Etilevodopa: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharmacology|erro
 
(22 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| UNII_Ref = {{fdacite|correct|FDA}}
| Watchedfields = changed
| UNII = 895X917GYE
| verifiedrevid = 443297402
| verifiedrevid = 443949574
| IUPAC_name = ethyl (2''S'')-2-amino-3-(3,4-dihydroxyphenyl)propanoate
| IUPAC_name = ethyl (2''S'')-2-amino-3-(3,4-dihydroxyphenyl)propanoate
| image = Etilevodopa.svg
| image = Etilevodopa.svg
| width = 240
| image2 = Etilevodopa 3D ball.png
| alt2 = Ball-and-stick model of the etilevodopa molecule

<!--Clinical data-->
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 37178-37-3
| ATC_prefix = N04
| ATC_suffix = BA06
| ATC_supplemental = (combination with [[decarboxylase inhibitor]])
| PubChem = 170345
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 148944
| ChemSpiderID = 148944
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI = 1/C11H15NO4/c1-2-16-11(15)8(12)5-7-3-4-9(13)10(14)6-7/h3-4,6,8,13-14H,2,5,12H2,1H3/t8-/m0/s1
| UNII = 895X917GYE
| InChIKey = NULMGOSOSZBEQL-QMMMGPOBBX
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04097

<!--Chemical data-->
| C=11 | H=15 | N=1 | O=4
| smiles = O=C(OCC)[C@@H](N)Cc1cc(O)c(O)cc1
| smiles = O=C(OCC)[C@@H](N)Cc1cc(O)c(O)cc1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 14: Line 45:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NULMGOSOSZBEQL-QMMMGPOBSA-N
| StdInChIKey = NULMGOSOSZBEQL-QMMMGPOBSA-N
| CAS_number = 37178-37-3
| ATC_prefix = N04
| ATC_suffix = BA06
| PubChem = 170345
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04097
| C=11|H=15|N=1|O=4
| molecular_weight = 225.241 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_category=
| legal_status =
| routes_of_administration =
}}
}}


'''Etilevodopa''' ('''TV-1203''') is a [[dopaminergic]] agent which was developed as a treatment for [[Parkinson's disease]].<ref>{{cite journal | vauthors = Djaldetti R, Giladi N, Hassin-Baer S, Shabtai H, Melamed E | title = Pharmacokinetics of etilevodopa compared to levodopa in patients with Parkinson's disease: an open-label, randomized, crossover study | journal = Clinical Neuropharmacology | volume = 26 | issue = 6 | pages = 322–6 | date = November–December 2003 | pmid = 14646613 | doi = 10.1097/00002826-200311000-00012 | s2cid = 23992241 }}</ref> It is the [[ethyl group|ethyl]] [[ester]] of [[levodopa]]. It was never marketed.
'''Etilevodopa''' is a [[dopaminergic]] agent. It is the [[ethyl group|ethyl]] [[ester]] of [[levodopa]].


== See also ==
== See also ==
Line 40: Line 53:


== References ==
== References ==
{{Reflist|2}}
{{Reflist}}



{{Antiparkinsonian}}
{{Antiparkinsonian}}
Line 47: Line 59:
{{Phenethylamines}}
{{Phenethylamines}}


[[Category:Neurotransmitter precursors]]


[[Category:Prodrugs]]
[[Category:Catecholamines]]
[[Category:Catecholamines]]
[[Category:Dopamine agonists]]
[[Category:Dopamine agonists]]
[[Category:Propionates]]
[[Category:Propionate esters]]
[[Category:Ethyl esters]]

[[Category:Abandoned drugs]]


{{nervous-system-drug-stub}}
{{nervous-system-drug-stub}}