Flopropione: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Spasmolytic or antispasmodic agent}}
-{{drugbox
+{{Drugbox
+| Verifiedfields = changed
+| verifiedrevid = 444212589
+| IUPAC_name = 1-(2,4,6-trihydroxyphenyl)propan-1-one
+| image = Flopropione.svg
+<!--Clinical data-->
+| tradename =
+| Drugs.com = {{drugs.com|international|flopropione}}
+| pregnancy_category =
+| legal_status =
+| routes_of_administration = Oral
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
+| CAS_number = 2295-58-1
+| ATC_prefix = none
+| ATC_suffix =
+| PubChem = 3362
 | UNII_Ref = {{fdacite|correct|FDA}}
 | UNII = 05V5NVB5Y1
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
-| verifiedrevid = 437131682
+| ChEMBL = 1605835
-| IUPAC_name        = 1-(2,4,6-trihydroxyphenyl)propan-1-one
-| image             = Flopropione.svg
-| CAS_number        = 2295-58-1
-| ATC_prefix        = none
-| ATC_suffix        =
-| PubChem           = 3362
 | KEGG_Ref = {{keggcite|correct|kegg}}
 | KEGG = D01259
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
-| C = 9 | H = 10 | O = 4
+| ChemSpiderID      = 3245
-| molecular_weight  = 182.17 g/mol
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
-| smiles            = CCC(=O)C1=C(C=C(C=C1O)O)O
+| StdInChI          = 1S/C9H10O4/c1-2-6(11)9-7(12)3-5(10)4-8(9)13/h3-4,10,12-13H,2H2,1H3
-| bioavailability   =
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
-| protein_bound     =
-| metabolism        =
+| StdInChIKey       = PTHLEKANMPKYDB-UHFFFAOYSA-N
+| DrugBank          =
-| elimination_half-life =
-| excretion         =
+<!--Chemical data-->
-| pregnancy_category=
-| legal_status      =
+| C=9 | H=10 | O=4
+| smiles = CCC(=O)C1=C(C=C(C=C1O)O)O
-| routes_of_administration = Oral
 }}
-'''Flopropione''' ('''Compacsul''', '''Cospanon''', '''Ecapron''', '''Pellegal''', '''Argobyl''', '''Floveton''', '''Saritron''', '''Spamorin''', '''Labrodax''', '''Tryalon''', '''Mirulevatin''', '''Padeskin''', '''Profenon''') is a [[muscle relaxant#Spasmolytics|spasmolytic]] or [[antispasmodic]] agent.<ref name="urlDictionary of Organic Compounds ... - Google Books">{{cite web | url = http://books.google.com/books?id=kfhQgpqxiVgC&lpg=PA1&dq=flopropione&as_brr=3&pg=PA241#v=onepage&q=flopropione&f=false | title = Dictionary of Organic Compounds ... - Google Books | format = | work = | accessdate = }}</ref> It acts as a [[5-HT1A receptor|5-HT<sub>1A</sub> receptor]] [[receptor_antagonist|antagonist]].<ref name="urlDictionary of Organic Compounds ... - Google Books">{{cite web | url = http://books.google.com/books?id=kfhQgpqxiVgC&lpg=PA1&dq=flopropione&as_brr=3&pg=PA241#v=onepage&q=flopropione&f=false | title = Dictionary of Organic Compounds ... - Google Books | format = | work = | accessdate = }}</ref>
+'''Flopropione''' ('''Compacsul''', '''Cospanon''', '''Ecapron''', '''Pellegal''', '''Argobyl''', '''Floveton''', '''Saritron''', '''Spamorin''', '''Labrodax''', '''Tryalon''', '''Mirulevatin''', '''Padeskin''', '''Profenon''') is a [[muscle relaxant#Spasmolytics|spasmolytic]] or [[antispasmodic]] agent.<ref name="urlDictionary of Organic Compounds ... - Google Books">{{cite book | url = https://books.google.com/books?id=kfhQgpqxiVgC&q=flopropione&pg=PA241 | title = Dictionary of Organic Compounds ... - Google Books | isbn = 978-0-412-54110-0 | vauthors = Buckingham J, MacDonald F | date = 26 September 1996 }}</ref> It acts as a [[COMT]] [[inhibitory postsynaptic potential|inhibitor]].<ref name="Cospanon">{{cite web | url = http://eisai.jp/medical/products/di/EPI/CSP_C_EPI.pdf | title = Cospanon label | access-date = 2016-03-14 | archive-date = 2016-10-07 | archive-url = https://web.archive.org/web/20161007001057/http://eisai.jp/medical/products/di/EPI/CSP_C_EPI.pdf | url-status = dead }}</ref>
+It is synthesized from [[phloroglucinol]] in a [[Hoesch reaction]].
+==See also==
+*[[2,4,6-Trihydroxyacetophenone]] (THAP)
 == References ==
-{{Reflist|2}}
+{{Reflist}}
 {{Muscle relaxants}}
 {{Serotonergics}}
+[[Category:Phloroglucinols]]
-[[Category:Synthetic phloroglucinols]]
 [[Category:Aromatic ketones]]
+[[Category:Serotonin receptor antagonists]]
+[[Category:3-Hydroxypropenals]]
 {{musculoskeletal-drug-stub}}