking, cephradine ('''5'''). |
|||
[[File:Cefradine synthesis.svg|thumb|center|700px|Cefradin synthesis:<ref>{{cite journal | vauthors = Dolfini JE, Applegate HE, Bach G, Basch H, Bernstein J, Schwartz J, Weisenborn FL | title = A new class of semisynthetic penicillins and cephalosporins derived from D-2-(1,4-cyclohexadienyl)glycine | journal = Journal of Medicinal Chemistry | volume = 14 | issue = 2 | pages = 117–9 | date = February 1971 | pmid = 5544394 | doi = 10.1021/jm00284a008 }}</ref><ref>{{US patent|3485819}}</ref><ref>{{cite patent|country=DE|number=1931722|title=α-Amino-cyclohexadienyl-alkylen-penicilline und -cephalosporine, ihre Salze, und Verfahren zu ihrer Herstellung [Alpha-amino-cyclohexadienyl-alkylene-penicillins and cephalosporins, their salts, and processes for their preparation] |
|||
|pubdate=1970-01-08 |
|||
|assign=[[Bristol Myers Squibb|E. R. Squibb & Sons Inc.]] |
|||
|inventor1-last=Weisenborn |inventor1-first=Frank L. |
|||
|inventor2-last=Dolfini |inventor2-first=Joseph E. |
|||
|inventor3-last=Bach |inventor3-first=Georges G. |
|||
|inventor4-last=Bernstein |inventor4-first=Jack |
|||
}}</ref>]]{{clear-left}} |
|||
== Production names == |
|||
The antibiotic is produced under many brand names across the world.<ref>{{cite web|url=https://www.drugs.com/international/cefradine.html|title=Cefradine|access-date=5 May 2016}}</ref> |
|||
* {{flagicon|Bangladesh}} Bangladesh: Ancef, Ancef forte, Aphrin, Avlosef, Cefadin, Cephadin, Cephran, Cephran-DS, Cusef, Cusef DS, Dicef , Dicef forte, Dolocef, Efrad, Elocef, Extracef, Extracef-DS, Intracef, Kefdrin, Lebac, Lebac Forte, Medicef, Mega-Cef, Megacin, Polycef, Procef, Procef, Procef forte, Rocef, Rocef Forte DS, Sefin, Sefin DS, Sefnin, Sefrad, Sefrad DS, Sefril, Sefril-DS, Sefro, Sefro-HS, Sephar, Sephar-DS, Septa, Sinaceph, SK-Cef, Sk-Cef DS, Supracef and Supracef-F, Torped, Ultrasef, Vecef, Vecef-DS, Velogen, Sinaceph, Velox |
|||
* {{flagicon|China}} China: Cefradine, Cephradine, Kebili, Saifuding, Shen You, Taididing, Velosef, Xianyi, and Xindadelei |
|||
* {{flagicon|Colombia}} Colombia: Cefagram, Cefrakov, Cefranil , Cefrex, and Kliacef |
|||
* {{flagicon|Egypt}} Egypt: Cefadrin, Cefadrine, Cephradine, Cephraforte, Farcosef, Fortecef, Mepadrin, Ultracef, and Velosef |
|||
* {{flagicon|France}} France: Dexef |
|||
* {{flagicon|Hong Kong}} Hong Kong: Cefradine and ChinaQualisef-250 |
|||
* {{flagicon|Indonesia}} Indonesia: Dynacef, Velodine, and Velodrom |
|||
* {{flagicon|Lebanon}} Lebanon: Eskacef, Julphacef, and Velosef |
|||
* {{flagicon|Lithuania}} Lithuania: Tafril |
|||
* {{flagicon|Myanmar}} Myanmar: Sinaceph |
|||
* {{flagicon|Oman}} Oman: Ceframed, Eskasef, Omadine, and Velocef |
|||
* {{flagicon|Pakistan}} Pakistan: Abidine, Ada-Cef, Ag-cef, Aksosef, Amspor, Anasef, Antimic, Atcosef, Bactocef, Biocef, Biodine, Velora, Velosef |
|||
* {{flagicon|Peru}} Peru: Abiocef, Cefradinal, Cefradur, Cefrid, Terbodina II, Velocef, Velomicin |
|||
* {{flagicon|Philippines}} Philippines: Altozef, Racep, Senadex, Solphride, Yudinef, Zefadin, Zefradil, and Zolicef |
|||
* {{flagicon|Poland}} Poland: Tafril |
|||
* {{flagicon|Portugal}} Portugal: Cefalmin, Cefradur |
|||
* {{flagicon|South Africa}} South Africa: Cefril A |
|||
* {{flagicon|South Korea}} South Korea: Cefradine and Tricef |
|||
* {{flagicon|Taiwan}} Taiwan: Cefadin, Cefamid, Cefin, Cekodin, Cephradine, Ceponin, Lacef, Licef-A, Lisacef, Lofadine, Recef, S-60, Sefree, Sephros, Topcef, Tydine, Unifradine, and U-Save |
|||
* {{flagicon|United Kingdom}} UK: Cefradune (Kent) |
|||
* {{flagicon|Vietnam}} Vietnam: Eurosefro and Incef |
|||
== See also == |
|||
* [[Cephapirin]] |
|||
* [[Cephacetrile]] |
|||
* [[Cefamandole]] |
|||
* [[Ampicillin]] (Has the same chemical formula) |
|||
== Notes == |
|||
{{reflist|group=note}} |
|||
== References == |
|||
{{reflist}} |
|||
{{CephalosporinAntiBiotics}} |
{{CephalosporinAntiBiotics}} |
||
{{Xenobiotic-sensing receptor modulators}} |
|||
[[Category:Cephalosporin antibiotics]] |
[[Category:Cephalosporin antibiotics]] |
||
[[Category:Enantiopure drugs]] |
[[Category:Enantiopure drugs]] |
||
{{antibiotic-stub}} |
|||
[[es:Cefradina]] |
|||
[[fr:Céfradine]] |
|||
[[it:Cefradina]] |
|||
[[pl:Cefradyna]] |
|||
[[pt:Cefradina]] |
|||
[[th:เซฟราดีน]] |