Melevodopa: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox
+{{Drugbox
-| UNII_Ref = {{fdacite|correct|FDA}}
+| Watchedfields = changed
-| UNII = M30686U4X4
-| verifiedrevid = 443668779
+| verifiedrevid = 444522501
-| IUPAC_name        = methyl (2''S'')-2-amino-3-(3,4-dihydroxyphenyl)propanoate
+| IUPAC_name = methyl (2''S'')-2-amino-3-(3,4-dihydroxyphenyl)propanoate
-| image             = Melevodopa.svg
+| image = Melevodopa.svg
+<!--Clinical data-->
+| tradename =
+| pregnancy_category =
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number = 7101-51-1
+| ATC_prefix = N04
+| ATC_suffix = BA04
+| PubChem = 23497
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 21968
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = M30686U4X4
 | KEGG_Ref = {{keggcite|correct|kegg}}
 | KEGG = D07304
-| InChI = 1/C10H13NO4/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,12-13H,4,11H2,1H3/t7-/m0/s1
+<!--Chemical data-->
-| InChIKey = XBBDACCLCFWBSI-ZETCQYMHBU
+| C=10 | H=13 | N=1 | O=4
 | smiles = O=C(OC)[C@@H](N)Cc1cc(O)c(O)cc1
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
@@ Line 16: / Line 40: @@
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = XBBDACCLCFWBSI-ZETCQYMHSA-N
-| CAS_number        = 7101-51-1
-| ATC_prefix        = N04
-| ATC_suffix        = BA04
-| PubChem           = 23497
-| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
-| DrugBank          =
-| C=10|H=13|N=1|O=4
-| molecular_weight  = 211.215 g/mol
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_category=
-| legal_status      =
-| routes_of_administration =
 }}
+'''Melevodopa''' (brand name '''Levomet''') is a [[dopaminergic]] agent. It is the [[methyl]] [[ester]] of [[levodopa]]. It is used in tablet form as an effervescent [[prodrug]] with 250 times the water solubility of tablet levodopa.<ref>{{cite journal | vauthors = Hickey P, Stacy M | title = Available and emerging treatments for Parkinson's disease: a review | journal = Drug Design, Development and Therapy | volume = 5 | pages = 241–54 | year = 2011 | pmid = 21607020 | pmc = 3096539 | doi = 10.2147/DDDT.S11836 | doi-access = free }}</ref>
-'''Melevodopa''' is a [[dopaminergic]] agent. It is the [[methyl]] [[ester]] of [[levodopa]].
 == See also ==
@@ Line 41: / Line 49: @@
 == References ==
 {{Reflist|2}}
 {{Antiparkinsonian}}
@@ Line 47: / Line 54: @@
 {{Phenethylamines}}
+[[Category:Neurotransmitter precursors]]
-[[Category:Prodrugs]]
 [[Category:Dopamine agonists]]
 [[Category:Catecholamines]]
-[[Category:Propionates]]
+[[Category:Carboxylate esters]]
+[[Category:Methyl esters]]
+[[Category:Phenylpropanoids]]
 {{nervous-system-drug-stub}}