Ampiroxicam: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox
+{{cs1 config|name-list-style=vanc|display-authors=6}}
-| UNII_Ref = {{fdacite|correct|FDA}}
+{{Drugbox
-| UNII = 0PV32JZB1J
+| Verifiedfields = changed
-| verifiedrevid = 443232918
+| verifiedrevid = 444349429
-| drug_name = Ampiroxicam
-| IUPAC_name        = (''RS'')-Ethyl 1-[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)benzo[e]thiazin-4-yl]oxyethyl carbonate
+| IUPAC_name = (''RS'')-Ethyl 1-[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)benzo[e]thiazin-4-yl]oxyethyl carbonate
-| image             = Ampiroxicam.png
+| image = Ampiroxicam chemical structure.png
+| alt = Structural formula of ampiroxicam
-| imagename = 1 : 1 mixture (racemate)
+| chirality = [[Racemic mixture]]
-| width = 250px
+<!--Clinical data-->
+| tradename =
+| Drugs.com = {{drugs.com|international|ampiroxicam}}
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
+| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
+| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
+| legal_status = Rx-only
+| routes_of_administration = Oral
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
+| CAS_number = 99464-64-9
+| ATC_prefix = none
+| ATC_suffix =
+| ATC_supplemental =
+| PubChem = 2176
+| ChEBI_Ref = {{ebicite|changed|EBI}}
+| ChEBI = 31210
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 1909052
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 2091
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = 0PV32JZB1J
+| KEGG_Ref = {{keggcite|correct|kegg}}
+| KEGG = D01397
+<!--Chemical data-->
+| chemical_formula =
+| C=20 | H=21 | N=3 | O=7 | S=1
+| smiles = CCOC(=O)OC(C)OC1=C(N(S(=O)(=O)C2=CC=CC=C21)C)C(=O)NC3=CC=CC=N3
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C20H21N3O7S/c1-4-28-20(25)30-13(2)29-18-14-9-5-6-10-15(14)31(26,27)23(3)17(18)19(24)22-16-11-7-8-12-21-16/h5-13H,4H2,1-3H3,(H,21,22,24)
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = LSNWBKACGXCGAJ-UHFFFAOYSA-N
+|drug_name=
-| smiles1 = O=C(OCC)OC(OC=2c1c(cccc1)S(=O)(=O)N(C=2C(=O)Nc3ncccc3)C)C
-| CAS_number        = 99464-64-9
-| CAS_supplemental  =
-| ATC_prefix        = none
-| ATC_suffix        =
-| ATC_supplemental  =
-| PubChem           = 2176
-| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
-| DrugBank          =
-| KEGG_Ref = {{keggcite|correct|kegg}}
-| KEGG = D01397
-| chemical_formula  =
-| C=20 | H=21 | N=3 | O=7 | S=1
-| molecular_weight  = 447.46 g/mol
-| smiles            = CCOC(=O)OC(C)OC1=C(N(S(=O)(=O)C2=CC=CC=C21)C)C(=O)NC3=CC=CC=N3
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
-| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
-| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
-| legal_status      = Rx-only
-| routes_of_administration = Oral
 }}
-'''Ampiroxicam''' ([[International Nonproprietary Name|INN]]) is a [[non-steroidal anti-inflammatory drug]]. It is a prodrug of [[piroxicam]].<ref name="pmid8304243">{{cite journal |author=Carty TJ, Marfat A, Moore PF, Falkner FC, Twomey TM, Weissman A |title=Ampiroxicam, an anti-inflammatory agent which is a prodrug of piroxicam |journal=Agents Actions |volume=39 |issue=3-4 |pages=157–65 |year=1993 |month=July |pmid=8304243 |doi= 10.1007/BF01998969|url=}}</ref>
+'''Ampiroxicam''' ([[International Nonproprietary Name|INN]]) is a [[non-steroidal anti-inflammatory drug]] (NSAID). It is a [[prodrug]] of [[piroxicam]].<ref name="pmid8304243">{{cite journal | vauthors = Carty TJ, Marfat A, Moore PF, Falkner FC, Twomey TM, Weissman A | title = Ampiroxicam, an anti-inflammatory agent which is a prodrug of piroxicam | journal = Agents and Actions | volume = 39 | issue = 3–4 | pages = 157–165 | date = July 1993 | pmid = 8304243 | doi = 10.1007/BF01998969 | s2cid = 24284281 }}</ref> It has been studied for potential [[Cancer treatment|anticancer activity]], but preliminary results did not show evidence of such activity.<ref>{{cite journal | vauthors = Choi KH, Shim JH, Huong LD, Cho NP, Cho SD | title = Inhibition of myeloid cell leukemia-1 by tolfenamic acid induces apoptosis in mucoepidermoid carcinoma | journal = Oral Diseases | volume = 17 | issue = 5 | pages = 469–475 | date = July 2011 | pmid = 21496182 | doi = 10.1111/j.1601-0825.2010.01774.x }}</ref><ref>{{cite journal | vauthors = Shim JH, Shin JA, Jung JY, Choi KH, Choi ES, Cho NP, Kong G, Ryu MH, Chae JI, Cho SD | title = Chemopreventive effect of tolfenamic acid on KB human cervical cancer cells and tumor xenograft by downregulating specificity protein 1 | journal = European Journal of Cancer Prevention | volume = 20 | issue = 2 | pages = 102–111 | date = March 2011 | pmid = 21131823 | doi = 10.1097/CEJ.0b013e328341e38f }}</ref>
-==References==
+== References ==
 {{Reflist}}
 {{Anti-inflammatory and antirheumatic products}}
+{{Prostanoid signaling modulators}}
-{{NSAIDs}}
-[[Category:Non-steroidal anti-inflammatory drugs]]
+[[Category:Dermatoxins]]
+[[Category:Nonsteroidal anti-inflammatory drugs]]
+[[Category:Drugs developed by Pfizer]]
 [[Category:Prodrugs]]
-[[Category:Pyridines]]
+[[Category:2-Pyridyl compounds]]
-[[Category:Ketones]]
 [[Category:Benzothiazines]]
 [[Category:Ethers]]
 {{musculoskeletal-drug-stub}}