Mannosulfan: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{short description|Chemical compound}}
-{{drugbox
+{{Drugbox
+| verifiedrevid = 444359259
+| IUPAC_name        = 1,2,5,6-Tetrakis-O-(methylsulfonyl)-<small>D</small>-mannitol
+| image = Mannosulfan.png
+<!--Clinical data-->
+| tradename =
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
+| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
+| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|CAS}}
+| CAS_number = 7518-35-6
+| ATC_prefix = L01
+| ATC_suffix = AB03
+| ATC_supplemental =
+| PubChem = 24140
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
 | UNII_Ref = {{fdacite|correct|FDA}}
 | UNII = 135FQ40L36
+| ChemSpiderID      = 16736959
-| verifiedrevid = 443410102
-| IUPAC_name        = 1,2,5,6-tetrakis-''O''-(methylsulfonyl)-<small>D</small>-mannitol
-|synonyms=<small>[(2''R'',3''S'',4''S'',5''R'')-3,4-dihydroxy-2,5,6-tris(methylsulfonyloxy)hexyl] methanesulfonate</small>
+<!--Chemical data-->
-| image             = Mannosulfan.png
+| chemical_formula =
-| CAS_number        =
-| CAS_supplemental  =
-| ATC_prefix        = L01
-| ATC_suffix        = AB03
-| ATC_supplemental  =
-| PubChem           = 24140
-| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
-| DrugBank          =
-| chemical_formula  =
 | C=10 | H=22 | O=14 | S=4
+| smiles = CS(=O)(=O)OC[C@H]([C@H]([C@@H]([C@@H](COS(=O)(=O)C)OS(=O)(=O)C)O)O)OS(=O)(=O)C
-| molecular_weight  = 494.53 g/mol
+| synonyms = <small>[(2''R'',3''S'',4''S'',5''R'')-3,4-dihydroxy-2,5,6-tris(methylsulfonyloxy)hexyl] methanesulfonate</small>
-| smiles            = CS(=O)(=O)OC[C@H]([C@H]([C@@H]([C@@H](COS(=O)(=O)C)OS(=O)(=O)C)O)O)OS(=O)(=O)C
+| StdInChI          = 1S/C10H22O14S4/c1-25(13,14)21-5-7(23-27(3,17)18)9(11)10(12)8(24-28(4,19)20)6-22-26(2,15)16/h7-12H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1
-| bioavailability   =
+| StdInChIKey       = UUVIQYKKKBJYJT-ZYUZMQFOSA-N}}
-| protein_bound     =
-| metabolism        =
+'''Mannosulfan''' ([[International Nonproprietary Name|INN]]) is an [[alkylating antineoplastic agent|alkylating agent]] with the potential for the treatment of [[cancer]].  It is not approved by the United States FDA for cancer treatment.  Research suggests it is less toxic than the alkyl sulfonate [[Busulfan]].<ref>{{Cite book | vauthors = Jeswani G, Paul SD |doi=10.1016/B978-0-323-52727-9.00015-7 |chapter=Recent Advances in the Delivery of Chemotherapeutic Agents |title=Nano- and Microscale Drug Delivery Systems |pages=281–98 |year=2017 |isbn=978-0-323-52727-9 }}</ref>
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
-| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
-| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
-| legal_status      =
-| routes_of_administration =
-}}
+==References==
-'''Mannosulfan''' ([[International Nonproprietary Name|INN]]) is an [[alkylating antineoplastic agent|alkylating agent]] used in the treatment of [[cancer]].
+{{reflist}}
+==External links==
+*{{Commonscatinline}}
 {{Chemotherapeutic agents}}
+{{Alcohols}}
-[[Category:Sulfonate esters]]
+[[Category:Alkylsulfonates]]
+[[Category:Mesylate esters]]
 [[Category:Monosaccharides]]
 [[Category:Alkylating antineoplastic agents]]